mirror of
https://github.com/elastic/elasticsearch.git
synced 2025-06-28 17:34:17 -04:00
ESQL: Clone ql for esql (#108773)
Part of https://github.com/elastic/elasticsearch/issues/106679 * Copy the `ql` project into a different project _just for esql_, call it `esql-core`. * Make `esql` depend only on the latter. * Fix `EsqlNodeSubclassTests`; I'm confused why this didn't bite us earlier. * Update the warning regexes in some csv tests as the exceptions have other package names now. **Note to reviewers:** Exclude the first commit when viewing the diff, as that contains only the actual copying of `ql`. The remaining commits are the actually meaningful ones. _The `build.gradle` files probably require the most attention._
This commit is contained in:
parent
06c27ec181
commit
16a5d248b7
1056 changed files with 39571 additions and 3058 deletions
|
@ -38,7 +38,7 @@ dependencies {
|
||||||
exclude group: 'net.sf.jopt-simple', module: 'jopt-simple'
|
exclude group: 'net.sf.jopt-simple', module: 'jopt-simple'
|
||||||
}
|
}
|
||||||
api(project(':modules:aggregations'))
|
api(project(':modules:aggregations'))
|
||||||
api(project(':x-pack:plugin:ql'))
|
api(project(':x-pack:plugin:esql-core'))
|
||||||
api(project(':x-pack:plugin:esql'))
|
api(project(':x-pack:plugin:esql'))
|
||||||
api(project(':x-pack:plugin:esql:compute'))
|
api(project(':x-pack:plugin:esql:compute'))
|
||||||
implementation project(path: ':libs:elasticsearch-vec')
|
implementation project(path: ':libs:elasticsearch-vec')
|
||||||
|
|
|
@ -22,6 +22,12 @@ import org.elasticsearch.compute.operator.DriverContext;
|
||||||
import org.elasticsearch.compute.operator.EvalOperator;
|
import org.elasticsearch.compute.operator.EvalOperator;
|
||||||
import org.elasticsearch.compute.operator.Operator;
|
import org.elasticsearch.compute.operator.Operator;
|
||||||
import org.elasticsearch.core.TimeValue;
|
import org.elasticsearch.core.TimeValue;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.FieldAttribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Literal;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.regex.RLikePattern;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.EsField;
|
||||||
import org.elasticsearch.xpack.esql.evaluator.EvalMapper;
|
import org.elasticsearch.xpack.esql.evaluator.EvalMapper;
|
||||||
import org.elasticsearch.xpack.esql.expression.function.scalar.date.DateTrunc;
|
import org.elasticsearch.xpack.esql.expression.function.scalar.date.DateTrunc;
|
||||||
import org.elasticsearch.xpack.esql.expression.function.scalar.math.Abs;
|
import org.elasticsearch.xpack.esql.expression.function.scalar.math.Abs;
|
||||||
|
@ -31,12 +37,6 @@ import org.elasticsearch.xpack.esql.expression.predicate.operator.arithmetic.Add
|
||||||
import org.elasticsearch.xpack.esql.expression.predicate.operator.comparison.Equals;
|
import org.elasticsearch.xpack.esql.expression.predicate.operator.comparison.Equals;
|
||||||
import org.elasticsearch.xpack.esql.planner.Layout;
|
import org.elasticsearch.xpack.esql.planner.Layout;
|
||||||
import org.elasticsearch.xpack.esql.type.EsqlDataTypes;
|
import org.elasticsearch.xpack.esql.type.EsqlDataTypes;
|
||||||
import org.elasticsearch.xpack.ql.expression.FieldAttribute;
|
|
||||||
import org.elasticsearch.xpack.ql.expression.Literal;
|
|
||||||
import org.elasticsearch.xpack.ql.expression.predicate.regex.RLikePattern;
|
|
||||||
import org.elasticsearch.xpack.ql.tree.Source;
|
|
||||||
import org.elasticsearch.xpack.ql.type.DataTypes;
|
|
||||||
import org.elasticsearch.xpack.ql.type.EsField;
|
|
||||||
import org.openjdk.jmh.annotations.Benchmark;
|
import org.openjdk.jmh.annotations.Benchmark;
|
||||||
import org.openjdk.jmh.annotations.BenchmarkMode;
|
import org.openjdk.jmh.annotations.BenchmarkMode;
|
||||||
import org.openjdk.jmh.annotations.Fork;
|
import org.openjdk.jmh.annotations.Fork;
|
||||||
|
|
|
@ -19,6 +19,6 @@ The header will provide information on the source of the failure:
|
||||||
|
|
||||||
A following header will contain the failure reason and the offending value:
|
A following header will contain the failure reason and the offending value:
|
||||||
|
|
||||||
`"org.elasticsearch.xpack.ql.InvalidArgumentException: [501379200000] out of [integer] range"`
|
`"org.elasticsearch.xpack.esql.core.InvalidArgumentException: [501379200000] out of [integer] range"`
|
||||||
|
|
||||||
|
|
||||||
|
|
14
x-pack/plugin/esql-core/README.md
Normal file
14
x-pack/plugin/esql-core/README.md
Normal file
|
@ -0,0 +1,14 @@
|
||||||
|
# ES|QL core
|
||||||
|
|
||||||
|
This project originated as a copy of the `ql` x-pack plugin.
|
||||||
|
It contains some fundamental classes used in `esql`, like `Node`, its subclasses `Expression`, `QueryPlan`, and the plan optimizer code.
|
||||||
|
Originally, `ql` shared classes between ES|QL, SQL and EQL, but ES|QL diverged far enough to justify a split.
|
||||||
|
|
||||||
|
## Warning
|
||||||
|
|
||||||
|
- **Consider the contents of this project untested.**
|
||||||
|
There may be some tests in `sql` and `eql` that may have indirectly covered the initial version of this (when it was copied from `ql`);
|
||||||
|
but neither do these tests apply to `esql`, nor do they even run against this.
|
||||||
|
- **Consider this project technical debt.**
|
||||||
|
The contents of this project need to be consolidated with the `esql` plugin.
|
||||||
|
In particular, there is a significant amount of code (or code paths) that are not used/executed at all in `esql`.
|
24
x-pack/plugin/esql-core/build.gradle
Normal file
24
x-pack/plugin/esql-core/build.gradle
Normal file
|
@ -0,0 +1,24 @@
|
||||||
|
apply plugin: 'elasticsearch.internal-es-plugin'
|
||||||
|
apply plugin: 'elasticsearch.internal-test-artifact'
|
||||||
|
|
||||||
|
esplugin {
|
||||||
|
name 'x-pack-esql-core'
|
||||||
|
description 'Elasticsearch infrastructure plugin for ESQL'
|
||||||
|
classname 'org.elasticsearch.xpack.esql.core.plugin.EsqlCorePlugin'
|
||||||
|
extendedPlugins = ['x-pack-core']
|
||||||
|
}
|
||||||
|
|
||||||
|
base {
|
||||||
|
archivesName = 'x-pack-esql-core'
|
||||||
|
}
|
||||||
|
|
||||||
|
dependencies {
|
||||||
|
api "org.antlr:antlr4-runtime:${versions.antlr4}"
|
||||||
|
api project(path: xpackModule('mapper-version'))
|
||||||
|
compileOnly project(path: xpackModule('core'))
|
||||||
|
testApi(project(xpackModule('esql-core:test-fixtures'))) {
|
||||||
|
exclude group: 'org.elasticsearch.plugin', module: 'esql-core'
|
||||||
|
}
|
||||||
|
testImplementation project(':test:framework')
|
||||||
|
testImplementation(testArtifact(project(xpackModule('core'))))
|
||||||
|
}
|
26
x-pack/plugin/esql-core/licenses/antlr4-runtime-LICENSE.txt
Normal file
26
x-pack/plugin/esql-core/licenses/antlr4-runtime-LICENSE.txt
Normal file
|
@ -0,0 +1,26 @@
|
||||||
|
[The "BSD license"]
|
||||||
|
Copyright (c) 2015 Terence Parr, Sam Harwell
|
||||||
|
All rights reserved.
|
||||||
|
|
||||||
|
Redistribution and use in source and binary forms, with or without
|
||||||
|
modification, are permitted provided that the following conditions
|
||||||
|
are met:
|
||||||
|
|
||||||
|
1. Redistributions of source code must retain the above copyright
|
||||||
|
notice, this list of conditions and the following disclaimer.
|
||||||
|
2. Redistributions in binary form must reproduce the above copyright
|
||||||
|
notice, this list of conditions and the following disclaimer in the
|
||||||
|
documentation and/or other materials provided with the distribution.
|
||||||
|
3. The name of the author may not be used to endorse or promote products
|
||||||
|
derived from this software without specific prior written permission.
|
||||||
|
|
||||||
|
THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
|
||||||
|
IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
|
||||||
|
OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
|
||||||
|
IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
|
||||||
|
INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
|
||||||
|
NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
|
||||||
|
DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
|
||||||
|
THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
|
||||||
|
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
|
||||||
|
THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
|
|
@ -0,0 +1,27 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Exception thrown when unable to continue processing client request,
|
||||||
|
* in cases such as invalid query parameter or failure to apply requested processing to given data.
|
||||||
|
* It's meant as a generic equivalent to QlIllegalArgumentException (that's a server exception).
|
||||||
|
* TODO: reason for [E|S|ES]QL specializations of QlIllegalArgumentException?
|
||||||
|
* TODO: the intended use of ql.ParsingException, vs its [E|S|ES]QL equivalents, subclassed from the respective XxxClientException?
|
||||||
|
* Same for PlanningException.
|
||||||
|
*/
|
||||||
|
public class InvalidArgumentException extends QlClientException {
|
||||||
|
|
||||||
|
public InvalidArgumentException(String message, Object... args) {
|
||||||
|
super(message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
public InvalidArgumentException(Throwable cause, String message, Object... args) {
|
||||||
|
super(cause, message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
|
@ -0,0 +1,56 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import static org.elasticsearch.common.logging.LoggerMessageFormat.format;
|
||||||
|
|
||||||
|
public class ParsingException extends QlClientException {
|
||||||
|
private final int line;
|
||||||
|
private final int charPositionInLine;
|
||||||
|
|
||||||
|
public ParsingException(String message, Exception cause, int line, int charPositionInLine) {
|
||||||
|
super(message, cause);
|
||||||
|
this.line = line;
|
||||||
|
this.charPositionInLine = charPositionInLine;
|
||||||
|
}
|
||||||
|
|
||||||
|
public ParsingException(String message, Object... args) {
|
||||||
|
this(Source.EMPTY, message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
public ParsingException(Source source, String message, Object... args) {
|
||||||
|
super(message, args);
|
||||||
|
this.line = source.source().getLineNumber();
|
||||||
|
this.charPositionInLine = source.source().getColumnNumber();
|
||||||
|
}
|
||||||
|
|
||||||
|
public ParsingException(Exception cause, Source source, String message, Object... args) {
|
||||||
|
super(cause, message, args);
|
||||||
|
this.line = source.source().getLineNumber();
|
||||||
|
this.charPositionInLine = source.source().getColumnNumber();
|
||||||
|
}
|
||||||
|
|
||||||
|
public int getLineNumber() {
|
||||||
|
return line;
|
||||||
|
}
|
||||||
|
|
||||||
|
public int getColumnNumber() {
|
||||||
|
return charPositionInLine + 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String getErrorMessage() {
|
||||||
|
return super.getMessage();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getMessage() {
|
||||||
|
return format("line {}:{}: {}", getLineNumber(), getColumnNumber(), getErrorMessage());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,41 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core;
|
||||||
|
|
||||||
|
import org.elasticsearch.rest.RestStatus;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Exception thrown by performing client (or user) code.
|
||||||
|
* Typically it means the given action or query is incorrect and needs fixing.
|
||||||
|
*/
|
||||||
|
public class QlClientException extends QlException {
|
||||||
|
|
||||||
|
protected QlClientException(String message, Object... args) {
|
||||||
|
super(message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlClientException(String message, Throwable cause, boolean enableSuppression, boolean writableStackTrace) {
|
||||||
|
super(message, cause, enableSuppression, writableStackTrace);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlClientException(String message, Throwable cause) {
|
||||||
|
super(message, cause);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlClientException(Throwable cause, String message, Object... args) {
|
||||||
|
super(cause, message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlClientException(Throwable cause) {
|
||||||
|
super(cause);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public RestStatus status() {
|
||||||
|
return RestStatus.BAD_REQUEST;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,34 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core;
|
||||||
|
|
||||||
|
import org.elasticsearch.ElasticsearchException;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Base class for all QL exceptions. Useful as a catch-all.
|
||||||
|
*/
|
||||||
|
public abstract class QlException extends ElasticsearchException {
|
||||||
|
public QlException(String message, Throwable cause, boolean enableSuppression, boolean writableStackTrace) {
|
||||||
|
super(message, cause, enableSuppression, writableStackTrace);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlException(String message, Throwable cause) {
|
||||||
|
super(message, cause);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlException(String message, Object... args) {
|
||||||
|
super(message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlException(Throwable cause, String message, Object... args) {
|
||||||
|
super(message, cause, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlException(Throwable cause) {
|
||||||
|
super(cause);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,33 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core;
|
||||||
|
|
||||||
|
public class QlIllegalArgumentException extends QlServerException {
|
||||||
|
public QlIllegalArgumentException(String message, Throwable cause, boolean enableSuppression, boolean writableStackTrace) {
|
||||||
|
super(message, cause, enableSuppression, writableStackTrace);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlIllegalArgumentException(String message, Throwable cause) {
|
||||||
|
super(message, cause);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlIllegalArgumentException(String message, Object... args) {
|
||||||
|
super(message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlIllegalArgumentException(Throwable cause, String message, Object... args) {
|
||||||
|
super(cause, message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlIllegalArgumentException(String message) {
|
||||||
|
super(message);
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlIllegalArgumentException(Throwable cause) {
|
||||||
|
super(cause);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,34 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Exception triggered inside server-side code.
|
||||||
|
* Typically a validation error or worse, a bug.
|
||||||
|
*/
|
||||||
|
public abstract class QlServerException extends QlException {
|
||||||
|
|
||||||
|
protected QlServerException(String message, Object... args) {
|
||||||
|
super(message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlServerException(String message, Throwable cause, boolean enableSuppression, boolean writableStackTrace) {
|
||||||
|
super(message, cause, enableSuppression, writableStackTrace);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlServerException(String message, Throwable cause) {
|
||||||
|
super(message, cause);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlServerException(Throwable cause, String message, Object... args) {
|
||||||
|
super(cause, message, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected QlServerException(Throwable cause) {
|
||||||
|
super(cause);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,259 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.analyzer;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Attribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.FieldAttribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Literal;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.UnresolvedAttribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.Function;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.FunctionDefinition;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.FunctionRegistry;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.UnresolvedFunction;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.logical.BinaryLogic;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.operator.comparison.Equals;
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.logical.Filter;
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.logical.LogicalPlan;
|
||||||
|
import org.elasticsearch.xpack.esql.core.rule.ParameterizedRule;
|
||||||
|
import org.elasticsearch.xpack.esql.core.rule.Rule;
|
||||||
|
import org.elasticsearch.xpack.esql.core.session.Configuration;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.InvalidMappedField;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.UnsupportedEsField;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
import java.util.function.Predicate;
|
||||||
|
import java.util.function.Supplier;
|
||||||
|
|
||||||
|
import static java.util.Arrays.asList;
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.BOOLEAN;
|
||||||
|
|
||||||
|
public final class AnalyzerRules {
|
||||||
|
|
||||||
|
public static class AddMissingEqualsToBoolField extends AnalyzerRule<Filter> {
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected LogicalPlan rule(Filter filter) {
|
||||||
|
if (filter.resolved() == false) {
|
||||||
|
return filter;
|
||||||
|
}
|
||||||
|
// check the condition itself
|
||||||
|
Expression condition = replaceRawBoolFieldWithEquals(filter.condition());
|
||||||
|
// otherwise look for binary logic
|
||||||
|
if (condition == filter.condition()) {
|
||||||
|
condition = condition.transformUp(
|
||||||
|
BinaryLogic.class,
|
||||||
|
b -> b.replaceChildren(asList(replaceRawBoolFieldWithEquals(b.left()), replaceRawBoolFieldWithEquals(b.right())))
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (condition != filter.condition()) {
|
||||||
|
filter = filter.with(condition);
|
||||||
|
}
|
||||||
|
return filter;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static Expression replaceRawBoolFieldWithEquals(Expression e) {
|
||||||
|
if (e instanceof FieldAttribute && e.dataType() == BOOLEAN) {
|
||||||
|
e = new Equals(e.source(), e, Literal.of(e, Boolean.TRUE));
|
||||||
|
}
|
||||||
|
return e;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected boolean skipResolved() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract static class AnalyzerRule<SubPlan extends LogicalPlan> extends Rule<SubPlan, LogicalPlan> {
|
||||||
|
|
||||||
|
// transformUp (post-order) - that is first children and then the node
|
||||||
|
// but with a twist; only if the tree is not resolved or analyzed
|
||||||
|
@Override
|
||||||
|
public final LogicalPlan apply(LogicalPlan plan) {
|
||||||
|
return plan.transformUp(typeToken(), t -> t.analyzed() || skipResolved() && t.resolved() ? t : rule(t));
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract LogicalPlan rule(SubPlan plan);
|
||||||
|
|
||||||
|
protected boolean skipResolved() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract static class ParameterizedAnalyzerRule<SubPlan extends LogicalPlan, P> extends ParameterizedRule<
|
||||||
|
SubPlan,
|
||||||
|
LogicalPlan,
|
||||||
|
P> {
|
||||||
|
|
||||||
|
// transformUp (post-order) - that is first children and then the node
|
||||||
|
// but with a twist; only if the tree is not resolved or analyzed
|
||||||
|
public final LogicalPlan apply(LogicalPlan plan, P context) {
|
||||||
|
return plan.transformUp(typeToken(), t -> t.analyzed() || skipResolved() && t.resolved() ? t : rule(t, context));
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract LogicalPlan rule(SubPlan plan, P context);
|
||||||
|
|
||||||
|
protected boolean skipResolved() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract static class BaseAnalyzerRule extends AnalyzerRule<LogicalPlan> {
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected LogicalPlan rule(LogicalPlan plan) {
|
||||||
|
if (plan.childrenResolved() == false) {
|
||||||
|
return plan;
|
||||||
|
}
|
||||||
|
return doRule(plan);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract LogicalPlan doRule(LogicalPlan plan);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Function resolveFunction(UnresolvedFunction uf, Configuration configuration, FunctionRegistry functionRegistry) {
|
||||||
|
Function f = null;
|
||||||
|
if (uf.analyzed()) {
|
||||||
|
f = uf;
|
||||||
|
} else if (uf.childrenResolved() == false) {
|
||||||
|
f = uf;
|
||||||
|
} else {
|
||||||
|
String functionName = functionRegistry.resolveAlias(uf.name());
|
||||||
|
if (functionRegistry.functionExists(functionName) == false) {
|
||||||
|
f = uf.missing(functionName, functionRegistry.listFunctions());
|
||||||
|
} else {
|
||||||
|
FunctionDefinition def = functionRegistry.resolveFunction(functionName);
|
||||||
|
f = uf.buildResolved(configuration, def);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return f;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Attribute> maybeResolveAgainstList(
|
||||||
|
UnresolvedAttribute u,
|
||||||
|
Collection<Attribute> attrList,
|
||||||
|
java.util.function.Function<Attribute, Attribute> fieldInspector
|
||||||
|
) {
|
||||||
|
// first take into account the qualified version
|
||||||
|
final String qualifier = u.qualifier();
|
||||||
|
final String name = u.name();
|
||||||
|
final boolean qualified = u.qualifier() != null;
|
||||||
|
|
||||||
|
Predicate<Attribute> predicate = a -> {
|
||||||
|
return qualified ? Objects.equals(qualifier, a.qualifiedName()) :
|
||||||
|
// if the field is unqualified
|
||||||
|
// first check the names directly
|
||||||
|
(Objects.equals(name, a.name()))
|
||||||
|
// but also if the qualifier might not be quoted and if there's any ambiguity with nested fields
|
||||||
|
|| Objects.equals(name, a.qualifiedName());
|
||||||
|
|
||||||
|
};
|
||||||
|
return maybeResolveAgainstList(predicate, () -> u, attrList, false, fieldInspector);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Attribute> maybeResolveAgainstList(
|
||||||
|
Predicate<Attribute> matcher,
|
||||||
|
Supplier<UnresolvedAttribute> unresolved,
|
||||||
|
Collection<Attribute> attrList,
|
||||||
|
boolean isPattern,
|
||||||
|
java.util.function.Function<Attribute, Attribute> fieldInspector
|
||||||
|
) {
|
||||||
|
List<Attribute> matches = new ArrayList<>();
|
||||||
|
|
||||||
|
for (Attribute attribute : attrList) {
|
||||||
|
if (attribute.synthetic() == false) {
|
||||||
|
boolean match = matcher.test(attribute);
|
||||||
|
if (match) {
|
||||||
|
matches.add(attribute);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (matches.isEmpty()) {
|
||||||
|
return matches;
|
||||||
|
}
|
||||||
|
|
||||||
|
UnresolvedAttribute ua = unresolved.get();
|
||||||
|
// found exact match or multiple if pattern
|
||||||
|
if (matches.size() == 1 || isPattern) {
|
||||||
|
// NB: only add the location if the match is univocal; b/c otherwise adding the location will overwrite any preexisting one
|
||||||
|
matches.replaceAll(e -> fieldInspector.apply(e));
|
||||||
|
return matches;
|
||||||
|
}
|
||||||
|
|
||||||
|
// report ambiguity
|
||||||
|
List<String> refs = matches.stream().sorted((a, b) -> {
|
||||||
|
int lineDiff = a.sourceLocation().getLineNumber() - b.sourceLocation().getLineNumber();
|
||||||
|
int colDiff = a.sourceLocation().getColumnNumber() - b.sourceLocation().getColumnNumber();
|
||||||
|
return lineDiff != 0 ? lineDiff : (colDiff != 0 ? colDiff : a.qualifiedName().compareTo(b.qualifiedName()));
|
||||||
|
})
|
||||||
|
.map(
|
||||||
|
a -> "line "
|
||||||
|
+ a.sourceLocation().toString().substring(1)
|
||||||
|
+ " ["
|
||||||
|
+ (a.qualifier() != null ? "\"" + a.qualifier() + "\".\"" + a.name() + "\"" : a.name())
|
||||||
|
+ "]"
|
||||||
|
)
|
||||||
|
.toList();
|
||||||
|
|
||||||
|
return singletonList(
|
||||||
|
ua.withUnresolvedMessage(
|
||||||
|
"Reference ["
|
||||||
|
+ ua.qualifiedName()
|
||||||
|
+ "] is ambiguous (to disambiguate use quotes or qualifiers); "
|
||||||
|
+ "matches any of "
|
||||||
|
+ refs
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Attribute handleSpecialFields(UnresolvedAttribute u, Attribute named, boolean allowCompound) {
|
||||||
|
// if it's a object/compound type, keep it unresolved with a nice error message
|
||||||
|
if (named instanceof FieldAttribute fa) {
|
||||||
|
|
||||||
|
// incompatible mappings
|
||||||
|
if (fa.field() instanceof InvalidMappedField imf) {
|
||||||
|
named = u.withUnresolvedMessage("Cannot use field [" + fa.name() + "] due to ambiguities being " + imf.errorMessage());
|
||||||
|
}
|
||||||
|
// unsupported types
|
||||||
|
else if (DataTypes.isUnsupported(fa.dataType())) {
|
||||||
|
UnsupportedEsField unsupportedField = (UnsupportedEsField) fa.field();
|
||||||
|
if (unsupportedField.hasInherited()) {
|
||||||
|
named = u.withUnresolvedMessage(
|
||||||
|
"Cannot use field ["
|
||||||
|
+ fa.name()
|
||||||
|
+ "] with unsupported type ["
|
||||||
|
+ unsupportedField.getOriginalType()
|
||||||
|
+ "] in hierarchy (field ["
|
||||||
|
+ unsupportedField.getInherited()
|
||||||
|
+ "])"
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
named = u.withUnresolvedMessage(
|
||||||
|
"Cannot use field [" + fa.name() + "] with unsupported type [" + unsupportedField.getOriginalType() + "]"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// compound fields
|
||||||
|
else if (allowCompound == false && DataTypes.isPrimitive(fa.dataType()) == false) {
|
||||||
|
named = u.withUnresolvedMessage(
|
||||||
|
"Cannot use field [" + fa.name() + "] type [" + fa.dataType().typeName() + "] only its subfields"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// make sure to copy the resolved attribute with the proper location
|
||||||
|
return named.withLocation(u.source());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,51 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.analyzer;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.logical.LogicalPlan;
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.logical.UnresolvedRelation;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
|
||||||
|
// Since the pre-analyzer only inspect (and does NOT transform) the tree
|
||||||
|
// it is not built as a rule executor.
|
||||||
|
// Further more it applies 'the rules' only once and needs to return some
|
||||||
|
// state back.
|
||||||
|
public class PreAnalyzer {
|
||||||
|
|
||||||
|
public static class PreAnalysis {
|
||||||
|
public static final PreAnalysis EMPTY = new PreAnalysis(emptyList());
|
||||||
|
|
||||||
|
public final List<TableInfo> indices;
|
||||||
|
|
||||||
|
public PreAnalysis(List<TableInfo> indices) {
|
||||||
|
this.indices = indices;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public PreAnalysis preAnalyze(LogicalPlan plan) {
|
||||||
|
if (plan.analyzed()) {
|
||||||
|
return PreAnalysis.EMPTY;
|
||||||
|
}
|
||||||
|
|
||||||
|
return doPreAnalyze(plan);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static PreAnalysis doPreAnalyze(LogicalPlan plan) {
|
||||||
|
List<TableInfo> indices = new ArrayList<>();
|
||||||
|
|
||||||
|
plan.forEachUp(UnresolvedRelation.class, p -> indices.add(new TableInfo(p.table(), p.frozen())));
|
||||||
|
|
||||||
|
// mark plan as preAnalyzed (if it were marked, there would be no analysis)
|
||||||
|
plan.forEachUp(LogicalPlan::setPreAnalyzed);
|
||||||
|
|
||||||
|
return new PreAnalysis(indices);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,29 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.analyzer;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.TableIdentifier;
|
||||||
|
|
||||||
|
public class TableInfo {
|
||||||
|
|
||||||
|
private final TableIdentifier id;
|
||||||
|
private final boolean isFrozen;
|
||||||
|
|
||||||
|
public TableInfo(TableIdentifier id, boolean isFrozen) {
|
||||||
|
this.id = id;
|
||||||
|
this.isFrozen = isFrozen;
|
||||||
|
}
|
||||||
|
|
||||||
|
public TableIdentifier id() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean isFrozen() {
|
||||||
|
return isFrozen;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,31 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.analyzer;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.common.Failure;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.logical.Filter;
|
||||||
|
import org.elasticsearch.xpack.esql.core.plan.logical.LogicalPlan;
|
||||||
|
|
||||||
|
import java.util.Set;
|
||||||
|
|
||||||
|
import static org.elasticsearch.xpack.esql.core.common.Failure.fail;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.BOOLEAN;
|
||||||
|
|
||||||
|
public final class VerifierChecks {
|
||||||
|
|
||||||
|
public static void checkFilterConditionType(LogicalPlan p, Set<Failure> localFailures) {
|
||||||
|
if (p instanceof Filter) {
|
||||||
|
Expression condition = ((Filter) p).condition();
|
||||||
|
if (condition.dataType() != BOOLEAN) {
|
||||||
|
localFailures.add(fail(condition, "Condition expression needs to be boolean, found [{}]", condition.dataType()));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
|
@ -0,0 +1,362 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.async;
|
||||||
|
|
||||||
|
import org.apache.logging.log4j.LogManager;
|
||||||
|
import org.apache.logging.log4j.Logger;
|
||||||
|
import org.elasticsearch.ExceptionsHelper;
|
||||||
|
import org.elasticsearch.action.ActionListener;
|
||||||
|
import org.elasticsearch.action.ActionResponse;
|
||||||
|
import org.elasticsearch.action.support.ListenerTimeouts;
|
||||||
|
import org.elasticsearch.client.internal.Client;
|
||||||
|
import org.elasticsearch.cluster.service.ClusterService;
|
||||||
|
import org.elasticsearch.common.UUIDs;
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteableRegistry;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.common.util.BigArrays;
|
||||||
|
import org.elasticsearch.core.TimeValue;
|
||||||
|
import org.elasticsearch.index.engine.DocumentMissingException;
|
||||||
|
import org.elasticsearch.index.engine.VersionConflictEngineException;
|
||||||
|
import org.elasticsearch.tasks.CancellableTask;
|
||||||
|
import org.elasticsearch.tasks.Task;
|
||||||
|
import org.elasticsearch.tasks.TaskAwareRequest;
|
||||||
|
import org.elasticsearch.tasks.TaskId;
|
||||||
|
import org.elasticsearch.tasks.TaskManager;
|
||||||
|
import org.elasticsearch.threadpool.Scheduler;
|
||||||
|
import org.elasticsearch.threadpool.ThreadPool;
|
||||||
|
import org.elasticsearch.xpack.core.ClientHelper;
|
||||||
|
import org.elasticsearch.xpack.core.async.AsyncExecutionId;
|
||||||
|
import org.elasticsearch.xpack.core.async.AsyncTask;
|
||||||
|
import org.elasticsearch.xpack.core.async.AsyncTaskIndexService;
|
||||||
|
import org.elasticsearch.xpack.core.async.StoredAsyncResponse;
|
||||||
|
import org.elasticsearch.xpack.core.async.StoredAsyncTask;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.concurrent.atomic.AtomicReference;
|
||||||
|
|
||||||
|
import static org.elasticsearch.core.Strings.format;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Service for managing EQL requests
|
||||||
|
*/
|
||||||
|
public class AsyncTaskManagementService<
|
||||||
|
Request extends TaskAwareRequest,
|
||||||
|
Response extends ActionResponse,
|
||||||
|
T extends StoredAsyncTask<Response>> {
|
||||||
|
|
||||||
|
private static final Logger logger = LogManager.getLogger(AsyncTaskManagementService.class);
|
||||||
|
|
||||||
|
private final TaskManager taskManager;
|
||||||
|
private final String action;
|
||||||
|
private final AsyncTaskIndexService<StoredAsyncResponse<Response>> asyncTaskIndexService;
|
||||||
|
private final AsyncOperation<Request, Response, T> operation;
|
||||||
|
private final ThreadPool threadPool;
|
||||||
|
private final ClusterService clusterService;
|
||||||
|
private final Class<T> taskClass;
|
||||||
|
|
||||||
|
public interface AsyncOperation<
|
||||||
|
Request extends TaskAwareRequest,
|
||||||
|
Response extends ActionResponse,
|
||||||
|
T extends CancellableTask & AsyncTask> {
|
||||||
|
|
||||||
|
T createTask(
|
||||||
|
Request request,
|
||||||
|
long id,
|
||||||
|
String type,
|
||||||
|
String action,
|
||||||
|
TaskId parentTaskId,
|
||||||
|
Map<String, String> headers,
|
||||||
|
Map<String, String> originHeaders,
|
||||||
|
AsyncExecutionId asyncExecutionId
|
||||||
|
);
|
||||||
|
|
||||||
|
void execute(Request request, T task, ActionListener<Response> listener);
|
||||||
|
|
||||||
|
Response initialResponse(T task);
|
||||||
|
|
||||||
|
Response readResponse(StreamInput inputStream) throws IOException;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for EqlSearchRequest that creates an async version of EqlSearchTask
|
||||||
|
*/
|
||||||
|
private class AsyncRequestWrapper implements TaskAwareRequest {
|
||||||
|
private final Request request;
|
||||||
|
private final String doc;
|
||||||
|
private final String node;
|
||||||
|
|
||||||
|
AsyncRequestWrapper(Request request, String node) {
|
||||||
|
this.request = request;
|
||||||
|
this.doc = UUIDs.randomBase64UUID();
|
||||||
|
this.node = node;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setParentTask(TaskId taskId) {
|
||||||
|
request.setParentTask(taskId);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public TaskId getParentTask() {
|
||||||
|
return request.getParentTask();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setRequestId(long requestId) {
|
||||||
|
request.setRequestId(requestId);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public long getRequestId() {
|
||||||
|
return request.getRequestId();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Task createTask(long id, String type, String actionName, TaskId parentTaskId, Map<String, String> headers) {
|
||||||
|
Map<String, String> originHeaders = ClientHelper.getPersistableSafeSecurityHeaders(
|
||||||
|
threadPool.getThreadContext(),
|
||||||
|
clusterService.state()
|
||||||
|
);
|
||||||
|
return operation.createTask(
|
||||||
|
request,
|
||||||
|
id,
|
||||||
|
type,
|
||||||
|
actionName,
|
||||||
|
parentTaskId,
|
||||||
|
headers,
|
||||||
|
originHeaders,
|
||||||
|
new AsyncExecutionId(doc, new TaskId(node, id))
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getDescription() {
|
||||||
|
return request.getDescription();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public AsyncTaskManagementService(
|
||||||
|
String index,
|
||||||
|
Client client,
|
||||||
|
String origin,
|
||||||
|
NamedWriteableRegistry registry,
|
||||||
|
TaskManager taskManager,
|
||||||
|
String action,
|
||||||
|
AsyncOperation<Request, Response, T> operation,
|
||||||
|
Class<T> taskClass,
|
||||||
|
ClusterService clusterService,
|
||||||
|
ThreadPool threadPool,
|
||||||
|
BigArrays bigArrays
|
||||||
|
) {
|
||||||
|
this.taskManager = taskManager;
|
||||||
|
this.action = action;
|
||||||
|
this.operation = operation;
|
||||||
|
this.taskClass = taskClass;
|
||||||
|
this.asyncTaskIndexService = new AsyncTaskIndexService<>(
|
||||||
|
index,
|
||||||
|
clusterService,
|
||||||
|
threadPool.getThreadContext(),
|
||||||
|
client,
|
||||||
|
origin,
|
||||||
|
i -> new StoredAsyncResponse<>(operation::readResponse, i),
|
||||||
|
registry,
|
||||||
|
bigArrays
|
||||||
|
);
|
||||||
|
this.clusterService = clusterService;
|
||||||
|
this.threadPool = threadPool;
|
||||||
|
}
|
||||||
|
|
||||||
|
public void asyncExecute(
|
||||||
|
Request request,
|
||||||
|
TimeValue waitForCompletionTimeout,
|
||||||
|
TimeValue keepAlive,
|
||||||
|
boolean keepOnCompletion,
|
||||||
|
ActionListener<Response> listener
|
||||||
|
) {
|
||||||
|
String nodeId = clusterService.localNode().getId();
|
||||||
|
try (var ignored = threadPool.getThreadContext().newTraceContext()) {
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
T searchTask = (T) taskManager.register("transport", action + "[a]", new AsyncRequestWrapper(request, nodeId));
|
||||||
|
boolean operationStarted = false;
|
||||||
|
try {
|
||||||
|
operation.execute(
|
||||||
|
request,
|
||||||
|
searchTask,
|
||||||
|
wrapStoringListener(searchTask, waitForCompletionTimeout, keepAlive, keepOnCompletion, listener)
|
||||||
|
);
|
||||||
|
operationStarted = true;
|
||||||
|
} finally {
|
||||||
|
// If we didn't start operation for any reason, we need to clean up the task that we have created
|
||||||
|
if (operationStarted == false) {
|
||||||
|
taskManager.unregister(searchTask);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private ActionListener<Response> wrapStoringListener(
|
||||||
|
T searchTask,
|
||||||
|
TimeValue waitForCompletionTimeout,
|
||||||
|
TimeValue keepAlive,
|
||||||
|
boolean keepOnCompletion,
|
||||||
|
ActionListener<Response> listener
|
||||||
|
) {
|
||||||
|
AtomicReference<ActionListener<Response>> exclusiveListener = new AtomicReference<>(listener);
|
||||||
|
// This is will performed in case of timeout
|
||||||
|
Scheduler.ScheduledCancellable timeoutHandler = threadPool.schedule(() -> {
|
||||||
|
ActionListener<Response> acquiredListener = exclusiveListener.getAndSet(null);
|
||||||
|
if (acquiredListener != null) {
|
||||||
|
acquiredListener.onResponse(operation.initialResponse(searchTask));
|
||||||
|
}
|
||||||
|
}, waitForCompletionTimeout, threadPool.executor(ThreadPool.Names.SEARCH));
|
||||||
|
|
||||||
|
// This will be performed at the end of normal execution
|
||||||
|
return ActionListener.wrap(response -> {
|
||||||
|
ActionListener<Response> acquiredListener = exclusiveListener.getAndSet(null);
|
||||||
|
if (acquiredListener != null) {
|
||||||
|
// We finished before timeout
|
||||||
|
timeoutHandler.cancel();
|
||||||
|
if (keepOnCompletion) {
|
||||||
|
storeResults(
|
||||||
|
searchTask,
|
||||||
|
new StoredAsyncResponse<>(response, threadPool.absoluteTimeInMillis() + keepAlive.getMillis()),
|
||||||
|
ActionListener.running(() -> acquiredListener.onResponse(response))
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
taskManager.unregister(searchTask);
|
||||||
|
searchTask.onResponse(response);
|
||||||
|
acquiredListener.onResponse(response);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// We finished after timeout - saving results
|
||||||
|
storeResults(
|
||||||
|
searchTask,
|
||||||
|
new StoredAsyncResponse<>(response, threadPool.absoluteTimeInMillis() + keepAlive.getMillis()),
|
||||||
|
ActionListener.running(response::decRef)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}, e -> {
|
||||||
|
ActionListener<Response> acquiredListener = exclusiveListener.getAndSet(null);
|
||||||
|
if (acquiredListener != null) {
|
||||||
|
// We finished before timeout
|
||||||
|
timeoutHandler.cancel();
|
||||||
|
if (keepOnCompletion) {
|
||||||
|
storeResults(
|
||||||
|
searchTask,
|
||||||
|
new StoredAsyncResponse<>(e, threadPool.absoluteTimeInMillis() + keepAlive.getMillis()),
|
||||||
|
ActionListener.running(() -> acquiredListener.onFailure(e))
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
taskManager.unregister(searchTask);
|
||||||
|
searchTask.onFailure(e);
|
||||||
|
acquiredListener.onFailure(e);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// We finished after timeout - saving exception
|
||||||
|
storeResults(searchTask, new StoredAsyncResponse<>(e, threadPool.absoluteTimeInMillis() + keepAlive.getMillis()));
|
||||||
|
}
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
private void storeResults(T searchTask, StoredAsyncResponse<Response> storedResponse) {
|
||||||
|
storeResults(searchTask, storedResponse, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void storeResults(T searchTask, StoredAsyncResponse<Response> storedResponse, ActionListener<Void> finalListener) {
|
||||||
|
try {
|
||||||
|
asyncTaskIndexService.createResponseForEQL(
|
||||||
|
searchTask.getExecutionId().getDocId(),
|
||||||
|
searchTask.getOriginHeaders(),
|
||||||
|
threadPool.getThreadContext().getResponseHeaders(), // includes ESQL warnings
|
||||||
|
storedResponse,
|
||||||
|
ActionListener.wrap(
|
||||||
|
// We should only unregister after the result is saved
|
||||||
|
resp -> {
|
||||||
|
// TODO: generalize the logging, not just eql
|
||||||
|
logger.trace(() -> "stored eql search results for [" + searchTask.getExecutionId().getEncoded() + "]");
|
||||||
|
taskManager.unregister(searchTask);
|
||||||
|
if (storedResponse.getException() != null) {
|
||||||
|
searchTask.onFailure(storedResponse.getException());
|
||||||
|
} else {
|
||||||
|
searchTask.onResponse(storedResponse.getResponse());
|
||||||
|
}
|
||||||
|
if (finalListener != null) {
|
||||||
|
finalListener.onResponse(null);
|
||||||
|
}
|
||||||
|
},
|
||||||
|
exc -> {
|
||||||
|
taskManager.unregister(searchTask);
|
||||||
|
searchTask.onFailure(exc);
|
||||||
|
Throwable cause = ExceptionsHelper.unwrapCause(exc);
|
||||||
|
if (cause instanceof DocumentMissingException == false
|
||||||
|
&& cause instanceof VersionConflictEngineException == false) {
|
||||||
|
logger.error(
|
||||||
|
// TODO: generalize the logging, not just eql
|
||||||
|
() -> format("failed to store eql search results for [%s]", searchTask.getExecutionId().getEncoded()),
|
||||||
|
exc
|
||||||
|
);
|
||||||
|
}
|
||||||
|
if (finalListener != null) {
|
||||||
|
finalListener.onFailure(exc);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
)
|
||||||
|
);
|
||||||
|
} catch (Exception exc) {
|
||||||
|
taskManager.unregister(searchTask);
|
||||||
|
searchTask.onFailure(exc);
|
||||||
|
logger.error(() -> "failed to store eql search results for [" + searchTask.getExecutionId().getEncoded() + "]", exc);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Adds a self-unregistering listener to a task. It works as a normal listener except it retrieves a partial response and unregister
|
||||||
|
* itself from the task if timeout occurs. Returns false if the listener could not be added, if say for example the task completed.
|
||||||
|
* Otherwise, returns true.
|
||||||
|
*/
|
||||||
|
public static <Response extends ActionResponse, Task extends StoredAsyncTask<Response>> boolean addCompletionListener(
|
||||||
|
ThreadPool threadPool,
|
||||||
|
Task task,
|
||||||
|
ActionListener<StoredAsyncResponse<Response>> listener,
|
||||||
|
TimeValue timeout
|
||||||
|
) {
|
||||||
|
if (timeout.getMillis() <= 0) {
|
||||||
|
getCurrentResult(task, listener);
|
||||||
|
return true;
|
||||||
|
} else {
|
||||||
|
return task.addCompletionListener(
|
||||||
|
() -> ListenerTimeouts.wrapWithTimeout(
|
||||||
|
threadPool,
|
||||||
|
timeout,
|
||||||
|
threadPool.executor(ThreadPool.Names.SEARCH),
|
||||||
|
ActionListener.wrap(
|
||||||
|
r -> listener.onResponse(new StoredAsyncResponse<>(r, task.getExpirationTimeMillis())),
|
||||||
|
e -> listener.onResponse(new StoredAsyncResponse<>(e, task.getExpirationTimeMillis()))
|
||||||
|
),
|
||||||
|
wrapper -> {
|
||||||
|
// Timeout was triggered
|
||||||
|
task.removeCompletionListener(wrapper);
|
||||||
|
getCurrentResult(task, listener);
|
||||||
|
}
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private static <Response extends ActionResponse, Task extends StoredAsyncTask<Response>> void getCurrentResult(
|
||||||
|
Task task,
|
||||||
|
ActionListener<StoredAsyncResponse<Response>> listener
|
||||||
|
) {
|
||||||
|
try {
|
||||||
|
listener.onResponse(new StoredAsyncResponse<>(task.getCurrentResult(), task.getExpirationTimeMillis()));
|
||||||
|
} catch (Exception ex) {
|
||||||
|
listener.onFailure(ex);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,200 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.async;
|
||||||
|
|
||||||
|
import org.elasticsearch.ExceptionsHelper;
|
||||||
|
import org.elasticsearch.action.ActionResponse;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamOutput;
|
||||||
|
import org.elasticsearch.common.io.stream.Writeable;
|
||||||
|
import org.elasticsearch.rest.RestStatus;
|
||||||
|
import org.elasticsearch.xcontent.ToXContentObject;
|
||||||
|
import org.elasticsearch.xcontent.XContentBuilder;
|
||||||
|
import org.elasticsearch.xpack.core.async.StoredAsyncResponse;
|
||||||
|
import org.elasticsearch.xpack.core.search.action.SearchStatusResponse;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A response for *QL search status request
|
||||||
|
*/
|
||||||
|
public class QlStatusResponse extends ActionResponse implements SearchStatusResponse, ToXContentObject {
|
||||||
|
private final String id;
|
||||||
|
private final boolean isRunning;
|
||||||
|
private final boolean isPartial;
|
||||||
|
private final Long startTimeMillis;
|
||||||
|
private final long expirationTimeMillis;
|
||||||
|
private final RestStatus completionStatus;
|
||||||
|
|
||||||
|
public interface AsyncStatus {
|
||||||
|
String id();
|
||||||
|
|
||||||
|
boolean isRunning();
|
||||||
|
|
||||||
|
boolean isPartial();
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlStatusResponse(
|
||||||
|
String id,
|
||||||
|
boolean isRunning,
|
||||||
|
boolean isPartial,
|
||||||
|
Long startTimeMillis,
|
||||||
|
long expirationTimeMillis,
|
||||||
|
RestStatus completionStatus
|
||||||
|
) {
|
||||||
|
this.id = id;
|
||||||
|
this.isRunning = isRunning;
|
||||||
|
this.isPartial = isPartial;
|
||||||
|
this.startTimeMillis = startTimeMillis;
|
||||||
|
this.expirationTimeMillis = expirationTimeMillis;
|
||||||
|
this.completionStatus = completionStatus;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get status from the stored Ql search response
|
||||||
|
* @param storedResponse - a response from a stored search
|
||||||
|
* @param expirationTimeMillis – expiration time in milliseconds
|
||||||
|
* @param id – encoded async search id
|
||||||
|
* @return a status response
|
||||||
|
*/
|
||||||
|
public static <S extends Writeable & AsyncStatus> QlStatusResponse getStatusFromStoredSearch(
|
||||||
|
StoredAsyncResponse<S> storedResponse,
|
||||||
|
long expirationTimeMillis,
|
||||||
|
String id
|
||||||
|
) {
|
||||||
|
S searchResponse = storedResponse.getResponse();
|
||||||
|
if (searchResponse != null) {
|
||||||
|
assert searchResponse.isRunning() == false : "Stored Ql search response must have a completed status!";
|
||||||
|
return new QlStatusResponse(
|
||||||
|
searchResponse.id(),
|
||||||
|
false,
|
||||||
|
searchResponse.isPartial(),
|
||||||
|
null, // we don't store in the index the start time for completed response
|
||||||
|
expirationTimeMillis,
|
||||||
|
RestStatus.OK
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
Exception exc = storedResponse.getException();
|
||||||
|
assert exc != null : "Stored Ql response must either have a search response or an exception!";
|
||||||
|
return new QlStatusResponse(
|
||||||
|
id,
|
||||||
|
false,
|
||||||
|
false,
|
||||||
|
null, // we don't store in the index the start time for completed response
|
||||||
|
expirationTimeMillis,
|
||||||
|
ExceptionsHelper.status(exc)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public QlStatusResponse(StreamInput in) throws IOException {
|
||||||
|
this.id = in.readString();
|
||||||
|
this.isRunning = in.readBoolean();
|
||||||
|
this.isPartial = in.readBoolean();
|
||||||
|
this.startTimeMillis = in.readOptionalLong();
|
||||||
|
this.expirationTimeMillis = in.readLong();
|
||||||
|
this.completionStatus = (this.isRunning == false) ? RestStatus.readFrom(in) : null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void writeTo(StreamOutput out) throws IOException {
|
||||||
|
out.writeString(id);
|
||||||
|
out.writeBoolean(isRunning);
|
||||||
|
out.writeBoolean(isPartial);
|
||||||
|
out.writeOptionalLong(startTimeMillis);
|
||||||
|
out.writeLong(expirationTimeMillis);
|
||||||
|
if (isRunning == false) {
|
||||||
|
RestStatus.writeTo(out, completionStatus);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public XContentBuilder toXContent(XContentBuilder builder, Params params) throws IOException {
|
||||||
|
builder.startObject();
|
||||||
|
{
|
||||||
|
builder.field("id", id);
|
||||||
|
builder.field("is_running", isRunning);
|
||||||
|
builder.field("is_partial", isPartial);
|
||||||
|
if (startTimeMillis != null) { // start time is available only for a running eql search
|
||||||
|
builder.timeField("start_time_in_millis", "start_time", startTimeMillis);
|
||||||
|
}
|
||||||
|
builder.timeField("expiration_time_in_millis", "expiration_time", expirationTimeMillis);
|
||||||
|
if (isRunning == false) { // completion status is available only for a completed eql search
|
||||||
|
builder.field("completion_status", completionStatus.getStatus());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
builder.endObject();
|
||||||
|
return builder;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) return true;
|
||||||
|
if (obj == null || getClass() != obj.getClass()) return false;
|
||||||
|
QlStatusResponse other = (QlStatusResponse) obj;
|
||||||
|
return id.equals(other.id)
|
||||||
|
&& isRunning == other.isRunning
|
||||||
|
&& isPartial == other.isPartial
|
||||||
|
&& Objects.equals(startTimeMillis, other.startTimeMillis)
|
||||||
|
&& expirationTimeMillis == other.expirationTimeMillis
|
||||||
|
&& Objects.equals(completionStatus, other.completionStatus);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(id, isRunning, isPartial, startTimeMillis, expirationTimeMillis, completionStatus);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns the id of the eql search status request.
|
||||||
|
*/
|
||||||
|
public String getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns {@code true} if the eql search is still running in the cluster,
|
||||||
|
* or {@code false} if the search has been completed.
|
||||||
|
*/
|
||||||
|
public boolean isRunning() {
|
||||||
|
return isRunning;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns {@code true} if the eql search results are partial.
|
||||||
|
* This could be either because eql search hasn't finished yet,
|
||||||
|
* or if it finished and some shards have failed or timed out.
|
||||||
|
*/
|
||||||
|
public boolean isPartial() {
|
||||||
|
return isPartial;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns a timestamp when the eql search task started, in milliseconds since epoch.
|
||||||
|
* For a completed eql search returns {@code null}, as we don't store start time for completed searches.
|
||||||
|
*/
|
||||||
|
public Long getStartTime() {
|
||||||
|
return startTimeMillis;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns a timestamp when the eql search will be expired, in milliseconds since epoch.
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public long getExpirationTime() {
|
||||||
|
return expirationTimeMillis;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* For a completed eql search returns the completion status.
|
||||||
|
* For a still running eql search returns {@code null}.
|
||||||
|
*/
|
||||||
|
public RestStatus getCompletionStatus() {
|
||||||
|
return completionStatus;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,12 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.capabilities;
|
||||||
|
|
||||||
|
public interface Resolvable {
|
||||||
|
|
||||||
|
boolean resolved();
|
||||||
|
}
|
|
@ -0,0 +1,19 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.capabilities;
|
||||||
|
|
||||||
|
public abstract class Resolvables {
|
||||||
|
|
||||||
|
public static boolean resolved(Iterable<? extends Resolvable> resolvables) {
|
||||||
|
for (Resolvable resolvable : resolvables) {
|
||||||
|
if (resolvable.resolved() == false) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,19 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.capabilities;
|
||||||
|
|
||||||
|
public interface Unresolvable extends Resolvable {
|
||||||
|
|
||||||
|
String UNRESOLVED_PREFIX = "?";
|
||||||
|
|
||||||
|
@Override
|
||||||
|
default boolean resolved() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
String unresolvedMessage();
|
||||||
|
}
|
|
@ -0,0 +1,19 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.capabilities;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlServerException;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Thrown when we accidentally attempt to resolve something on on an unresolved entity. Throwing this
|
||||||
|
* is always a bug.
|
||||||
|
*/
|
||||||
|
public class UnresolvedException extends QlServerException {
|
||||||
|
public UnresolvedException(String action, Object target) {
|
||||||
|
super("Invalid call to {} on an unresolved object {}", action, target);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,79 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.common;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Location;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Node;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.StringUtils;
|
||||||
|
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.Objects;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
|
import static org.elasticsearch.common.logging.LoggerMessageFormat.format;
|
||||||
|
|
||||||
|
public class Failure {
|
||||||
|
|
||||||
|
private final Node<?> node;
|
||||||
|
private final String message;
|
||||||
|
|
||||||
|
public Failure(Node<?> node, String message) {
|
||||||
|
this.node = node;
|
||||||
|
this.message = message;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Node<?> node() {
|
||||||
|
return node;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String message() {
|
||||||
|
return message;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(node);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
Failure other = (Failure) obj;
|
||||||
|
return Objects.equals(node, other.node);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return message;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Failure fail(Node<?> source, String message, Object... args) {
|
||||||
|
return new Failure(source, format(message, args));
|
||||||
|
}
|
||||||
|
|
||||||
|
public static String failMessage(Collection<Failure> failures) {
|
||||||
|
return failures.stream().map(f -> {
|
||||||
|
Location l = f.node().source().source();
|
||||||
|
return "line " + l.getLineNumber() + ":" + l.getColumnNumber() + ": " + f.message();
|
||||||
|
})
|
||||||
|
.collect(
|
||||||
|
Collectors.joining(
|
||||||
|
StringUtils.NEW_LINE,
|
||||||
|
format("Found {} problem{}\n", failures.size(), failures.size() > 1 ? "s" : StringUtils.EMPTY),
|
||||||
|
StringUtils.EMPTY
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,57 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.common;
|
||||||
|
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.LinkedHashSet;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Glorified list for managing {@link Failure}s.
|
||||||
|
*/
|
||||||
|
public class Failures {
|
||||||
|
|
||||||
|
private final Collection<Failure> failures;
|
||||||
|
|
||||||
|
public Failures() {
|
||||||
|
this.failures = new LinkedHashSet<>();
|
||||||
|
}
|
||||||
|
|
||||||
|
public Failures add(Failure failure) {
|
||||||
|
if (failure != null) {
|
||||||
|
failures.add(failure);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean hasFailures() {
|
||||||
|
return failures.size() > 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Collection<Failure> failures() {
|
||||||
|
return failures;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(failures);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object o) {
|
||||||
|
if (this == o) return true;
|
||||||
|
if (o == null || getClass() != o.getClass()) return false;
|
||||||
|
Failures failures1 = (Failures) o;
|
||||||
|
return Objects.equals(failures, failures1.failures);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return failures.isEmpty() ? "[]" : Failure.failMessage(failures);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,23 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reference to a ES aggregation (which can be either a GROUP BY or Metric agg).
|
||||||
|
*/
|
||||||
|
public abstract class AggRef implements FieldExtraction {
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
// Aggregations do not need any special fields
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean supportedByAggsOnlyQuery() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,28 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search;
|
||||||
|
|
||||||
|
import org.elasticsearch.search.builder.SearchSourceBuilder;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An interface for something that needs to extract field(s) from a result.
|
||||||
|
*/
|
||||||
|
public interface FieldExtraction {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add whatever is necessary to the {@link SearchSourceBuilder}
|
||||||
|
* in order to fetch the field. This can include tracking the score,
|
||||||
|
* {@code _source} fields, doc values fields, and script fields.
|
||||||
|
*/
|
||||||
|
void collectFields(QlSourceBuilder sourceBuilder);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Is this aggregation supported in an "aggregation only" query
|
||||||
|
* ({@code true}) or should it force a scroll query ({@code false})?
|
||||||
|
*/
|
||||||
|
boolean supportedByAggsOnlyQuery();
|
||||||
|
}
|
|
@ -0,0 +1,62 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search;
|
||||||
|
|
||||||
|
import org.elasticsearch.script.Script;
|
||||||
|
import org.elasticsearch.search.builder.SearchSourceBuilder;
|
||||||
|
import org.elasticsearch.search.fetch.subphase.FieldAndFormat;
|
||||||
|
|
||||||
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.LinkedHashSet;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Set;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@code SqlSourceBuilder} is a builder object passed to objects implementing
|
||||||
|
* {@link FieldExtraction} that can "build" whatever needs to be extracted from
|
||||||
|
* the resulting ES document as a field.
|
||||||
|
*/
|
||||||
|
public class QlSourceBuilder {
|
||||||
|
// The LinkedHashMaps preserve the order of the fields in the response
|
||||||
|
private final Set<FieldAndFormat> fetchFields = new LinkedHashSet<>();
|
||||||
|
private final Map<String, Script> scriptFields = new LinkedHashMap<>();
|
||||||
|
|
||||||
|
boolean trackScores = false;
|
||||||
|
|
||||||
|
public QlSourceBuilder() {}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Turns on returning the {@code _score} for documents.
|
||||||
|
*/
|
||||||
|
public void trackScores() {
|
||||||
|
this.trackScores = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieve the requested field using the "fields" API
|
||||||
|
*/
|
||||||
|
public void addFetchField(String field, String format) {
|
||||||
|
fetchFields.add(new FieldAndFormat(field, format));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Return the given field as a script field with the supplied script
|
||||||
|
*/
|
||||||
|
public void addScriptField(String name, Script script) {
|
||||||
|
scriptFields.put(name, script);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Collect the necessary fields, modifying the {@code SearchSourceBuilder}
|
||||||
|
* to retrieve them from the document.
|
||||||
|
*/
|
||||||
|
public void build(SearchSourceBuilder sourceBuilder) {
|
||||||
|
sourceBuilder.trackScores(this.trackScores);
|
||||||
|
fetchFields.forEach(field -> sourceBuilder.fetchField(new FieldAndFormat(field.field, field.format, null)));
|
||||||
|
scriptFields.forEach(sourceBuilder::scriptField);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,270 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.TransportVersions;
|
||||||
|
import org.elasticsearch.common.document.DocumentField;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamOutput;
|
||||||
|
import org.elasticsearch.search.SearchHit;
|
||||||
|
import org.elasticsearch.xpack.esql.core.InvalidArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.time.ZoneId;
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.Iterator;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Extractor for ES fields. Works for both 'normal' fields but also nested ones (which require hitName to be set).
|
||||||
|
* The latter is used as metadata in assembling the results in the tabular response.
|
||||||
|
*/
|
||||||
|
public abstract class AbstractFieldHitExtractor implements HitExtractor {
|
||||||
|
|
||||||
|
private final String fieldName, hitName;
|
||||||
|
private final DataType dataType;
|
||||||
|
private final ZoneId zoneId;
|
||||||
|
|
||||||
|
protected MultiValueSupport multiValueSupport;
|
||||||
|
|
||||||
|
public enum MultiValueSupport {
|
||||||
|
NONE,
|
||||||
|
LENIENT,
|
||||||
|
FULL
|
||||||
|
}
|
||||||
|
|
||||||
|
protected AbstractFieldHitExtractor(String name, DataType dataType, ZoneId zoneId) {
|
||||||
|
this(name, dataType, zoneId, null, MultiValueSupport.NONE);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected AbstractFieldHitExtractor(String name, DataType dataType, ZoneId zoneId, MultiValueSupport multiValueSupport) {
|
||||||
|
this(name, dataType, zoneId, null, multiValueSupport);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected AbstractFieldHitExtractor(
|
||||||
|
String name,
|
||||||
|
DataType dataType,
|
||||||
|
ZoneId zoneId,
|
||||||
|
String hitName,
|
||||||
|
MultiValueSupport multiValueSupport
|
||||||
|
) {
|
||||||
|
this.fieldName = name;
|
||||||
|
this.dataType = dataType;
|
||||||
|
this.zoneId = zoneId;
|
||||||
|
this.multiValueSupport = multiValueSupport;
|
||||||
|
this.hitName = hitName;
|
||||||
|
|
||||||
|
if (hitName != null) {
|
||||||
|
if (name.contains(hitName) == false) {
|
||||||
|
throw new QlIllegalArgumentException("Hitname [{}] specified but not part of the name [{}]", hitName, name);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("this-escape")
|
||||||
|
protected AbstractFieldHitExtractor(StreamInput in) throws IOException {
|
||||||
|
fieldName = in.readString();
|
||||||
|
String typeName = in.readOptionalString();
|
||||||
|
dataType = typeName != null ? loadTypeFromName(typeName) : null;
|
||||||
|
hitName = in.readOptionalString();
|
||||||
|
if (in.getTransportVersion().before(TransportVersions.V_8_6_0)) {
|
||||||
|
this.multiValueSupport = in.readBoolean() ? MultiValueSupport.LENIENT : MultiValueSupport.NONE;
|
||||||
|
} else {
|
||||||
|
this.multiValueSupport = in.readEnum(MultiValueSupport.class);
|
||||||
|
}
|
||||||
|
zoneId = readZoneId(in);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected DataType loadTypeFromName(String typeName) {
|
||||||
|
return DataTypes.fromTypeName(typeName);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract ZoneId readZoneId(StreamInput in) throws IOException;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void writeTo(StreamOutput out) throws IOException {
|
||||||
|
out.writeString(fieldName);
|
||||||
|
out.writeOptionalString(dataType == null ? null : dataType.typeName());
|
||||||
|
out.writeOptionalString(hitName);
|
||||||
|
if (out.getTransportVersion().before(TransportVersions.V_8_6_0)) {
|
||||||
|
out.writeBoolean(multiValueSupport != MultiValueSupport.NONE);
|
||||||
|
} else {
|
||||||
|
out.writeEnum(multiValueSupport);
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(SearchHit hit) {
|
||||||
|
Object value = null;
|
||||||
|
DocumentField field = null;
|
||||||
|
if (hitName != null) {
|
||||||
|
value = unwrapFieldsMultiValue(extractNestedField(hit));
|
||||||
|
} else {
|
||||||
|
field = hit.field(fieldName);
|
||||||
|
if (field != null) {
|
||||||
|
value = unwrapFieldsMultiValue(field.getValues());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*
|
||||||
|
* For a path of fields like root.nested1.nested2.leaf where nested1 and nested2 are nested field types,
|
||||||
|
* fieldName is root.nested1.nested2.leaf, while hitName is root.nested1.nested2
|
||||||
|
* We first look for root.nested1.nested2 or root.nested1 or root in the SearchHit until we find something.
|
||||||
|
* If the DocumentField lives under "root.nested1" the remaining path to search for (in the DocumentField itself) is nested2.
|
||||||
|
* After this step is done, what remains to be done is just getting the leaf values.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
private Object extractNestedField(SearchHit hit) {
|
||||||
|
Object value;
|
||||||
|
DocumentField field;
|
||||||
|
String tempHitname = hitName;
|
||||||
|
List<String> remainingPath = new ArrayList<>();
|
||||||
|
// first, search for the "root" DocumentField under which the remaining path of nested document values is
|
||||||
|
while ((field = hit.field(tempHitname)) == null) {
|
||||||
|
int indexOfDot = tempHitname.lastIndexOf('.');
|
||||||
|
if (indexOfDot < 0) {// there is no such field in the hit
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
remainingPath.add(0, tempHitname.substring(indexOfDot + 1));
|
||||||
|
tempHitname = tempHitname.substring(0, indexOfDot);
|
||||||
|
}
|
||||||
|
// then dig into DocumentField's structure until we reach the field we are interested into
|
||||||
|
if (remainingPath.size() > 0) {
|
||||||
|
List<Object> values = field.getValues();
|
||||||
|
Iterator<String> pathIterator = remainingPath.iterator();
|
||||||
|
while (pathIterator.hasNext()) {
|
||||||
|
String pathElement = pathIterator.next();
|
||||||
|
Map<String, List<Object>> elements = (Map<String, List<Object>>) values.get(0);
|
||||||
|
values = elements.get(pathElement);
|
||||||
|
/*
|
||||||
|
* if this path is not found it means we hit another nested document (inner_root_1.inner_root_2.nested_field_2)
|
||||||
|
* something like this
|
||||||
|
* "root_field_1.root_field_2.nested_field_1" : [
|
||||||
|
* {
|
||||||
|
* "inner_root_1.inner_root_2.nested_field_2" : [
|
||||||
|
* {
|
||||||
|
* "leaf_field" : [
|
||||||
|
* "abc2"
|
||||||
|
* ]
|
||||||
|
* So, start re-building the path until the right one is found, ie inner_root_1.inner_root_2......
|
||||||
|
*/
|
||||||
|
while (values == null) {
|
||||||
|
pathElement += "." + pathIterator.next();
|
||||||
|
values = elements.get(pathElement);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
value = ((Map<String, Object>) values.get(0)).get(fieldName.substring(hitName.length() + 1));
|
||||||
|
} else {
|
||||||
|
value = field.getValues();
|
||||||
|
}
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Object unwrapFieldsMultiValue(Object values) {
|
||||||
|
if (values == null) {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
if (values instanceof Map && hitName != null) {
|
||||||
|
// extract the sub-field from a nested field (dep.dep_name -> dep_name)
|
||||||
|
return unwrapFieldsMultiValue(((Map<?, ?>) values).get(fieldName.substring(hitName.length() + 1)));
|
||||||
|
}
|
||||||
|
if (values instanceof List<?> list) {
|
||||||
|
if (list.isEmpty()) {
|
||||||
|
return null;
|
||||||
|
} else {
|
||||||
|
if (isPrimitive(list) == false) {
|
||||||
|
if (list.size() == 1 || multiValueSupport == MultiValueSupport.LENIENT) {
|
||||||
|
return unwrapFieldsMultiValue(list.get(0));
|
||||||
|
} else if (multiValueSupport == MultiValueSupport.FULL) {
|
||||||
|
List<Object> unwrappedValues = new ArrayList<>();
|
||||||
|
for (Object value : list) {
|
||||||
|
unwrappedValues.add(unwrapFieldsMultiValue(value));
|
||||||
|
}
|
||||||
|
values = unwrappedValues;
|
||||||
|
} else {
|
||||||
|
// missing `field_multi_value_leniency` setting
|
||||||
|
throw new InvalidArgumentException("Arrays (returned by [{}]) are not supported", fieldName);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Object unwrapped = unwrapCustomValue(values);
|
||||||
|
if (unwrapped != null && isListOfNulls(unwrapped) == false) {
|
||||||
|
return unwrapped;
|
||||||
|
}
|
||||||
|
|
||||||
|
return values;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static boolean isListOfNulls(Object unwrapped) {
|
||||||
|
if (unwrapped instanceof List<?> list) {
|
||||||
|
if (list.size() == 0) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
for (Object o : list) {
|
||||||
|
if (o != null) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract Object unwrapCustomValue(Object values);
|
||||||
|
|
||||||
|
protected abstract boolean isPrimitive(List<?> list);
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String hitName() {
|
||||||
|
return hitName;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String fieldName() {
|
||||||
|
return fieldName;
|
||||||
|
}
|
||||||
|
|
||||||
|
public ZoneId zoneId() {
|
||||||
|
return zoneId;
|
||||||
|
}
|
||||||
|
|
||||||
|
public DataType dataType() {
|
||||||
|
return dataType;
|
||||||
|
}
|
||||||
|
|
||||||
|
public MultiValueSupport multiValueSupport() {
|
||||||
|
return multiValueSupport;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return fieldName + "@" + hitName + "@" + zoneId;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
AbstractFieldHitExtractor other = (AbstractFieldHitExtractor) obj;
|
||||||
|
return fieldName.equals(other.fieldName) && hitName.equals(other.hitName) && multiValueSupport == other.multiValueSupport;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(fieldName, hitName, multiValueSupport);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,18 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteable;
|
||||||
|
import org.elasticsearch.search.aggregations.bucket.MultiBucketsAggregation.Bucket;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Extracts an aggregation value from a {@link Bucket}.
|
||||||
|
*/
|
||||||
|
public interface BucketExtractor extends NamedWriteable {
|
||||||
|
|
||||||
|
Object extract(Bucket bucket);
|
||||||
|
}
|
|
@ -0,0 +1,29 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteableRegistry;
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteableRegistry.Entry;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
public final class BucketExtractors {
|
||||||
|
|
||||||
|
private BucketExtractors() {}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* All of the named writeables needed to deserialize the instances of
|
||||||
|
* {@linkplain BucketExtractor}s.
|
||||||
|
*/
|
||||||
|
public static List<NamedWriteableRegistry.Entry> getNamedWriteables() {
|
||||||
|
List<NamedWriteableRegistry.Entry> entries = new ArrayList<>();
|
||||||
|
entries.add(new Entry(BucketExtractor.class, ComputingExtractor.NAME, ComputingExtractor::new));
|
||||||
|
entries.add(new Entry(BucketExtractor.class, ConstantExtractor.NAME, ConstantExtractor::new));
|
||||||
|
return entries;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,106 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamOutput;
|
||||||
|
import org.elasticsearch.search.SearchHit;
|
||||||
|
import org.elasticsearch.search.aggregations.bucket.MultiBucketsAggregation.Bucket;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.HitExtractorProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hit/BucketExtractor that delegates to a processor. The difference between this class
|
||||||
|
* and {@link HitExtractorProcessor} is that the latter is used inside a
|
||||||
|
* {@link Processor} tree as a leaf (and thus can effectively parse the
|
||||||
|
* {@link SearchHit} while this class is used when scrolling and passing down
|
||||||
|
* the results.
|
||||||
|
*
|
||||||
|
* In the future, the processor might be used across the board for all columns
|
||||||
|
* to reduce API complexity (and keep the {@link HitExtractor} only as an
|
||||||
|
* internal implementation detail).
|
||||||
|
*/
|
||||||
|
public class ComputingExtractor implements HitExtractor, BucketExtractor {
|
||||||
|
/**
|
||||||
|
* Stands for {@code comPuting}. We try to use short names for {@link HitExtractor}s
|
||||||
|
* to save a few bytes when when we send them back to the user.
|
||||||
|
*/
|
||||||
|
static final String NAME = "p";
|
||||||
|
private final Processor processor;
|
||||||
|
private final String hitName;
|
||||||
|
|
||||||
|
public ComputingExtractor(Processor processor) {
|
||||||
|
this(processor, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public ComputingExtractor(Processor processor, String hitName) {
|
||||||
|
this.processor = processor;
|
||||||
|
this.hitName = hitName;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Visibility required for tests
|
||||||
|
public ComputingExtractor(StreamInput in) throws IOException {
|
||||||
|
processor = in.readNamedWriteable(Processor.class);
|
||||||
|
hitName = in.readOptionalString();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void writeTo(StreamOutput out) throws IOException {
|
||||||
|
out.writeNamedWriteable(processor);
|
||||||
|
out.writeOptionalString(hitName);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getWriteableName() {
|
||||||
|
return NAME;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Processor processor() {
|
||||||
|
return processor;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Object extract(Object input) {
|
||||||
|
return processor.process(input);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(Bucket bucket) {
|
||||||
|
return processor.process(bucket);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(SearchHit hit) {
|
||||||
|
return processor.process(hit);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String hitName() {
|
||||||
|
return hitName;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
ComputingExtractor other = (ComputingExtractor) obj;
|
||||||
|
return Objects.equals(processor, other.processor) && Objects.equals(hitName, other.hitName);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(processor, hitName);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return processor.toString();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,79 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamOutput;
|
||||||
|
import org.elasticsearch.search.SearchHit;
|
||||||
|
import org.elasticsearch.search.aggregations.bucket.MultiBucketsAggregation.Bucket;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns the a constant for every search hit against which it is run.
|
||||||
|
*/
|
||||||
|
public class ConstantExtractor implements HitExtractor, BucketExtractor {
|
||||||
|
/**
|
||||||
|
* Stands for {@code constant}. We try to use short names for {@link HitExtractor}s
|
||||||
|
* to save a few bytes when when we send them back to the user.
|
||||||
|
*/
|
||||||
|
static final String NAME = "c";
|
||||||
|
private final Object constant;
|
||||||
|
|
||||||
|
public ConstantExtractor(Object constant) {
|
||||||
|
this.constant = constant;
|
||||||
|
}
|
||||||
|
|
||||||
|
ConstantExtractor(StreamInput in) throws IOException {
|
||||||
|
constant = in.readGenericValue();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void writeTo(StreamOutput out) throws IOException {
|
||||||
|
out.writeGenericValue(constant);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getWriteableName() {
|
||||||
|
return NAME;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(SearchHit hit) {
|
||||||
|
return constant;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(Bucket bucket) {
|
||||||
|
return constant;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String hitName() {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
ConstantExtractor other = (ConstantExtractor) obj;
|
||||||
|
return Objects.equals(constant, other.constant);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hashCode(constant);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return "^" + constant;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,27 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteable;
|
||||||
|
import org.elasticsearch.core.Nullable;
|
||||||
|
import org.elasticsearch.search.SearchHit;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Extracts a column value from a {@link SearchHit}.
|
||||||
|
*/
|
||||||
|
public interface HitExtractor extends NamedWriteable {
|
||||||
|
/**
|
||||||
|
* Extract the value from a hit.
|
||||||
|
*/
|
||||||
|
Object extract(SearchHit hit);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Name of the inner hit needed by this extractor if it needs one, {@code null} otherwise.
|
||||||
|
*/
|
||||||
|
@Nullable
|
||||||
|
String hitName();
|
||||||
|
}
|
|
@ -0,0 +1,29 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteableRegistry;
|
||||||
|
import org.elasticsearch.common.io.stream.NamedWriteableRegistry.Entry;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
public final class HitExtractors {
|
||||||
|
|
||||||
|
private HitExtractors() {}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* All of the named writeables needed to deserialize the instances of
|
||||||
|
* {@linkplain HitExtractor}.
|
||||||
|
*/
|
||||||
|
public static List<NamedWriteableRegistry.Entry> getNamedWriteables() {
|
||||||
|
List<NamedWriteableRegistry.Entry> entries = new ArrayList<>();
|
||||||
|
entries.add(new Entry(HitExtractor.class, ConstantExtractor.NAME, ConstantExtractor::new));
|
||||||
|
entries.add(new Entry(HitExtractor.class, ComputingExtractor.NAME, ComputingExtractor::new));
|
||||||
|
return entries;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,54 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.execution.search.extractor;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.search.SearchHit;
|
||||||
|
import org.elasticsearch.search.aggregations.bucket.MultiBucketsAggregation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
public class TotalHitsExtractor extends ConstantExtractor {
|
||||||
|
|
||||||
|
public TotalHitsExtractor(Long constant) {
|
||||||
|
super(constant);
|
||||||
|
}
|
||||||
|
|
||||||
|
TotalHitsExtractor(StreamInput in) throws IOException {
|
||||||
|
super(in);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(MultiBucketsAggregation.Bucket bucket) {
|
||||||
|
return validate(super.extract(bucket));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object extract(SearchHit hit) {
|
||||||
|
return validate(super.extract(hit));
|
||||||
|
}
|
||||||
|
|
||||||
|
private static Object validate(Object value) {
|
||||||
|
if (Number.class.isInstance(value) == false) {
|
||||||
|
throw new QlIllegalArgumentException(
|
||||||
|
"Inconsistent total hits count handling, expected a numeric value but found a {}: {}",
|
||||||
|
value == null ? null : value.getClass().getSimpleName(),
|
||||||
|
value
|
||||||
|
);
|
||||||
|
}
|
||||||
|
if (((Number) value).longValue() < 0) {
|
||||||
|
throw new QlIllegalArgumentException(
|
||||||
|
"Inconsistent total hits count handling, expected a non-negative value but found {}",
|
||||||
|
value
|
||||||
|
);
|
||||||
|
}
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
|
@ -0,0 +1,116 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An {@code Alias} is a {@code NamedExpression} that gets renamed to something else through the Alias.
|
||||||
|
*
|
||||||
|
* For example, in the statement {@code 5 + 2 AS x}, {@code x} is an alias which is points to {@code ADD(5, 2)}.
|
||||||
|
*
|
||||||
|
* And in {@code SELECT col AS x} "col" is a named expression that gets renamed to "x" through an alias.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
public class Alias extends NamedExpression {
|
||||||
|
|
||||||
|
private final Expression child;
|
||||||
|
private final String qualifier;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Postpone attribute creation until it is actually created.
|
||||||
|
* Being immutable, create only one instance.
|
||||||
|
*/
|
||||||
|
private Attribute lazyAttribute;
|
||||||
|
|
||||||
|
public Alias(Source source, String name, Expression child) {
|
||||||
|
this(source, name, null, child, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Alias(Source source, String name, String qualifier, Expression child) {
|
||||||
|
this(source, name, qualifier, child, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Alias(Source source, String name, String qualifier, Expression child, NameId id) {
|
||||||
|
this(source, name, qualifier, child, id, false);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Alias(Source source, String name, String qualifier, Expression child, NameId id, boolean synthetic) {
|
||||||
|
super(source, name, singletonList(child), id, synthetic);
|
||||||
|
this.child = child;
|
||||||
|
this.qualifier = qualifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<Alias> info() {
|
||||||
|
return NodeInfo.create(this, Alias::new, name(), qualifier, child, id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Alias replaceChild(Expression child) {
|
||||||
|
return new Alias(source(), name(), qualifier, child, id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Alias replaceChildren(List<Expression> newChildren) {
|
||||||
|
return new Alias(source(), name(), qualifier, newChildren.get(0), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression child() {
|
||||||
|
return child;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String qualifier() {
|
||||||
|
return qualifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String qualifiedName() {
|
||||||
|
return qualifier == null ? name() : qualifier + "." + name();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
return child.nullable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return child.dataType();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Attribute toAttribute() {
|
||||||
|
if (lazyAttribute == null) {
|
||||||
|
lazyAttribute = resolved()
|
||||||
|
? new ReferenceAttribute(source(), name(), dataType(), qualifier, nullable(), id(), synthetic())
|
||||||
|
: new UnresolvedAttribute(source(), name(), qualifier);
|
||||||
|
}
|
||||||
|
return lazyAttribute;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return child + " AS " + name() + "#" + id();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return child.nodeString() + " AS " + name();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If the given expression is an alias, return its child - otherwise return as is.
|
||||||
|
*/
|
||||||
|
public static Expression unwrap(Expression e) {
|
||||||
|
return e instanceof Alias as ? as.child() : e;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,170 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.core.Tuple;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.util.StringUtils.splitQualifiedIndex;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* {@link Expression}s that can be materialized and describe properties of the derived table.
|
||||||
|
* In other words, an attribute represent a column in the results of a query.
|
||||||
|
*
|
||||||
|
* In the statement {@code SELECT ABS(foo), A, B+C FROM ...} the three named
|
||||||
|
* expressions {@code ABS(foo), A, B+C} get converted to attributes and the user can
|
||||||
|
* only see Attributes.
|
||||||
|
*
|
||||||
|
* In the statement {@code SELECT foo FROM TABLE WHERE foo > 10 + 1} only {@code foo} inside the SELECT
|
||||||
|
* is a named expression (an {@code Alias} will be created automatically for it).
|
||||||
|
* The rest are not as they are not part of the projection and thus are not part of the derived table.
|
||||||
|
*/
|
||||||
|
public abstract class Attribute extends NamedExpression {
|
||||||
|
|
||||||
|
// empty - such as a top level attribute in SELECT cause
|
||||||
|
// present - table name or a table name alias
|
||||||
|
private final String qualifier;
|
||||||
|
// cluster name in the qualifier (if any)
|
||||||
|
private final String cluster;
|
||||||
|
|
||||||
|
// can the attr be null - typically used in JOINs
|
||||||
|
private final Nullability nullability;
|
||||||
|
|
||||||
|
public Attribute(Source source, String name, String qualifier, NameId id) {
|
||||||
|
this(source, name, qualifier, Nullability.TRUE, id);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute(Source source, String name, String qualifier, Nullability nullability, NameId id) {
|
||||||
|
this(source, name, qualifier, nullability, id, false);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute(Source source, String name, String qualifier, Nullability nullability, NameId id, boolean synthetic) {
|
||||||
|
super(source, name, emptyList(), id, synthetic);
|
||||||
|
if (qualifier != null) {
|
||||||
|
Tuple<String, String> splitQualifier = splitQualifiedIndex(qualifier);
|
||||||
|
this.cluster = splitQualifier.v1();
|
||||||
|
this.qualifier = splitQualifier.v2();
|
||||||
|
} else {
|
||||||
|
this.cluster = null;
|
||||||
|
this.qualifier = null;
|
||||||
|
}
|
||||||
|
this.nullability = nullability;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Expression replaceChildren(List<Expression> newChildren) {
|
||||||
|
throw new UnsupportedOperationException("this type of node doesn't have any children to replace");
|
||||||
|
}
|
||||||
|
|
||||||
|
public String qualifier() {
|
||||||
|
return qualifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String qualifiedName() {
|
||||||
|
return qualifier == null ? name() : qualifier + "." + name();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
return nullability;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public AttributeSet references() {
|
||||||
|
return new AttributeSet(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute withLocation(Source source) {
|
||||||
|
return Objects.equals(source(), source) ? this : clone(source, name(), dataType(), qualifier(), nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute withQualifier(String qualifier) {
|
||||||
|
return Objects.equals(qualifier(), qualifier)
|
||||||
|
? this
|
||||||
|
: clone(source(), name(), dataType(), qualifier, nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute withName(String name) {
|
||||||
|
return Objects.equals(name(), name) ? this : clone(source(), name, dataType(), qualifier(), nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute withNullability(Nullability nullability) {
|
||||||
|
return Objects.equals(nullable(), nullability)
|
||||||
|
? this
|
||||||
|
: clone(source(), name(), dataType(), qualifier(), nullability, id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute withId(NameId id) {
|
||||||
|
return clone(source(), name(), dataType(), qualifier(), nullable(), id, synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Attribute withDataType(DataType type) {
|
||||||
|
return Objects.equals(dataType(), type) ? this : clone(source(), name(), type, qualifier(), nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract Attribute clone(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType type,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
);
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Attribute toAttribute() {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int semanticHash() {
|
||||||
|
return id().hashCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean semanticEquals(Expression other) {
|
||||||
|
return other instanceof Attribute ? id().equals(((Attribute) other).id()) : false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Expression canonicalize() {
|
||||||
|
return clone(Source.EMPTY, name(), dataType(), qualifier, nullability, id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), qualifier, nullability);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (super.equals(obj)) {
|
||||||
|
Attribute other = (Attribute) obj;
|
||||||
|
return Objects.equals(qualifier, other.qualifier) && Objects.equals(nullability, other.nullability);
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return qualifiedName() + "{" + label() + "}" + "#" + id();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract String label();
|
||||||
|
}
|
|
@ -0,0 +1,406 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.util.set.Sets;
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
|
||||||
|
import java.util.AbstractSet;
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.Iterator;
|
||||||
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Set;
|
||||||
|
import java.util.function.BiConsumer;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyMap;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Dedicated map for checking {@link Attribute} equality.
|
||||||
|
* This is typically the case when comparing the initial declaration of an Attribute, such as {@link FieldAttribute} with
|
||||||
|
* references to it, namely {@link ReferenceAttribute}.
|
||||||
|
* Using plain object equality, the two references are difference due to their type however semantically, they are the same.
|
||||||
|
* Expressions support semantic equality through {@link Expression#semanticEquals(Expression)} - this map is dedicated solution
|
||||||
|
* for attributes as its common case picked up by the plan rules.
|
||||||
|
* <p>
|
||||||
|
* The map implementation is mutable thus consumers need to be careful NOT to modify the content unless they have ownership.
|
||||||
|
* Worth noting the {@link #combine(AttributeMap)}, {@link #intersect(AttributeMap)} and {@link #subtract(AttributeMap)} methods which
|
||||||
|
* return copies, decoupled from the input maps. In other words the returned maps can be modified without affecting the input or vice-versa.
|
||||||
|
*/
|
||||||
|
public final class AttributeMap<E> implements Map<Attribute, E> {
|
||||||
|
|
||||||
|
static class AttributeWrapper {
|
||||||
|
|
||||||
|
private final Attribute attr;
|
||||||
|
|
||||||
|
AttributeWrapper(Attribute attr) {
|
||||||
|
this.attr = attr;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return attr.semanticHash();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
return obj instanceof AttributeWrapper aw ? attr.semanticEquals(aw.attr) : false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return attr.toString();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set that does unwrapping of keys inside the keySet and iterator.
|
||||||
|
*/
|
||||||
|
private abstract static class UnwrappingSet<W, U> extends AbstractSet<U> {
|
||||||
|
private final Set<W> set;
|
||||||
|
|
||||||
|
UnwrappingSet(Set<W> originalSet) {
|
||||||
|
set = originalSet;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Iterator<U> iterator() {
|
||||||
|
return new Iterator<>() {
|
||||||
|
final Iterator<W> i = set.iterator();
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean hasNext() {
|
||||||
|
return i.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public U next() {
|
||||||
|
return unwrap(i.next());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void remove() {
|
||||||
|
i.remove();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract U unwrap(W next);
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Stream<U> stream() {
|
||||||
|
return set.stream().map(this::unwrap);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Stream<U> parallelStream() {
|
||||||
|
return set.parallelStream().map(this::unwrap);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int size() {
|
||||||
|
return set.size();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object o) {
|
||||||
|
return set.equals(o);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return set.hashCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object[] toArray() {
|
||||||
|
Object[] array = set.toArray();
|
||||||
|
for (int i = 0; i < array.length; i++) {
|
||||||
|
array[i] = ((AttributeWrapper) array[i]).attr;
|
||||||
|
}
|
||||||
|
return array;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
public <A> A[] toArray(A[] a) {
|
||||||
|
// collection is immutable so use that to our advantage
|
||||||
|
if (a.length < size()) {
|
||||||
|
a = (A[]) java.lang.reflect.Array.newInstance(a.getClass().getComponentType(), size());
|
||||||
|
}
|
||||||
|
int i = 0;
|
||||||
|
Object[] result = a;
|
||||||
|
for (U u : this) {
|
||||||
|
result[i++] = u;
|
||||||
|
}
|
||||||
|
// array larger than size, mark the ending element as null
|
||||||
|
if (a.length > size()) {
|
||||||
|
a[size()] = null;
|
||||||
|
}
|
||||||
|
return a;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return set.toString();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("rawtypes")
|
||||||
|
private static final AttributeMap EMPTY = new AttributeMap<>(emptyMap());
|
||||||
|
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
public static <E> AttributeMap<E> emptyAttributeMap() {
|
||||||
|
return EMPTY;
|
||||||
|
}
|
||||||
|
|
||||||
|
private final Map<AttributeWrapper, E> delegate;
|
||||||
|
|
||||||
|
private AttributeMap(Map<AttributeWrapper, E> other) {
|
||||||
|
delegate = other;
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeMap() {
|
||||||
|
delegate = new LinkedHashMap<>();
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeMap(Attribute key, E value) {
|
||||||
|
delegate = new LinkedHashMap<>();
|
||||||
|
add(key, value);
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeMap<E> combine(AttributeMap<E> other) {
|
||||||
|
AttributeMap<E> combine = new AttributeMap<>();
|
||||||
|
combine.addAll(this);
|
||||||
|
combine.addAll(other);
|
||||||
|
|
||||||
|
return combine;
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeMap<E> subtract(AttributeMap<E> other) {
|
||||||
|
AttributeMap<E> diff = new AttributeMap<>();
|
||||||
|
for (Entry<AttributeWrapper, E> entry : this.delegate.entrySet()) {
|
||||||
|
if (other.delegate.containsKey(entry.getKey()) == false) {
|
||||||
|
diff.delegate.put(entry.getKey(), entry.getValue());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return diff;
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeMap<E> intersect(AttributeMap<E> other) {
|
||||||
|
AttributeMap<E> smaller = (other.size() > size() ? this : other);
|
||||||
|
AttributeMap<E> larger = (smaller == this ? other : this);
|
||||||
|
|
||||||
|
AttributeMap<E> intersect = new AttributeMap<>();
|
||||||
|
for (Entry<AttributeWrapper, E> entry : smaller.delegate.entrySet()) {
|
||||||
|
if (larger.delegate.containsKey(entry.getKey())) {
|
||||||
|
intersect.delegate.put(entry.getKey(), entry.getValue());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return intersect;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean subsetOf(AttributeMap<E> other) {
|
||||||
|
if (this.size() > other.size()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
for (AttributeWrapper aw : delegate.keySet()) {
|
||||||
|
if (other.delegate.containsKey(aw) == false) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
public void add(Attribute key, E value) {
|
||||||
|
put(key, value);
|
||||||
|
}
|
||||||
|
|
||||||
|
public void addAll(AttributeMap<E> other) {
|
||||||
|
putAll(other);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Set<String> attributeNames() {
|
||||||
|
Set<String> s = Sets.newLinkedHashSetWithExpectedSize(size());
|
||||||
|
|
||||||
|
for (AttributeWrapper aw : delegate.keySet()) {
|
||||||
|
s.add(aw.attr.name());
|
||||||
|
}
|
||||||
|
return s;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int size() {
|
||||||
|
return delegate.size();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean isEmpty() {
|
||||||
|
return delegate.isEmpty();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean containsKey(Object key) {
|
||||||
|
return key instanceof NamedExpression ne ? delegate.containsKey(new AttributeWrapper(ne.toAttribute())) : false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean containsValue(Object value) {
|
||||||
|
return delegate.containsValue(value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public E get(Object key) {
|
||||||
|
return key instanceof NamedExpression ne ? delegate.get(new AttributeWrapper(ne.toAttribute())) : null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public E getOrDefault(Object key, E defaultValue) {
|
||||||
|
return key instanceof NamedExpression ne
|
||||||
|
? delegate.getOrDefault(new AttributeWrapper(ne.toAttribute()), defaultValue)
|
||||||
|
: defaultValue;
|
||||||
|
}
|
||||||
|
|
||||||
|
public E resolve(Object key) {
|
||||||
|
return resolve(key, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public E resolve(Object key, E defaultValue) {
|
||||||
|
E value = defaultValue;
|
||||||
|
E candidate = null;
|
||||||
|
int allowedLookups = 1000;
|
||||||
|
while ((candidate = get(key)) != null || containsKey(key)) {
|
||||||
|
// instead of circling around, return
|
||||||
|
if (candidate == key) {
|
||||||
|
return candidate;
|
||||||
|
}
|
||||||
|
if (--allowedLookups == 0) {
|
||||||
|
throw new QlIllegalArgumentException("Potential cycle detected");
|
||||||
|
}
|
||||||
|
key = candidate;
|
||||||
|
value = candidate;
|
||||||
|
}
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public E put(Attribute key, E value) {
|
||||||
|
return delegate.put(new AttributeWrapper(key), value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void putAll(Map<? extends Attribute, ? extends E> m) {
|
||||||
|
for (Entry<? extends Attribute, ? extends E> entry : m.entrySet()) {
|
||||||
|
put(entry.getKey(), entry.getValue());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public E remove(Object key) {
|
||||||
|
return key instanceof NamedExpression ne ? delegate.remove(new AttributeWrapper(ne.toAttribute())) : null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void clear() {
|
||||||
|
delegate.clear();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Set<Attribute> keySet() {
|
||||||
|
return new UnwrappingSet<>(delegate.keySet()) {
|
||||||
|
@Override
|
||||||
|
protected Attribute unwrap(AttributeWrapper next) {
|
||||||
|
return next.attr;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Collection<E> values() {
|
||||||
|
return delegate.values();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Set<Entry<Attribute, E>> entrySet() {
|
||||||
|
return new UnwrappingSet<>(delegate.entrySet()) {
|
||||||
|
@Override
|
||||||
|
protected Entry<Attribute, E> unwrap(final Entry<AttributeWrapper, E> next) {
|
||||||
|
return new Entry<>() {
|
||||||
|
@Override
|
||||||
|
public Attribute getKey() {
|
||||||
|
return next.getKey().attr;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public E getValue() {
|
||||||
|
return next.getValue();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public E setValue(E value) {
|
||||||
|
return next.setValue(value);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void forEach(BiConsumer<? super Attribute, ? super E> action) {
|
||||||
|
delegate.forEach((k, v) -> action.accept(k.attr, v));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return delegate.hashCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (obj instanceof AttributeMap<?> am) {
|
||||||
|
obj = am.delegate;
|
||||||
|
}
|
||||||
|
return delegate.equals(obj);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return delegate.toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static <E> Builder<E> builder() {
|
||||||
|
return new Builder<>();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static <E> Builder<E> builder(AttributeMap<E> map) {
|
||||||
|
return new Builder<E>().putAll(map);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static class Builder<E> {
|
||||||
|
private AttributeMap<E> map = new AttributeMap<>();
|
||||||
|
|
||||||
|
private Builder() {}
|
||||||
|
|
||||||
|
public Builder<E> put(Attribute attr, E value) {
|
||||||
|
map.add(attr, value);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Builder<E> putAll(AttributeMap<E> m) {
|
||||||
|
map.addAll(m);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeMap<E> build() {
|
||||||
|
return map;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,190 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.Iterator;
|
||||||
|
import java.util.Set;
|
||||||
|
import java.util.Spliterator;
|
||||||
|
import java.util.function.Consumer;
|
||||||
|
import java.util.function.Predicate;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set variant of {@link AttributeMap} - please see that class Javadoc.
|
||||||
|
*/
|
||||||
|
public class AttributeSet implements Set<Attribute> {
|
||||||
|
|
||||||
|
public static final AttributeSet EMPTY = new AttributeSet(AttributeMap.emptyAttributeMap());
|
||||||
|
|
||||||
|
// use the same name as in HashSet
|
||||||
|
private static final Object PRESENT = new Object();
|
||||||
|
|
||||||
|
private final AttributeMap<Object> delegate;
|
||||||
|
|
||||||
|
public AttributeSet() {
|
||||||
|
delegate = new AttributeMap<>();
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeSet(Attribute attr) {
|
||||||
|
delegate = new AttributeMap<>(attr, PRESENT);
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeSet(Collection<? extends Attribute> attr) {
|
||||||
|
delegate = new AttributeMap<>();
|
||||||
|
|
||||||
|
for (Attribute a : attr) {
|
||||||
|
delegate.add(a, PRESENT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private AttributeSet(AttributeMap<Object> delegate) {
|
||||||
|
this.delegate = delegate;
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeSet combine(AttributeSet other) {
|
||||||
|
return new AttributeSet(delegate.combine(other.delegate));
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeSet subtract(AttributeSet other) {
|
||||||
|
return new AttributeSet(delegate.subtract(other.delegate));
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeSet intersect(AttributeSet other) {
|
||||||
|
return new AttributeSet(delegate.intersect(other.delegate));
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean subsetOf(AttributeSet other) {
|
||||||
|
return delegate.subsetOf(other.delegate);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Set<String> names() {
|
||||||
|
return delegate.attributeNames();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void forEach(Consumer<? super Attribute> action) {
|
||||||
|
delegate.forEach((k, v) -> action.accept(k));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int size() {
|
||||||
|
return delegate.size();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean isEmpty() {
|
||||||
|
return delegate.isEmpty();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean contains(Object o) {
|
||||||
|
return delegate.containsKey(o);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean containsAll(Collection<?> c) {
|
||||||
|
for (Object o : c) {
|
||||||
|
if (delegate.containsKey(o) == false) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Iterator<Attribute> iterator() {
|
||||||
|
return delegate.keySet().iterator();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object[] toArray() {
|
||||||
|
return delegate.keySet().toArray();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public <T> T[] toArray(T[] a) {
|
||||||
|
return delegate.keySet().toArray(a);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean add(Attribute e) {
|
||||||
|
return delegate.put(e, PRESENT) != null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean remove(Object o) {
|
||||||
|
return delegate.remove(o) != null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public void addAll(AttributeSet other) {
|
||||||
|
delegate.addAll(other.delegate);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean addAll(Collection<? extends Attribute> c) {
|
||||||
|
int size = delegate.size();
|
||||||
|
for (var e : c) {
|
||||||
|
delegate.put(e, PRESENT);
|
||||||
|
}
|
||||||
|
return delegate.size() != size;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean retainAll(Collection<?> c) {
|
||||||
|
return delegate.keySet().removeIf(e -> c.contains(e) == false);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean removeAll(Collection<?> c) {
|
||||||
|
int size = delegate.size();
|
||||||
|
for (var e : c) {
|
||||||
|
delegate.remove(e);
|
||||||
|
}
|
||||||
|
return delegate.size() != size;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void clear() {
|
||||||
|
delegate.clear();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Spliterator<Attribute> spliterator() {
|
||||||
|
return delegate.keySet().spliterator();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean removeIf(Predicate<? super Attribute> filter) {
|
||||||
|
return delegate.keySet().removeIf(filter);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Stream<Attribute> stream() {
|
||||||
|
return delegate.keySet().stream();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Stream<Attribute> parallelStream() {
|
||||||
|
return delegate.keySet().parallelStream();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object o) {
|
||||||
|
return delegate.equals(o);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return delegate.hashCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return delegate.keySet().toString();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,76 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.StringUtils;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Marker for optional attributes. Acting as a dummy placeholder to avoid using null
|
||||||
|
* in the tree (which is not allowed).
|
||||||
|
*/
|
||||||
|
public class EmptyAttribute extends Attribute {
|
||||||
|
|
||||||
|
public EmptyAttribute(Source source) {
|
||||||
|
super(source, StringUtils.EMPTY, null, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Attribute clone(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType type,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected String label() {
|
||||||
|
return "e";
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return DataTypes.NULL;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<? extends Expression> info() {
|
||||||
|
return NodeInfo.create(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return EmptyAttribute.class.hashCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,199 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.Resolvable;
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.Resolvables;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Node;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.StringUtils;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.function.Supplier;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* In a SQL statement, an Expression is whatever a user specifies inside an
|
||||||
|
* action, so for instance:
|
||||||
|
*
|
||||||
|
* {@code SELECT a, b, ABS(c) FROM i}
|
||||||
|
*
|
||||||
|
* a, b, ABS(c), and i are all Expressions, with ABS(c) being a Function
|
||||||
|
* (which is a type of expression) with a single child, c.
|
||||||
|
*/
|
||||||
|
public abstract class Expression extends Node<Expression> implements Resolvable {
|
||||||
|
|
||||||
|
public static class TypeResolution {
|
||||||
|
private final boolean failed;
|
||||||
|
private final String message;
|
||||||
|
|
||||||
|
public static final TypeResolution TYPE_RESOLVED = new TypeResolution(false, StringUtils.EMPTY);
|
||||||
|
|
||||||
|
public TypeResolution(String message) {
|
||||||
|
this(true, message);
|
||||||
|
}
|
||||||
|
|
||||||
|
private TypeResolution(boolean unresolved, String message) {
|
||||||
|
this.failed = unresolved;
|
||||||
|
this.message = message;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean unresolved() {
|
||||||
|
return failed;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean resolved() {
|
||||||
|
return failed == false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public TypeResolution and(TypeResolution other) {
|
||||||
|
return failed ? this : other;
|
||||||
|
}
|
||||||
|
|
||||||
|
public TypeResolution and(Supplier<TypeResolution> other) {
|
||||||
|
return failed ? this : other.get();
|
||||||
|
}
|
||||||
|
|
||||||
|
public String message() {
|
||||||
|
return message;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return resolved() ? "" : message;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private TypeResolution lazyTypeResolution = null;
|
||||||
|
private Boolean lazyChildrenResolved = null;
|
||||||
|
private Expression lazyCanonical = null;
|
||||||
|
private AttributeSet lazyReferences = null;
|
||||||
|
|
||||||
|
public Expression(Source source, List<Expression> children) {
|
||||||
|
super(source, children);
|
||||||
|
}
|
||||||
|
|
||||||
|
// whether the expression can be evaluated statically (folded) or not
|
||||||
|
public boolean foldable() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Object fold() {
|
||||||
|
throw new QlIllegalArgumentException("Should not fold expression");
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract Nullability nullable();
|
||||||
|
|
||||||
|
// the references/inputs/leaves of the expression tree
|
||||||
|
public AttributeSet references() {
|
||||||
|
if (lazyReferences == null) {
|
||||||
|
lazyReferences = Expressions.references(children());
|
||||||
|
}
|
||||||
|
return lazyReferences;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean childrenResolved() {
|
||||||
|
if (lazyChildrenResolved == null) {
|
||||||
|
lazyChildrenResolved = Boolean.valueOf(Resolvables.resolved(children()));
|
||||||
|
}
|
||||||
|
return lazyChildrenResolved;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Does the tree rooted at this expression have valid types at all nodes?
|
||||||
|
* <p>
|
||||||
|
* For example, {@code SIN(1.2)} has a valid type and should return
|
||||||
|
* {@link TypeResolution#TYPE_RESOLVED} to signal "this type is fine".
|
||||||
|
* Another example, {@code SIN("cat")} has an invalid type in the
|
||||||
|
* tree. The value passed to the {@code SIN} function is a string which
|
||||||
|
* doesn't make any sense. So this method should return a "failure"
|
||||||
|
* resolution which it can build by calling {@link TypeResolution#TypeResolution(String)}.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* Take {@code SIN(1.2) + COS(ATAN("cat"))}, this tree should also
|
||||||
|
* fail, specifically because {@code ATAN("cat")} is invalid. This should
|
||||||
|
* fail even though {@code +} is perfectly valid when run on the results
|
||||||
|
* of {@code SIN} and {@code COS}. And {@code COS} can operate on the results
|
||||||
|
* of any valid call to {@code ATAN}. For this method to return a "valid"
|
||||||
|
* result the <strong>whole</strong> tree rooted at this expression must
|
||||||
|
* be valid.
|
||||||
|
* </p>
|
||||||
|
*/
|
||||||
|
public final TypeResolution typeResolved() {
|
||||||
|
if (lazyTypeResolution == null) {
|
||||||
|
lazyTypeResolution = resolveType();
|
||||||
|
}
|
||||||
|
return lazyTypeResolution;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The implementation of {@link #typeResolved}, which is just a caching wrapper
|
||||||
|
* around this method. See it's javadoc for what this method should return.
|
||||||
|
* <p>
|
||||||
|
* Implementations will rarely interact with the {@link TypeResolution}
|
||||||
|
* class directly, instead usually calling the utility methods on {@link TypeResolutions}.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* Implementations should fail if {@link #childrenResolved()} returns {@code false}.
|
||||||
|
* </p>
|
||||||
|
*/
|
||||||
|
protected TypeResolution resolveType() {
|
||||||
|
return TypeResolution.TYPE_RESOLVED;
|
||||||
|
}
|
||||||
|
|
||||||
|
public final Expression canonical() {
|
||||||
|
if (lazyCanonical == null) {
|
||||||
|
lazyCanonical = canonicalize();
|
||||||
|
}
|
||||||
|
return lazyCanonical;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Expression canonicalize() {
|
||||||
|
if (children().isEmpty()) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
List<Expression> canonicalChildren = Expressions.canonicalize(children());
|
||||||
|
// check if replacement is really needed
|
||||||
|
if (children().equals(canonicalChildren)) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
return replaceChildrenSameSize(canonicalChildren);
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean semanticEquals(Expression other) {
|
||||||
|
return canonical().equals(other.canonical());
|
||||||
|
}
|
||||||
|
|
||||||
|
public int semanticHash() {
|
||||||
|
return canonical().hashCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return childrenResolved() && typeResolved().resolved();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The {@link DataType} returned by executing the tree rooted at this
|
||||||
|
* expression. If {@link #typeResolved()} returns an error then the behavior
|
||||||
|
* of this method is undefined. It <strong>may</strong> return a valid
|
||||||
|
* type. Or it may throw an exception. Or it may return a totally nonsensical
|
||||||
|
* type.
|
||||||
|
*/
|
||||||
|
public abstract DataType dataType();
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return sourceText();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String propertiesToString(boolean skipIfChild) {
|
||||||
|
return super.propertiesToString(false);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,154 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.Iterator;
|
||||||
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Set;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @param <E> expression type
|
||||||
|
*/
|
||||||
|
public final class ExpressionSet<E extends Expression> implements Set<E> {
|
||||||
|
|
||||||
|
@SuppressWarnings("rawtypes")
|
||||||
|
public static final ExpressionSet EMPTY = new ExpressionSet<>(emptyList());
|
||||||
|
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
public static <T extends Expression> ExpressionSet<T> emptySet() {
|
||||||
|
return (ExpressionSet<T>) EMPTY;
|
||||||
|
}
|
||||||
|
|
||||||
|
// canonical to actual/original association
|
||||||
|
private final Map<Expression, E> map = new LinkedHashMap<>();
|
||||||
|
|
||||||
|
public ExpressionSet() {
|
||||||
|
super();
|
||||||
|
}
|
||||||
|
|
||||||
|
public ExpressionSet(Collection<? extends E> c) {
|
||||||
|
addAll(c);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Returns the equivalent expression (if already exists in the set) or null if none is found
|
||||||
|
public E get(Expression e) {
|
||||||
|
return map.get(e.canonical());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int size() {
|
||||||
|
return map.size();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean isEmpty() {
|
||||||
|
return map.isEmpty();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean contains(Object o) {
|
||||||
|
if (o instanceof Expression) {
|
||||||
|
return map.containsKey(((Expression) o).canonical());
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean containsAll(Collection<?> c) {
|
||||||
|
for (Object o : c) {
|
||||||
|
if (contains(o) == false) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Iterator<E> iterator() {
|
||||||
|
return map.values().iterator();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean add(E e) {
|
||||||
|
return map.putIfAbsent(e.canonical(), e) == null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean addAll(Collection<? extends E> c) {
|
||||||
|
boolean result = true;
|
||||||
|
for (E o : c) {
|
||||||
|
result &= add(o);
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean retainAll(Collection<?> c) {
|
||||||
|
boolean modified = false;
|
||||||
|
|
||||||
|
Iterator<Expression> keys = map.keySet().iterator();
|
||||||
|
|
||||||
|
while (keys.hasNext()) {
|
||||||
|
Expression key = keys.next();
|
||||||
|
boolean found = false;
|
||||||
|
for (Object o : c) {
|
||||||
|
if (o instanceof Expression) {
|
||||||
|
o = ((Expression) o).canonical();
|
||||||
|
}
|
||||||
|
if (key.equals(o)) {
|
||||||
|
found = true;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (found == false) {
|
||||||
|
keys.remove();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return modified;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean remove(Object o) {
|
||||||
|
if (o instanceof Expression) {
|
||||||
|
return map.remove(((Expression) o).canonical()) != null;
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean removeAll(Collection<?> c) {
|
||||||
|
boolean modified = false;
|
||||||
|
for (Object o : c) {
|
||||||
|
modified |= remove(o);
|
||||||
|
}
|
||||||
|
return modified;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void clear() {
|
||||||
|
map.clear();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object[] toArray() {
|
||||||
|
return map.values().toArray();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public <T> T[] toArray(T[] a) {
|
||||||
|
return map.values().toArray(a);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return map.toString();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,241 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.core.Tuple;
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.Function;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.AttributeInput;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.ConstantInput;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.LinkedHashSet;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Set;
|
||||||
|
import java.util.function.Predicate;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
|
||||||
|
public final class Expressions {
|
||||||
|
|
||||||
|
private Expressions() {}
|
||||||
|
|
||||||
|
public static NamedExpression wrapAsNamed(Expression exp) {
|
||||||
|
return exp instanceof NamedExpression ne ? ne : new Alias(exp.source(), exp.sourceText(), exp);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Attribute> asAttributes(List<? extends NamedExpression> named) {
|
||||||
|
if (named.isEmpty()) {
|
||||||
|
return emptyList();
|
||||||
|
}
|
||||||
|
List<Attribute> list = new ArrayList<>(named.size());
|
||||||
|
for (NamedExpression exp : named) {
|
||||||
|
list.add(exp.toAttribute());
|
||||||
|
}
|
||||||
|
return list;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static AttributeMap<Expression> asAttributeMap(List<? extends NamedExpression> named) {
|
||||||
|
if (named.isEmpty()) {
|
||||||
|
return AttributeMap.emptyAttributeMap();
|
||||||
|
}
|
||||||
|
|
||||||
|
AttributeMap<Expression> map = new AttributeMap<>();
|
||||||
|
for (NamedExpression exp : named) {
|
||||||
|
map.add(exp.toAttribute(), exp);
|
||||||
|
}
|
||||||
|
return map;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean anyMatch(List<? extends Expression> exps, Predicate<? super Expression> predicate) {
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
if (exp.anyMatch(predicate)) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean match(List<? extends Expression> exps, Predicate<? super Expression> predicate) {
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
if (predicate.test(exp)) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Return the logical AND of a list of {@code Nullability}
|
||||||
|
* <pre>
|
||||||
|
* UNKNOWN AND TRUE/FALSE/UNKNOWN = UNKNOWN
|
||||||
|
* FALSE AND FALSE = FALSE
|
||||||
|
* TRUE AND FALSE/TRUE = TRUE
|
||||||
|
* </pre>
|
||||||
|
*/
|
||||||
|
public static Nullability nullable(List<? extends Expression> exps) {
|
||||||
|
Nullability value = Nullability.FALSE;
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
switch (exp.nullable()) {
|
||||||
|
case UNKNOWN:
|
||||||
|
return Nullability.UNKNOWN;
|
||||||
|
case TRUE:
|
||||||
|
value = Nullability.TRUE;
|
||||||
|
break;
|
||||||
|
default:
|
||||||
|
// not nullable
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Expression> canonicalize(List<? extends Expression> exps) {
|
||||||
|
List<Expression> canonical = new ArrayList<>(exps.size());
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
canonical.add(exp.canonical());
|
||||||
|
}
|
||||||
|
return canonical;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean foldable(List<? extends Expression> exps) {
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
if (exp.foldable() == false) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Object> fold(List<? extends Expression> exps) {
|
||||||
|
List<Object> folded = new ArrayList<>(exps.size());
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
folded.add(exp.fold());
|
||||||
|
}
|
||||||
|
|
||||||
|
return folded;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static AttributeSet references(List<? extends Expression> exps) {
|
||||||
|
if (exps.isEmpty()) {
|
||||||
|
return AttributeSet.EMPTY;
|
||||||
|
}
|
||||||
|
|
||||||
|
AttributeSet set = new AttributeSet();
|
||||||
|
for (Expression exp : exps) {
|
||||||
|
set.addAll(exp.references());
|
||||||
|
}
|
||||||
|
return set;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static String name(Expression e) {
|
||||||
|
return e instanceof NamedExpression ne ? ne.name() : e.sourceText();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean isNull(Expression e) {
|
||||||
|
return e.dataType() == DataTypes.NULL || (e.foldable() && e.fold() == null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<String> names(Collection<? extends Expression> e) {
|
||||||
|
List<String> names = new ArrayList<>(e.size());
|
||||||
|
for (Expression ex : e) {
|
||||||
|
names.add(name(ex));
|
||||||
|
}
|
||||||
|
|
||||||
|
return names;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Attribute attribute(Expression e) {
|
||||||
|
if (e instanceof NamedExpression ne) {
|
||||||
|
return ne.toAttribute();
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean isPresent(NamedExpression e) {
|
||||||
|
return e instanceof EmptyAttribute == false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean equalsAsAttribute(Expression left, Expression right) {
|
||||||
|
if (left.semanticEquals(right) == false) {
|
||||||
|
Attribute l = attribute(left);
|
||||||
|
return (l != null && l.semanticEquals(attribute(right)));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Tuple<Attribute, Expression>> aliases(List<? extends NamedExpression> named) {
|
||||||
|
// an alias of same name and data type can be reused (by mistake): need to use a list to collect all refs (and later report them)
|
||||||
|
List<Tuple<Attribute, Expression>> aliases = new ArrayList<>();
|
||||||
|
for (NamedExpression ne : named) {
|
||||||
|
if (ne instanceof Alias as) {
|
||||||
|
aliases.add(new Tuple<>(ne.toAttribute(), as.child()));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return aliases;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean hasReferenceAttribute(Collection<Attribute> output) {
|
||||||
|
for (Attribute attribute : output) {
|
||||||
|
if (attribute instanceof ReferenceAttribute) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Attribute> onlyPrimitiveFieldAttributes(Collection<Attribute> attributes) {
|
||||||
|
List<Attribute> filtered = new ArrayList<>();
|
||||||
|
// add only primitives
|
||||||
|
// but filter out multi fields (allow only the top-level value)
|
||||||
|
Set<Attribute> seenMultiFields = new LinkedHashSet<>();
|
||||||
|
|
||||||
|
for (Attribute a : attributes) {
|
||||||
|
if (DataTypes.isUnsupported(a.dataType()) == false && DataTypes.isPrimitive(a.dataType())) {
|
||||||
|
if (a instanceof FieldAttribute fa) {
|
||||||
|
// skip nested fields and seen multi-fields
|
||||||
|
if (fa.isNested() == false && seenMultiFields.contains(fa.parent()) == false) {
|
||||||
|
filtered.add(a);
|
||||||
|
seenMultiFields.add(a);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
filtered.add(a);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return filtered;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Pipe pipe(Expression e) {
|
||||||
|
if (e.foldable()) {
|
||||||
|
return new ConstantInput(e.source(), e, e.fold());
|
||||||
|
}
|
||||||
|
if (e instanceof NamedExpression ne) {
|
||||||
|
return new AttributeInput(e.source(), e, ne.toAttribute());
|
||||||
|
}
|
||||||
|
if (e instanceof Function f) {
|
||||||
|
return f.asPipe();
|
||||||
|
}
|
||||||
|
throw new QlIllegalArgumentException("Cannot create pipe for {}", e);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static List<Pipe> pipe(List<Expression> expressions) {
|
||||||
|
List<Pipe> pipes = new ArrayList<>(expressions.size());
|
||||||
|
for (Expression e : expressions) {
|
||||||
|
pipes.add(pipe(e));
|
||||||
|
}
|
||||||
|
return pipes;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static String id(Expression e) {
|
||||||
|
return Integer.toHexString(e.hashCode());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,156 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.Strings;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.EsField;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.StringUtils;
|
||||||
|
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Attribute for an ES field.
|
||||||
|
* To differentiate between the different type of fields this class offers:
|
||||||
|
* - name - the fully qualified name (foo.bar.tar)
|
||||||
|
* - path - the path pointing to the field name (foo.bar)
|
||||||
|
* - parent - the immediate parent of the field; useful for figuring out the type of field (nested vs object)
|
||||||
|
* - nestedParent - if nested, what's the parent (which might not be the immediate one)
|
||||||
|
*/
|
||||||
|
public class FieldAttribute extends TypedAttribute {
|
||||||
|
|
||||||
|
private final FieldAttribute parent;
|
||||||
|
private final FieldAttribute nestedParent;
|
||||||
|
private final String path;
|
||||||
|
private final EsField field;
|
||||||
|
|
||||||
|
public FieldAttribute(Source source, String name, EsField field) {
|
||||||
|
this(source, null, name, field);
|
||||||
|
}
|
||||||
|
|
||||||
|
public FieldAttribute(Source source, FieldAttribute parent, String name, EsField field) {
|
||||||
|
this(source, parent, name, field, null, Nullability.TRUE, null, false);
|
||||||
|
}
|
||||||
|
|
||||||
|
public FieldAttribute(
|
||||||
|
Source source,
|
||||||
|
FieldAttribute parent,
|
||||||
|
String name,
|
||||||
|
EsField field,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
this(source, parent, name, field.getDataType(), field, qualifier, nullability, id, synthetic);
|
||||||
|
}
|
||||||
|
|
||||||
|
public FieldAttribute(
|
||||||
|
Source source,
|
||||||
|
FieldAttribute parent,
|
||||||
|
String name,
|
||||||
|
DataType type,
|
||||||
|
EsField field,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
super(source, name, type, qualifier, nullability, id, synthetic);
|
||||||
|
this.path = parent != null ? parent.name() : StringUtils.EMPTY;
|
||||||
|
this.parent = parent;
|
||||||
|
this.field = field;
|
||||||
|
|
||||||
|
// figure out the last nested parent
|
||||||
|
FieldAttribute nestedPar = null;
|
||||||
|
if (parent != null) {
|
||||||
|
nestedPar = parent.nestedParent;
|
||||||
|
if (parent.dataType() == DataTypes.NESTED) {
|
||||||
|
nestedPar = parent;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
this.nestedParent = nestedPar;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<FieldAttribute> info() {
|
||||||
|
return NodeInfo.create(this, FieldAttribute::new, parent, name(), dataType(), field, qualifier(), nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
public FieldAttribute parent() {
|
||||||
|
return parent;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String path() {
|
||||||
|
return path;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String qualifiedPath() {
|
||||||
|
// return only the qualifier is there's no path
|
||||||
|
return qualifier() != null ? qualifier() + (Strings.hasText(path) ? "." + path : StringUtils.EMPTY) : path;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean isNested() {
|
||||||
|
return nestedParent != null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public FieldAttribute nestedParent() {
|
||||||
|
return nestedParent;
|
||||||
|
}
|
||||||
|
|
||||||
|
public EsField.Exact getExactInfo() {
|
||||||
|
return field.getExactInfo();
|
||||||
|
}
|
||||||
|
|
||||||
|
public FieldAttribute exactAttribute() {
|
||||||
|
EsField exactField = field.getExactField();
|
||||||
|
if (exactField.equals(field) == false) {
|
||||||
|
return innerField(exactField);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
private FieldAttribute innerField(EsField type) {
|
||||||
|
return new FieldAttribute(source(), this, name() + "." + type.getName(), type, qualifier(), nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Attribute clone(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType type,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
FieldAttribute qualifiedParent = parent != null ? (FieldAttribute) parent.withQualifier(qualifier) : null;
|
||||||
|
return new FieldAttribute(source, qualifiedParent, name, field, qualifier, nullability, id, synthetic);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), path);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
return super.equals(obj) && Objects.equals(path, ((FieldAttribute) obj).path);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected String label() {
|
||||||
|
return "f";
|
||||||
|
}
|
||||||
|
|
||||||
|
public EsField field() {
|
||||||
|
return field;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,19 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
|
||||||
|
public abstract class Foldables {
|
||||||
|
|
||||||
|
public static Object valueOf(Expression e) {
|
||||||
|
if (e.foldable()) {
|
||||||
|
return e.fold();
|
||||||
|
}
|
||||||
|
throw new QlIllegalArgumentException("Cannot determine value for {}", e);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,34 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
|
||||||
|
public abstract class LeafExpression extends Expression {
|
||||||
|
|
||||||
|
protected LeafExpression(Source source) {
|
||||||
|
super(source, emptyList());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Expression replaceChildren(List<Expression> newChildren) {
|
||||||
|
throw new UnsupportedOperationException("this type of node doesn't have any children to replace");
|
||||||
|
}
|
||||||
|
|
||||||
|
public AttributeSet references() {
|
||||||
|
return AttributeSet.EMPTY;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Expression canonicalize() {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,116 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* SQL Literal or constant.
|
||||||
|
*/
|
||||||
|
public class Literal extends LeafExpression {
|
||||||
|
|
||||||
|
public static final Literal TRUE = new Literal(Source.EMPTY, Boolean.TRUE, DataTypes.BOOLEAN);
|
||||||
|
public static final Literal FALSE = new Literal(Source.EMPTY, Boolean.FALSE, DataTypes.BOOLEAN);
|
||||||
|
public static final Literal NULL = new Literal(Source.EMPTY, null, DataTypes.NULL);
|
||||||
|
|
||||||
|
private final Object value;
|
||||||
|
private final DataType dataType;
|
||||||
|
|
||||||
|
public Literal(Source source, Object value, DataType dataType) {
|
||||||
|
super(source);
|
||||||
|
this.dataType = dataType;
|
||||||
|
this.value = value;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<? extends Literal> info() {
|
||||||
|
return NodeInfo.create(this, Literal::new, value, dataType);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Object value() {
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
return value == null ? Nullability.TRUE : Nullability.FALSE;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return dataType;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object fold() {
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(dataType, value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
Literal other = (Literal) obj;
|
||||||
|
return Objects.equals(value, other.value) && Objects.equals(dataType, other.dataType);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return String.valueOf(value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return toString() + "[" + dataType + "]";
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Utility method for creating a literal out of a foldable expression.
|
||||||
|
* Throws an exception if the expression is not foldable.
|
||||||
|
*/
|
||||||
|
public static Literal of(Expression foldable) {
|
||||||
|
if (foldable.foldable() == false) {
|
||||||
|
throw new QlIllegalArgumentException("Foldable expression required for Literal creation; received unfoldable " + foldable);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (foldable instanceof Literal) {
|
||||||
|
return (Literal) foldable;
|
||||||
|
}
|
||||||
|
|
||||||
|
return new Literal(foldable.source(), foldable.fold(), foldable.dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Literal of(Expression source, Object value) {
|
||||||
|
return new Literal(source.source(), value, source.dataType());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,99 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.core.Tuple;
|
||||||
|
import org.elasticsearch.index.mapper.IdFieldMapper;
|
||||||
|
import org.elasticsearch.index.mapper.SourceFieldMapper;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
|
import static org.elasticsearch.core.Tuple.tuple;
|
||||||
|
|
||||||
|
public class MetadataAttribute extends TypedAttribute {
|
||||||
|
|
||||||
|
private static final Map<String, Tuple<DataType, Boolean>> ATTRIBUTES_MAP = Map.of(
|
||||||
|
"_version",
|
||||||
|
tuple(DataTypes.LONG, false), // _version field is not searchable
|
||||||
|
"_index",
|
||||||
|
tuple(DataTypes.KEYWORD, true),
|
||||||
|
IdFieldMapper.NAME,
|
||||||
|
tuple(DataTypes.KEYWORD, false), // actually searchable, but fielddata access on the _id field is disallowed by default
|
||||||
|
SourceFieldMapper.NAME,
|
||||||
|
tuple(DataTypes.SOURCE, false)
|
||||||
|
);
|
||||||
|
|
||||||
|
private final boolean searchable;
|
||||||
|
|
||||||
|
public MetadataAttribute(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType dataType,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic,
|
||||||
|
boolean searchable
|
||||||
|
) {
|
||||||
|
super(source, name, dataType, qualifier, nullability, id, synthetic);
|
||||||
|
this.searchable = searchable;
|
||||||
|
}
|
||||||
|
|
||||||
|
public MetadataAttribute(Source source, String name, DataType dataType, boolean searchable) {
|
||||||
|
this(source, name, dataType, null, Nullability.TRUE, null, false, searchable);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected MetadataAttribute clone(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType type,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
return new MetadataAttribute(source, name, type, qualifier, nullability, id, synthetic, searchable);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected String label() {
|
||||||
|
return "m";
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<? extends Expression> info() {
|
||||||
|
return NodeInfo.create(this, MetadataAttribute::new, name(), dataType(), qualifier(), nullable(), id(), synthetic(), searchable);
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean searchable() {
|
||||||
|
return searchable;
|
||||||
|
}
|
||||||
|
|
||||||
|
private MetadataAttribute withSource(Source source) {
|
||||||
|
return new MetadataAttribute(source, name(), dataType(), qualifier(), nullable(), id(), synthetic(), searchable());
|
||||||
|
}
|
||||||
|
|
||||||
|
public static MetadataAttribute create(Source source, String name) {
|
||||||
|
var t = ATTRIBUTES_MAP.get(name);
|
||||||
|
return t != null ? new MetadataAttribute(source, name, t.v1(), t.v2()) : null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static DataType dataType(String name) {
|
||||||
|
var t = ATTRIBUTES_MAP.get(name);
|
||||||
|
return t != null ? t.v1() : null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean isSupported(String name) {
|
||||||
|
return ATTRIBUTES_MAP.containsKey(name);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,50 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import java.util.Objects;
|
||||||
|
import java.util.concurrent.atomic.AtomicLong;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unique identifier for a named expression.
|
||||||
|
* <p>
|
||||||
|
* We use an {@link AtomicLong} to guarantee that they are unique
|
||||||
|
* and that create reproducible values when run in subsequent
|
||||||
|
* tests. They don't produce reproducible values in production, but
|
||||||
|
* you rarely debug with them in production and commonly do so in
|
||||||
|
* tests.
|
||||||
|
*/
|
||||||
|
public class NameId {
|
||||||
|
private static final AtomicLong COUNTER = new AtomicLong();
|
||||||
|
private final long id;
|
||||||
|
|
||||||
|
public NameId() {
|
||||||
|
this.id = COUNTER.incrementAndGet();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(id);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (obj == this) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
NameId other = (NameId) obj;
|
||||||
|
return id == other.id;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return Long.toString(id);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,84 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An expression that has a name. Named expressions can be used as a result
|
||||||
|
* (by converting to an attribute).
|
||||||
|
*/
|
||||||
|
public abstract class NamedExpression extends Expression {
|
||||||
|
|
||||||
|
private final String name;
|
||||||
|
private final NameId id;
|
||||||
|
private final boolean synthetic;
|
||||||
|
|
||||||
|
public NamedExpression(Source source, String name, List<Expression> children, NameId id) {
|
||||||
|
this(source, name, children, id, false);
|
||||||
|
}
|
||||||
|
|
||||||
|
public NamedExpression(Source source, String name, List<Expression> children, NameId id, boolean synthetic) {
|
||||||
|
super(source, children);
|
||||||
|
this.name = name;
|
||||||
|
this.id = id == null ? new NameId() : id;
|
||||||
|
this.synthetic = synthetic;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String name() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
public NameId id() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean synthetic() {
|
||||||
|
return synthetic;
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract Attribute toAttribute();
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), name, synthetic);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
NamedExpression other = (NamedExpression) obj;
|
||||||
|
return Objects.equals(synthetic, other.synthetic)
|
||||||
|
/*
|
||||||
|
* It is important that the line below be `name`
|
||||||
|
* and not `name()` because subclasses might override
|
||||||
|
* `name()` in ways that are not compatible with
|
||||||
|
* equality. Specifically the `Unresolved` subclasses.
|
||||||
|
*/
|
||||||
|
&& Objects.equals(name, other.name)
|
||||||
|
&& Objects.equals(children(), other.children());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return super.toString() + "#" + id();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return name();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,13 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
public enum Nullability {
|
||||||
|
TRUE, // Whether the expression can become null
|
||||||
|
FALSE, // The expression can never become null
|
||||||
|
UNKNOWN // Cannot determine if the expression supports possible null folding
|
||||||
|
}
|
|
@ -0,0 +1,104 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.isExact;
|
||||||
|
|
||||||
|
public class Order extends Expression {
|
||||||
|
|
||||||
|
public enum OrderDirection {
|
||||||
|
ASC,
|
||||||
|
DESC
|
||||||
|
}
|
||||||
|
|
||||||
|
public enum NullsPosition {
|
||||||
|
FIRST,
|
||||||
|
LAST,
|
||||||
|
/**
|
||||||
|
* Nulls position has not been specified by the user and an appropriate default will be used.
|
||||||
|
*
|
||||||
|
* The default values are chosen such that it stays compatible with previous behavior. Unfortunately, this results in
|
||||||
|
* inconsistencies across different types of queries (see https://github.com/elastic/elasticsearch/issues/77068).
|
||||||
|
*/
|
||||||
|
ANY;
|
||||||
|
}
|
||||||
|
|
||||||
|
private final Expression child;
|
||||||
|
private final OrderDirection direction;
|
||||||
|
private final NullsPosition nulls;
|
||||||
|
|
||||||
|
public Order(Source source, Expression child, OrderDirection direction, NullsPosition nulls) {
|
||||||
|
super(source, singletonList(child));
|
||||||
|
this.child = child;
|
||||||
|
this.direction = direction;
|
||||||
|
this.nulls = nulls == null ? NullsPosition.ANY : nulls;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<Order> info() {
|
||||||
|
return NodeInfo.create(this, Order::new, child, direction, nulls);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
return Nullability.FALSE;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected TypeResolution resolveType() {
|
||||||
|
return isExact(child, "ORDER BY cannot be applied to field of data type [{}]: {}");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return child.dataType();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Order replaceChildren(List<Expression> newChildren) {
|
||||||
|
return new Order(source(), newChildren.get(0), direction, nulls);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression child() {
|
||||||
|
return child;
|
||||||
|
}
|
||||||
|
|
||||||
|
public OrderDirection direction() {
|
||||||
|
return direction;
|
||||||
|
}
|
||||||
|
|
||||||
|
public NullsPosition nullsPosition() {
|
||||||
|
return nulls;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(child, direction, nulls);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
Order other = (Order) obj;
|
||||||
|
return Objects.equals(direction, other.direction) && Objects.equals(nulls, other.nulls) && Objects.equals(child, other.child);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,56 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Attribute based on a reference to an expression.
|
||||||
|
*/
|
||||||
|
public class ReferenceAttribute extends TypedAttribute {
|
||||||
|
|
||||||
|
public ReferenceAttribute(Source source, String name, DataType dataType) {
|
||||||
|
this(source, name, dataType, null, Nullability.FALSE, null, false);
|
||||||
|
}
|
||||||
|
|
||||||
|
public ReferenceAttribute(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType dataType,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
super(source, name, dataType, qualifier, nullability, id, synthetic);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Attribute clone(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType dataType,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
return new ReferenceAttribute(source, name, dataType, qualifier, nullability, id, synthetic);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<ReferenceAttribute> info() {
|
||||||
|
return NodeInfo.create(this, ReferenceAttribute::new, name(), dataType(), qualifier(), nullable(), id(), synthetic());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected String label() {
|
||||||
|
return "r";
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,184 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression.TypeResolution;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.EsField;
|
||||||
|
|
||||||
|
import java.util.Locale;
|
||||||
|
import java.util.StringJoiner;
|
||||||
|
import java.util.function.Predicate;
|
||||||
|
|
||||||
|
import static org.elasticsearch.common.logging.LoggerMessageFormat.format;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.Expressions.name;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.ParamOrdinal.DEFAULT;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.BOOLEAN;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.DATETIME;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.IP;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.NULL;
|
||||||
|
|
||||||
|
public final class TypeResolutions {
|
||||||
|
|
||||||
|
public enum ParamOrdinal {
|
||||||
|
DEFAULT,
|
||||||
|
FIRST,
|
||||||
|
SECOND,
|
||||||
|
THIRD,
|
||||||
|
FOURTH,
|
||||||
|
FIFTH;
|
||||||
|
|
||||||
|
public static ParamOrdinal fromIndex(int index) {
|
||||||
|
return switch (index) {
|
||||||
|
case 0 -> FIRST;
|
||||||
|
case 1 -> SECOND;
|
||||||
|
case 2 -> THIRD;
|
||||||
|
case 3 -> FOURTH;
|
||||||
|
case 4 -> FIFTH;
|
||||||
|
default -> DEFAULT;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private TypeResolutions() {}
|
||||||
|
|
||||||
|
public static TypeResolution isBoolean(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
return isType(e, dt -> dt == BOOLEAN, operationName, paramOrd, "boolean");
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isInteger(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
return isType(e, DataType::isInteger, operationName, paramOrd, "integer");
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isNumeric(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
return isType(e, DataType::isNumeric, operationName, paramOrd, "numeric");
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isString(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
return isType(e, DataTypes::isString, operationName, paramOrd, "string");
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isIP(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
return isType(e, dt -> dt == IP, operationName, paramOrd, "ip");
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isDate(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
return isType(e, dt -> dt == DATETIME, operationName, paramOrd, "datetime");
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isExact(Expression e, String message) {
|
||||||
|
if (e instanceof FieldAttribute fa) {
|
||||||
|
EsField.Exact exact = fa.getExactInfo();
|
||||||
|
if (exact.hasExact() == false) {
|
||||||
|
return new TypeResolution(format(null, message, e.dataType().typeName(), exact.errorMsg()));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return TypeResolution.TYPE_RESOLVED;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isExact(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
if (e instanceof FieldAttribute fa) {
|
||||||
|
EsField.Exact exact = fa.getExactInfo();
|
||||||
|
if (exact.hasExact() == false) {
|
||||||
|
return new TypeResolution(
|
||||||
|
format(
|
||||||
|
null,
|
||||||
|
"[{}] cannot operate on {}field of data type [{}]: {}",
|
||||||
|
operationName,
|
||||||
|
paramOrd == null || paramOrd == DEFAULT ? "" : paramOrd.name().toLowerCase(Locale.ROOT) + " argument ",
|
||||||
|
e.dataType().typeName(),
|
||||||
|
exact.errorMsg()
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return TypeResolution.TYPE_RESOLVED;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isStringAndExact(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
TypeResolution resolution = isString(e, operationName, paramOrd);
|
||||||
|
if (resolution.unresolved()) {
|
||||||
|
return resolution;
|
||||||
|
}
|
||||||
|
|
||||||
|
return isExact(e, operationName, paramOrd);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isIPAndExact(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
TypeResolution resolution = isIP(e, operationName, paramOrd);
|
||||||
|
if (resolution.unresolved()) {
|
||||||
|
return resolution;
|
||||||
|
}
|
||||||
|
|
||||||
|
return isExact(e, operationName, paramOrd);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isFoldable(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
if (e.foldable() == false) {
|
||||||
|
return new TypeResolution(
|
||||||
|
format(
|
||||||
|
null,
|
||||||
|
"{}argument of [{}] must be a constant, received [{}]",
|
||||||
|
paramOrd == null || paramOrd == DEFAULT ? "" : paramOrd.name().toLowerCase(Locale.ROOT) + " ",
|
||||||
|
operationName,
|
||||||
|
Expressions.name(e)
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
return TypeResolution.TYPE_RESOLVED;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isNotFoldable(Expression e, String operationName, ParamOrdinal paramOrd) {
|
||||||
|
if (e.foldable()) {
|
||||||
|
return new TypeResolution(
|
||||||
|
format(
|
||||||
|
null,
|
||||||
|
"{}argument of [{}] must be a table column, found constant [{}]",
|
||||||
|
paramOrd == null || paramOrd == DEFAULT ? "" : paramOrd.name().toLowerCase(Locale.ROOT) + " ",
|
||||||
|
operationName,
|
||||||
|
Expressions.name(e)
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
return TypeResolution.TYPE_RESOLVED;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static TypeResolution isType(
|
||||||
|
Expression e,
|
||||||
|
Predicate<DataType> predicate,
|
||||||
|
String operationName,
|
||||||
|
ParamOrdinal paramOrd,
|
||||||
|
String... acceptedTypes
|
||||||
|
) {
|
||||||
|
return predicate.test(e.dataType()) || e.dataType() == NULL
|
||||||
|
? TypeResolution.TYPE_RESOLVED
|
||||||
|
: new TypeResolution(
|
||||||
|
format(
|
||||||
|
null,
|
||||||
|
"{}argument of [{}] must be [{}], found value [{}] type [{}]",
|
||||||
|
paramOrd == null || paramOrd == DEFAULT ? "" : paramOrd.name().toLowerCase(Locale.ROOT) + " ",
|
||||||
|
operationName,
|
||||||
|
acceptedTypesForErrorMsg(acceptedTypes),
|
||||||
|
name(e),
|
||||||
|
e.dataType().typeName()
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static String acceptedTypesForErrorMsg(String... acceptedTypes) {
|
||||||
|
StringJoiner sj = new StringJoiner(", ");
|
||||||
|
for (int i = 0; i < acceptedTypes.length - 1; i++) {
|
||||||
|
sj.add(acceptedTypes[i]);
|
||||||
|
}
|
||||||
|
if (acceptedTypes.length > 1) {
|
||||||
|
return sj.toString() + " or " + acceptedTypes[acceptedTypes.length - 1];
|
||||||
|
} else {
|
||||||
|
return acceptedTypes[0];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,45 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
public abstract class TypedAttribute extends Attribute {
|
||||||
|
|
||||||
|
private final DataType dataType;
|
||||||
|
|
||||||
|
protected TypedAttribute(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType dataType,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
super(source, name, qualifier, nullability, id, synthetic);
|
||||||
|
this.dataType = dataType;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return dataType;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), dataType);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
return super.equals(obj) && Objects.equals(dataType, ((TypedAttribute) obj).dataType);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,75 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
|
||||||
|
public abstract class UnaryExpression extends Expression {
|
||||||
|
|
||||||
|
private final Expression child;
|
||||||
|
|
||||||
|
protected UnaryExpression(Source source, Expression child) {
|
||||||
|
super(source, singletonList(child));
|
||||||
|
this.child = child;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final UnaryExpression replaceChildren(List<Expression> newChildren) {
|
||||||
|
return replaceChild(newChildren.get(0));
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract UnaryExpression replaceChild(Expression newChild);
|
||||||
|
|
||||||
|
public Expression child() {
|
||||||
|
return child;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return child.foldable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
return child.nullable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return child.resolved();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return child.dataType();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(child);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
UnaryExpression other = (UnaryExpression) obj;
|
||||||
|
return Objects.equals(child, other.child);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,78 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.UnresolvedException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
|
||||||
|
public class UnresolvedAlias extends UnresolvedNamedExpression {
|
||||||
|
|
||||||
|
private final Expression child;
|
||||||
|
|
||||||
|
public UnresolvedAlias(Source source, Expression child) {
|
||||||
|
super(source, singletonList(child));
|
||||||
|
this.child = child;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<UnresolvedAlias> info() {
|
||||||
|
return NodeInfo.create(this, UnresolvedAlias::new, child);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Expression replaceChildren(List<Expression> newChildren) {
|
||||||
|
return new UnresolvedAlias(source(), newChildren.get(0));
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression child() {
|
||||||
|
return child;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String unresolvedMessage() {
|
||||||
|
return "Unknown alias [" + name() + "]";
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
throw new UnresolvedException("nullable", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(child);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
/*
|
||||||
|
* Intentionally not calling the superclass
|
||||||
|
* equals because it uses id which we always
|
||||||
|
* mutate when we make a clone.
|
||||||
|
*/
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
return Objects.equals(child, ((UnresolvedAlias) obj).child);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return child + " AS ?";
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return toString();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,136 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.Unresolvable;
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.UnresolvedException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.CollectionUtils;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
// unfortunately we can't use UnresolvedNamedExpression
|
||||||
|
public class UnresolvedAttribute extends Attribute implements Unresolvable {
|
||||||
|
|
||||||
|
private final String unresolvedMsg;
|
||||||
|
private final boolean customMessage;
|
||||||
|
private final Object resolutionMetadata;
|
||||||
|
|
||||||
|
public UnresolvedAttribute(Source source, String name) {
|
||||||
|
this(source, name, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public UnresolvedAttribute(Source source, String name, String qualifier) {
|
||||||
|
this(source, name, qualifier, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public UnresolvedAttribute(Source source, String name, String qualifier, String unresolvedMessage) {
|
||||||
|
this(source, name, qualifier, null, unresolvedMessage, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("this-escape")
|
||||||
|
public UnresolvedAttribute(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
String qualifier,
|
||||||
|
NameId id,
|
||||||
|
String unresolvedMessage,
|
||||||
|
Object resolutionMetadata
|
||||||
|
) {
|
||||||
|
super(source, name, qualifier, id);
|
||||||
|
this.customMessage = unresolvedMessage != null;
|
||||||
|
this.unresolvedMsg = unresolvedMessage == null ? errorMessage(qualifiedName(), null) : unresolvedMessage;
|
||||||
|
this.resolutionMetadata = resolutionMetadata;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<UnresolvedAttribute> info() {
|
||||||
|
return NodeInfo.create(this, UnresolvedAttribute::new, name(), qualifier(), id(), unresolvedMsg, resolutionMetadata);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Object resolutionMetadata() {
|
||||||
|
return resolutionMetadata;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean customMessage() {
|
||||||
|
return customMessage;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Attribute clone(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
DataType dataType,
|
||||||
|
String qualifier,
|
||||||
|
Nullability nullability,
|
||||||
|
NameId id,
|
||||||
|
boolean synthetic
|
||||||
|
) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public UnresolvedAttribute withUnresolvedMessage(String unresolvedMessage) {
|
||||||
|
return new UnresolvedAttribute(source(), name(), qualifier(), id(), unresolvedMessage, resolutionMetadata());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
throw new UnresolvedException("dataType", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return UNRESOLVED_PREFIX + qualifiedName();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected String label() {
|
||||||
|
return UNRESOLVED_PREFIX;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String unresolvedMessage() {
|
||||||
|
return unresolvedMsg;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static String errorMessage(String name, List<String> potentialMatches) {
|
||||||
|
String msg = "Unknown column [" + name + "]";
|
||||||
|
if (CollectionUtils.isEmpty(potentialMatches) == false) {
|
||||||
|
msg += ", did you mean "
|
||||||
|
+ (potentialMatches.size() == 1 ? "[" + potentialMatches.get(0) + "]" : "any of " + potentialMatches.toString())
|
||||||
|
+ "?";
|
||||||
|
}
|
||||||
|
return msg;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), resolutionMetadata, unresolvedMsg);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (super.equals(obj)) {
|
||||||
|
UnresolvedAttribute ua = (UnresolvedAttribute) obj;
|
||||||
|
return Objects.equals(resolutionMetadata, ua.resolutionMetadata) && Objects.equals(unresolvedMsg, ua.unresolvedMsg);
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,46 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.Unresolvable;
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.UnresolvedException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
public abstract class UnresolvedNamedExpression extends NamedExpression implements Unresolvable {
|
||||||
|
|
||||||
|
public UnresolvedNamedExpression(Source source, List<Expression> children) {
|
||||||
|
super(source, "<unresolved>", children, new NameId());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String name() {
|
||||||
|
throw new UnresolvedException("name", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public NameId id() {
|
||||||
|
throw new UnresolvedException("id", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
throw new UnresolvedException("data type", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Attribute toAttribute() {
|
||||||
|
throw new UnresolvedException("attribute", this);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,87 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.UnresolvedException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
|
||||||
|
public class UnresolvedStar extends UnresolvedNamedExpression {
|
||||||
|
|
||||||
|
// typically used for nested fields or inner/dotted fields
|
||||||
|
private final UnresolvedAttribute qualifier;
|
||||||
|
|
||||||
|
public UnresolvedStar(Source source, UnresolvedAttribute qualifier) {
|
||||||
|
super(source, emptyList());
|
||||||
|
this.qualifier = qualifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<UnresolvedStar> info() {
|
||||||
|
return NodeInfo.create(this, UnresolvedStar::new, qualifier);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Expression replaceChildren(List<Expression> newChildren) {
|
||||||
|
throw new UnsupportedOperationException("this type of node doesn't have any children to replace");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
throw new UnresolvedException("nullable", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
public UnresolvedAttribute qualifier() {
|
||||||
|
return qualifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(qualifier);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
/*
|
||||||
|
* Intentionally not calling the superclass
|
||||||
|
* equals because it uses id which we always
|
||||||
|
* mutate when we make a clone. So we need
|
||||||
|
* to ignore it in equals for the transform
|
||||||
|
* tests to pass.
|
||||||
|
*/
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
UnresolvedStar other = (UnresolvedStar) obj;
|
||||||
|
return Objects.equals(qualifier, other.qualifier);
|
||||||
|
}
|
||||||
|
|
||||||
|
private String message() {
|
||||||
|
return (qualifier() != null ? qualifier().qualifiedName() + "." : "") + "*";
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String unresolvedMessage() {
|
||||||
|
return "Cannot determine columns for [" + message() + "]";
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return UNRESOLVED_PREFIX + message();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,36 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.aggregate.AggregateFunction;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.scalar.ScalarFunction;
|
||||||
|
|
||||||
|
public class DefaultFunctionTypeRegistry implements FunctionTypeRegistry {
|
||||||
|
|
||||||
|
public static final DefaultFunctionTypeRegistry INSTANCE = new DefaultFunctionTypeRegistry();
|
||||||
|
|
||||||
|
private enum Types {
|
||||||
|
AGGREGATE(AggregateFunction.class),
|
||||||
|
SCALAR(ScalarFunction.class);
|
||||||
|
|
||||||
|
private Class<? extends Function> baseClass;
|
||||||
|
|
||||||
|
Types(Class<? extends Function> base) {
|
||||||
|
this.baseClass = base;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String type(Class<? extends Function> clazz) {
|
||||||
|
for (Types type : Types.values()) {
|
||||||
|
if (type.baseClass.isAssignableFrom(clazz)) {
|
||||||
|
return type.name();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return "UNKNOWN";
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,90 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expressions;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Nullability;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.ConstantInput;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
import java.util.StringJoiner;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Any SQL expression with parentheses, like {@code MAX()}, or {@code ABS()}. A
|
||||||
|
* function is always a {@code NamedExpression}.
|
||||||
|
*/
|
||||||
|
public abstract class Function extends Expression {
|
||||||
|
|
||||||
|
private final String functionName = getClass().getSimpleName().toUpperCase(Locale.ROOT);
|
||||||
|
|
||||||
|
private Pipe lazyPipe = null;
|
||||||
|
|
||||||
|
// TODO: Functions supporting distinct should add a dedicated constructor Location, List<Expression>, boolean
|
||||||
|
protected Function(Source source, List<Expression> children) {
|
||||||
|
super(source, children);
|
||||||
|
}
|
||||||
|
|
||||||
|
public final List<Expression> arguments() {
|
||||||
|
return children();
|
||||||
|
}
|
||||||
|
|
||||||
|
public String functionName() {
|
||||||
|
return functionName;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
return Expressions.nullable(children());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(getClass(), children());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
Function other = (Function) obj;
|
||||||
|
return Objects.equals(children(), other.children());
|
||||||
|
}
|
||||||
|
|
||||||
|
public Pipe asPipe() {
|
||||||
|
if (lazyPipe == null) {
|
||||||
|
lazyPipe = foldable() ? new ConstantInput(source(), this, fold()) : makePipe();
|
||||||
|
}
|
||||||
|
return lazyPipe;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Pipe makePipe() {
|
||||||
|
throw new UnsupportedOperationException();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
StringJoiner sj = new StringJoiner(",", functionName() + "(", ")");
|
||||||
|
for (Expression ex : arguments()) {
|
||||||
|
sj.add(ex.nodeString());
|
||||||
|
}
|
||||||
|
return sj.toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract ScriptTemplate asScript();
|
||||||
|
}
|
|
@ -0,0 +1,60 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.session.Configuration;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static org.elasticsearch.common.logging.LoggerMessageFormat.format;
|
||||||
|
|
||||||
|
public class FunctionDefinition {
|
||||||
|
/**
|
||||||
|
* Converts an {@link UnresolvedFunction} into the a proper {@link Function}.
|
||||||
|
* <p>
|
||||||
|
* Provides the basic signature (unresolved function + runtime configuration object) while
|
||||||
|
* allowing extensions through the vararg extras which subclasses should expand for their
|
||||||
|
* own purposes.
|
||||||
|
*/
|
||||||
|
@FunctionalInterface
|
||||||
|
public interface Builder {
|
||||||
|
Function build(UnresolvedFunction uf, Configuration configuration, Object... extras);
|
||||||
|
}
|
||||||
|
|
||||||
|
private final String name;
|
||||||
|
private final List<String> aliases;
|
||||||
|
private final Class<? extends Function> clazz;
|
||||||
|
private final Builder builder;
|
||||||
|
|
||||||
|
public FunctionDefinition(String name, List<String> aliases, Class<? extends Function> clazz, Builder builder) {
|
||||||
|
this.name = name;
|
||||||
|
this.aliases = aliases;
|
||||||
|
this.clazz = clazz;
|
||||||
|
this.builder = builder;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String name() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
public List<String> aliases() {
|
||||||
|
return aliases;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Class<? extends Function> clazz() {
|
||||||
|
return clazz;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Builder builder() {
|
||||||
|
return builder;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return format(null, "{}({})", name, aliases.isEmpty() ? "" : aliases.size() == 1 ? aliases.get(0) : aliases);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,463 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.Strings;
|
||||||
|
import org.elasticsearch.common.util.CollectionUtils;
|
||||||
|
import org.elasticsearch.xpack.esql.core.ParsingException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.session.Configuration;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.Check;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collection;
|
||||||
|
import java.util.HashMap;
|
||||||
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Map.Entry;
|
||||||
|
import java.util.function.BiFunction;
|
||||||
|
import java.util.regex.Pattern;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
import static java.util.Collections.unmodifiableList;
|
||||||
|
import static java.util.stream.Collectors.toList;
|
||||||
|
|
||||||
|
public class FunctionRegistry {
|
||||||
|
|
||||||
|
// Translation table for error messaging in the following function
|
||||||
|
private static final String[] NUM_NAMES = { "zero", "one", "two", "three", "four", "five", };
|
||||||
|
|
||||||
|
// list of functions grouped by type of functions (aggregate, statistics, math etc) and ordered alphabetically inside each group
|
||||||
|
// a single function will have one entry for itself with its name associated to its instance and, also, one entry for each alias
|
||||||
|
// it has with the alias name associated to the FunctionDefinition instance
|
||||||
|
private final Map<String, FunctionDefinition> defs = new LinkedHashMap<>();
|
||||||
|
private final Map<String, String> aliases = new HashMap<>();
|
||||||
|
|
||||||
|
public FunctionRegistry() {}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Register the given function definitions with this registry.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("this-escape")
|
||||||
|
public FunctionRegistry(FunctionDefinition... functions) {
|
||||||
|
register(functions);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("this-escape")
|
||||||
|
public FunctionRegistry(FunctionDefinition[]... groupFunctions) {
|
||||||
|
register(groupFunctions);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected void register(FunctionDefinition[]... groupFunctions) {
|
||||||
|
for (FunctionDefinition[] group : groupFunctions) {
|
||||||
|
register(group);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
protected void register(FunctionDefinition... functions) {
|
||||||
|
// temporary map to hold [function_name/alias_name : function instance]
|
||||||
|
Map<String, FunctionDefinition> batchMap = new HashMap<>();
|
||||||
|
for (FunctionDefinition f : functions) {
|
||||||
|
batchMap.put(f.name(), f);
|
||||||
|
for (String alias : f.aliases()) {
|
||||||
|
Object old = batchMap.put(alias, f);
|
||||||
|
if (old != null || defs.containsKey(alias)) {
|
||||||
|
throw new QlIllegalArgumentException(
|
||||||
|
"alias ["
|
||||||
|
+ alias
|
||||||
|
+ "] is used by "
|
||||||
|
+ "["
|
||||||
|
+ (old != null ? old : defs.get(alias).name())
|
||||||
|
+ "] and ["
|
||||||
|
+ f.name()
|
||||||
|
+ "]"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
aliases.put(alias, f.name());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// sort the temporary map by key name and add it to the global map of functions
|
||||||
|
defs.putAll(
|
||||||
|
batchMap.entrySet()
|
||||||
|
.stream()
|
||||||
|
.sorted(Map.Entry.comparingByKey())
|
||||||
|
.collect(
|
||||||
|
Collectors.<
|
||||||
|
Entry<String, FunctionDefinition>,
|
||||||
|
String,
|
||||||
|
FunctionDefinition,
|
||||||
|
LinkedHashMap<String, FunctionDefinition>>toMap(
|
||||||
|
Map.Entry::getKey,
|
||||||
|
Map.Entry::getValue,
|
||||||
|
(oldValue, newValue) -> oldValue,
|
||||||
|
LinkedHashMap::new
|
||||||
|
)
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
public FunctionDefinition resolveFunction(String functionName) {
|
||||||
|
FunctionDefinition def = defs.get(functionName);
|
||||||
|
if (def == null) {
|
||||||
|
throw new QlIllegalArgumentException("Cannot find function {}; this should have been caught during analysis", functionName);
|
||||||
|
}
|
||||||
|
return def;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected String normalize(String name) {
|
||||||
|
return name.toUpperCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
|
||||||
|
public String resolveAlias(String alias) {
|
||||||
|
String normalized = normalize(alias);
|
||||||
|
return aliases.getOrDefault(normalized, normalized);
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean functionExists(String functionName) {
|
||||||
|
return defs.containsKey(functionName);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Collection<FunctionDefinition> listFunctions() {
|
||||||
|
// It is worth double checking if we need this copy. These are immutable anyway.
|
||||||
|
return defs.values();
|
||||||
|
}
|
||||||
|
|
||||||
|
public Collection<FunctionDefinition> listFunctions(String pattern) {
|
||||||
|
// It is worth double checking if we need this copy. These are immutable anyway.
|
||||||
|
Pattern p = Strings.hasText(pattern) ? Pattern.compile(normalize(pattern)) : null;
|
||||||
|
return defs.entrySet()
|
||||||
|
.stream()
|
||||||
|
.filter(e -> p == null || p.matcher(e.getKey()).matches())
|
||||||
|
.map(e -> cloneDefinition(e.getKey(), e.getValue()))
|
||||||
|
.collect(toList());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected FunctionDefinition cloneDefinition(String name, FunctionDefinition definition) {
|
||||||
|
return new FunctionDefinition(name, emptyList(), definition.clazz(), definition.builder());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface FunctionBuilder {
|
||||||
|
Function build(Source source, List<Expression> children, Configuration cfg);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Main method to register a function.
|
||||||
|
*
|
||||||
|
* @param names Must always have at least one entry which is the method's primary name
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads")
|
||||||
|
protected static FunctionDefinition def(Class<? extends Function> function, FunctionBuilder builder, String... names) {
|
||||||
|
Check.isTrue(names.length > 0, "At least one name must be provided for the function");
|
||||||
|
String primaryName = names[0];
|
||||||
|
List<String> aliases = Arrays.asList(names).subList(1, names.length);
|
||||||
|
FunctionDefinition.Builder realBuilder = (uf, cfg, extras) -> {
|
||||||
|
if (CollectionUtils.isEmpty(extras) == false) {
|
||||||
|
throw new ParsingException(
|
||||||
|
uf.source(),
|
||||||
|
"Unused parameters {} detected when building [{}]",
|
||||||
|
Arrays.toString(extras),
|
||||||
|
primaryName
|
||||||
|
);
|
||||||
|
}
|
||||||
|
try {
|
||||||
|
return builder.build(uf.source(), uf.children(), cfg);
|
||||||
|
} catch (QlIllegalArgumentException e) {
|
||||||
|
throw new ParsingException(e, uf.source(), "error building [{}]: {}", primaryName, e.getMessage());
|
||||||
|
}
|
||||||
|
};
|
||||||
|
return new FunctionDefinition(primaryName, unmodifiableList(aliases), function, realBuilder);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a no-argument function.
|
||||||
|
*/
|
||||||
|
protected static <T extends Function> FunctionDefinition def(
|
||||||
|
Class<T> function,
|
||||||
|
java.util.function.Function<Source, T> ctorRef,
|
||||||
|
String... names
|
||||||
|
) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
if (false == children.isEmpty()) {
|
||||||
|
throw new QlIllegalArgumentException("expects no arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.apply(source);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a unary function.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
public static <T extends Function> FunctionDefinition def(
|
||||||
|
Class<T> function,
|
||||||
|
BiFunction<Source, Expression, T> ctorRef,
|
||||||
|
String... names
|
||||||
|
) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
if (children.size() != 1) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly one argument");
|
||||||
|
}
|
||||||
|
return ctorRef.apply(source, children.get(0));
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for multi-arg/n-ary function.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected <T extends Function> FunctionDefinition def(Class<T> function, NaryBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> { return ctorRef.build(source, children); };
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface NaryBuilder<T> {
|
||||||
|
T build(Source source, List<Expression> children);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a binary function.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected static <T extends Function> FunctionDefinition def(Class<T> function, BinaryBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
boolean isBinaryOptionalParamFunction = OptionalArgument.class.isAssignableFrom(function);
|
||||||
|
if (isBinaryOptionalParamFunction && (children.size() > 2 || children.size() < 1)) {
|
||||||
|
throw new QlIllegalArgumentException("expects one or two arguments");
|
||||||
|
} else if (isBinaryOptionalParamFunction == false && children.size() != 2) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly two arguments");
|
||||||
|
}
|
||||||
|
|
||||||
|
return ctorRef.build(source, children.get(0), children.size() == 2 ? children.get(1) : null);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface BinaryBuilder<T> {
|
||||||
|
T build(Source source, Expression left, Expression right);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a ternary function.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected static <T extends Function> FunctionDefinition def(Class<T> function, TernaryBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
boolean hasMinimumTwo = OptionalArgument.class.isAssignableFrom(function);
|
||||||
|
if (hasMinimumTwo && (children.size() > 3 || children.size() < 2)) {
|
||||||
|
throw new QlIllegalArgumentException("expects two or three arguments");
|
||||||
|
} else if (hasMinimumTwo == false && children.size() != 3) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly three arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(source, children.get(0), children.get(1), children.size() == 3 ? children.get(2) : null);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface TernaryBuilder<T> {
|
||||||
|
T build(Source source, Expression one, Expression two, Expression three);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a quaternary function.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected static <T extends Function> FunctionDefinition def(Class<T> function, QuaternaryBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
if (OptionalArgument.class.isAssignableFrom(function)) {
|
||||||
|
if (children.size() > 4 || children.size() < 3) {
|
||||||
|
throw new QlIllegalArgumentException("expects three or four arguments");
|
||||||
|
}
|
||||||
|
} else if (TwoOptionalArguments.class.isAssignableFrom(function)) {
|
||||||
|
if (children.size() > 4 || children.size() < 2) {
|
||||||
|
throw new QlIllegalArgumentException("expects minimum two, maximum four arguments");
|
||||||
|
}
|
||||||
|
} else if (children.size() != 4) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly four arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(
|
||||||
|
source,
|
||||||
|
children.get(0),
|
||||||
|
children.get(1),
|
||||||
|
children.size() > 2 ? children.get(2) : null,
|
||||||
|
children.size() > 3 ? children.get(3) : null
|
||||||
|
);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface QuaternaryBuilder<T> {
|
||||||
|
T build(Source source, Expression one, Expression two, Expression three, Expression four);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a quinary function.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected static <T extends Function> FunctionDefinition def(
|
||||||
|
Class<T> function,
|
||||||
|
QuinaryBuilder<T> ctorRef,
|
||||||
|
int numOptionalParams,
|
||||||
|
String... names
|
||||||
|
) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
final int NUM_TOTAL_PARAMS = 5;
|
||||||
|
boolean hasOptionalParams = OptionalArgument.class.isAssignableFrom(function);
|
||||||
|
if (hasOptionalParams && (children.size() > NUM_TOTAL_PARAMS || children.size() < NUM_TOTAL_PARAMS - numOptionalParams)) {
|
||||||
|
throw new QlIllegalArgumentException(
|
||||||
|
"expects between "
|
||||||
|
+ NUM_NAMES[NUM_TOTAL_PARAMS - numOptionalParams]
|
||||||
|
+ " and "
|
||||||
|
+ NUM_NAMES[NUM_TOTAL_PARAMS]
|
||||||
|
+ " arguments"
|
||||||
|
);
|
||||||
|
} else if (hasOptionalParams == false && children.size() != NUM_TOTAL_PARAMS) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly " + NUM_NAMES[NUM_TOTAL_PARAMS] + " arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(
|
||||||
|
source,
|
||||||
|
children.size() > 0 ? children.get(0) : null,
|
||||||
|
children.size() > 1 ? children.get(1) : null,
|
||||||
|
children.size() > 2 ? children.get(2) : null,
|
||||||
|
children.size() > 3 ? children.get(3) : null,
|
||||||
|
children.size() > 4 ? children.get(4) : null
|
||||||
|
);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface QuinaryBuilder<T> {
|
||||||
|
T build(Source source, Expression one, Expression two, Expression three, Expression four, Expression five);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for functions with a mandatory argument followed by a varidic list.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected static <T extends Function> FunctionDefinition def(Class<T> function, UnaryVariadicBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
boolean hasMinimumOne = OptionalArgument.class.isAssignableFrom(function);
|
||||||
|
if (hasMinimumOne && children.size() < 1) {
|
||||||
|
throw new QlIllegalArgumentException("expects at least one argument");
|
||||||
|
} else if (hasMinimumOne == false && children.size() < 2) {
|
||||||
|
throw new QlIllegalArgumentException("expects at least two arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(source, children.get(0), children.subList(1, children.size()));
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface UnaryVariadicBuilder<T> {
|
||||||
|
T build(Source source, Expression exp, List<Expression> variadic);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a no-argument function that is configuration aware.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads")
|
||||||
|
protected static <T extends Function> FunctionDefinition def(Class<T> function, ConfigurationAwareBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
if (false == children.isEmpty()) {
|
||||||
|
throw new QlIllegalArgumentException("expects no arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(source, cfg);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface ConfigurationAwareBuilder<T> {
|
||||||
|
T build(Source source, Configuration configuration);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a one-argument function that is configuration aware.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads")
|
||||||
|
protected static <T extends Function> FunctionDefinition def(
|
||||||
|
Class<T> function,
|
||||||
|
UnaryConfigurationAwareBuilder<T> ctorRef,
|
||||||
|
String... names
|
||||||
|
) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
if (children.size() > 1) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly one argument");
|
||||||
|
}
|
||||||
|
Expression ex = children.size() == 1 ? children.get(0) : null;
|
||||||
|
return ctorRef.build(source, ex, cfg);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface UnaryConfigurationAwareBuilder<T> {
|
||||||
|
T build(Source source, Expression exp, Configuration configuration);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a binary function that is configuration aware.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected static <T extends Function> FunctionDefinition def(
|
||||||
|
Class<T> function,
|
||||||
|
BinaryConfigurationAwareBuilder<T> ctorRef,
|
||||||
|
String... names
|
||||||
|
) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
boolean isBinaryOptionalParamFunction = OptionalArgument.class.isAssignableFrom(function);
|
||||||
|
if (isBinaryOptionalParamFunction && (children.size() > 2 || children.size() < 1)) {
|
||||||
|
throw new QlIllegalArgumentException("expects one or two arguments");
|
||||||
|
} else if (isBinaryOptionalParamFunction == false && children.size() != 2) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly two arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(source, children.get(0), children.size() == 2 ? children.get(1) : null, cfg);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface BinaryConfigurationAwareBuilder<T> {
|
||||||
|
T build(Source source, Expression left, Expression right, Configuration configuration);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a {@linkplain FunctionDefinition} for a ternary function that is configuration aware.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("overloads") // These are ambiguous if you aren't using ctor references but we always do
|
||||||
|
protected <T extends Function> FunctionDefinition def(Class<T> function, TernaryConfigurationAwareBuilder<T> ctorRef, String... names) {
|
||||||
|
FunctionBuilder builder = (source, children, cfg) -> {
|
||||||
|
boolean hasMinimumTwo = OptionalArgument.class.isAssignableFrom(function);
|
||||||
|
if (hasMinimumTwo && (children.size() > 3 || children.size() < 2)) {
|
||||||
|
throw new QlIllegalArgumentException("expects two or three arguments");
|
||||||
|
} else if (hasMinimumTwo == false && children.size() != 3) {
|
||||||
|
throw new QlIllegalArgumentException("expects exactly three arguments");
|
||||||
|
}
|
||||||
|
return ctorRef.build(source, children.get(0), children.get(1), children.size() == 3 ? children.get(2) : null, cfg);
|
||||||
|
};
|
||||||
|
return def(function, builder, names);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected interface TernaryConfigurationAwareBuilder<T> {
|
||||||
|
T build(Source source, Expression one, Expression two, Expression three, Configuration configuration);
|
||||||
|
}
|
||||||
|
|
||||||
|
//
|
||||||
|
// Utility method for extra argument extraction.
|
||||||
|
//
|
||||||
|
protected static Boolean asBool(Object[] extras) {
|
||||||
|
if (CollectionUtils.isEmpty(extras)) {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
if (extras.length != 1 || (extras[0] instanceof Boolean) == false) {
|
||||||
|
throw new QlIllegalArgumentException("Invalid number and types of arguments given to function definition");
|
||||||
|
}
|
||||||
|
return (Boolean) extras[0];
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,48 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.session.Configuration;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Strategy indicating the type of resolution to apply for resolving the actual function definition in a pluggable way.
|
||||||
|
*/
|
||||||
|
public interface FunctionResolutionStrategy {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default behavior of standard function calls like {@code ABS(col)}.
|
||||||
|
*/
|
||||||
|
FunctionResolutionStrategy DEFAULT = new FunctionResolutionStrategy() {
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build the real function from this one and resolution metadata.
|
||||||
|
*/
|
||||||
|
default Function buildResolved(UnresolvedFunction uf, Configuration cfg, FunctionDefinition def) {
|
||||||
|
return def.builder().build(uf, cfg);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The kind of strategy being applied. Used when
|
||||||
|
* building the error message sent back to the user when
|
||||||
|
* they specify a function that doesn't exist.
|
||||||
|
*/
|
||||||
|
default String kind() {
|
||||||
|
return "function";
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Is {@code def} a valid alternative for function invocations
|
||||||
|
* of this kind. Used to filter the list of "did you mean"
|
||||||
|
* options sent back to the user when they specify a missing
|
||||||
|
* function.
|
||||||
|
*/
|
||||||
|
default boolean isValidAlternative(FunctionDefinition def) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,13 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
public interface FunctionTypeRegistry {
|
||||||
|
|
||||||
|
String type(Class<? extends Function> clazz);
|
||||||
|
}
|
|
@ -0,0 +1,22 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.aggregate.AggregateFunction;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.grouping.GroupingFunction;
|
||||||
|
|
||||||
|
public abstract class Functions {
|
||||||
|
|
||||||
|
public static boolean isAggregate(Expression e) {
|
||||||
|
return e instanceof AggregateFunction;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean isGrouping(Expression e) {
|
||||||
|
return e instanceof GroupingFunction;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,16 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Marker interface indicating that a function accepts one optional argument (typically the last one).
|
||||||
|
* This is used by the {@link FunctionRegistry} to perform validation of function declaration.
|
||||||
|
*/
|
||||||
|
public interface OptionalArgument {
|
||||||
|
|
||||||
|
}
|
|
@ -0,0 +1,16 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Marker interface indicating that a function accepts two optional arguments (the last two).
|
||||||
|
* This is used by the {@link FunctionRegistry} to perform validation of function declaration.
|
||||||
|
*/
|
||||||
|
public interface TwoOptionalArguments {
|
||||||
|
|
||||||
|
}
|
|
@ -0,0 +1,170 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.Unresolvable;
|
||||||
|
import org.elasticsearch.xpack.esql.core.capabilities.UnresolvedException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Nullability;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.session.Configuration;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.StringUtils;
|
||||||
|
|
||||||
|
import java.util.LinkedHashSet;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
import java.util.Set;
|
||||||
|
|
||||||
|
public class UnresolvedFunction extends Function implements Unresolvable {
|
||||||
|
|
||||||
|
private final String name;
|
||||||
|
private final String unresolvedMsg;
|
||||||
|
private final FunctionResolutionStrategy resolution;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Flag to indicate analysis has been applied and there's no point in
|
||||||
|
* doing it again this is an optimization to prevent searching for a
|
||||||
|
* better unresolved message over and over again.
|
||||||
|
*/
|
||||||
|
private final boolean analyzed;
|
||||||
|
|
||||||
|
public UnresolvedFunction(Source source, String name, FunctionResolutionStrategy resolutionStrategy, List<Expression> children) {
|
||||||
|
this(source, name, resolutionStrategy, children, false, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Constructor used for specifying a more descriptive message (typically
|
||||||
|
* 'did you mean') instead of the default one.
|
||||||
|
*
|
||||||
|
* @see #withMessage(String)
|
||||||
|
*/
|
||||||
|
UnresolvedFunction(
|
||||||
|
Source source,
|
||||||
|
String name,
|
||||||
|
FunctionResolutionStrategy resolutionStrategy,
|
||||||
|
List<Expression> children,
|
||||||
|
boolean analyzed,
|
||||||
|
String unresolvedMessage
|
||||||
|
) {
|
||||||
|
super(source, children);
|
||||||
|
this.name = name;
|
||||||
|
this.resolution = resolutionStrategy;
|
||||||
|
this.analyzed = analyzed;
|
||||||
|
this.unresolvedMsg = unresolvedMessage == null ? "Unknown " + resolutionStrategy.kind() + " [" + name + "]" : unresolvedMessage;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<UnresolvedFunction> info() {
|
||||||
|
return NodeInfo.create(this, UnresolvedFunction::new, name, resolution, children(), analyzed, unresolvedMsg);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Expression replaceChildren(List<Expression> newChildren) {
|
||||||
|
return new UnresolvedFunction(source(), name, resolution, newChildren, analyzed, unresolvedMsg);
|
||||||
|
}
|
||||||
|
|
||||||
|
public UnresolvedFunction withMessage(String message) {
|
||||||
|
return new UnresolvedFunction(source(), name(), resolution, children(), true, message);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a function to replace this one after resolving the function.
|
||||||
|
*/
|
||||||
|
public Function buildResolved(Configuration configuration, FunctionDefinition def) {
|
||||||
|
return resolution.buildResolved(this, configuration, def);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a marker {@link UnresolvedFunction} with an error message
|
||||||
|
* about the function being missing.
|
||||||
|
*/
|
||||||
|
public UnresolvedFunction missing(String normalizedName, Iterable<FunctionDefinition> alternatives) {
|
||||||
|
// try to find alternatives
|
||||||
|
Set<String> names = new LinkedHashSet<>();
|
||||||
|
for (FunctionDefinition def : alternatives) {
|
||||||
|
if (resolution.isValidAlternative(def)) {
|
||||||
|
names.add(def.name());
|
||||||
|
names.addAll(def.aliases());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
List<String> matches = StringUtils.findSimilar(normalizedName, names);
|
||||||
|
if (matches.isEmpty()) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
String matchesMessage = matches.size() == 1 ? "[" + matches.get(0) + "]" : "any of " + matches;
|
||||||
|
return withMessage("Unknown " + resolution.kind() + " [" + name + "], did you mean " + matchesMessage + "?");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String name() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
public FunctionResolutionStrategy resolutionStrategy() {
|
||||||
|
return resolution;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean analyzed() {
|
||||||
|
return analyzed;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
throw new UnresolvedException("dataType", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Nullability nullable() {
|
||||||
|
throw new UnresolvedException("nullable", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
throw new UnresolvedException("script", this);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String unresolvedMessage() {
|
||||||
|
return unresolvedMsg;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return UNRESOLVED_PREFIX + name + children();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String nodeString() {
|
||||||
|
return toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (obj == null || obj.getClass() != getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
UnresolvedFunction other = (UnresolvedFunction) obj;
|
||||||
|
return name.equals(other.name)
|
||||||
|
&& resolution.equals(other.resolution)
|
||||||
|
&& children().equals(other.children())
|
||||||
|
&& analyzed == other.analyzed
|
||||||
|
&& Objects.equals(unresolvedMsg, other.unresolvedMsg);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(name, resolution, children(), analyzed, unresolvedMsg);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,83 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.aggregate;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.TypeResolutions;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.Function;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.AggNameInput;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.CollectionUtils;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.ParamOrdinal.DEFAULT;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A type of {@code Function} that takes multiple values and extracts a single value out of them. For example, {@code AVG()}.
|
||||||
|
*/
|
||||||
|
public abstract class AggregateFunction extends Function {
|
||||||
|
|
||||||
|
private final Expression field;
|
||||||
|
private final List<? extends Expression> parameters;
|
||||||
|
|
||||||
|
protected AggregateFunction(Source source, Expression field) {
|
||||||
|
this(source, field, emptyList());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected AggregateFunction(Source source, Expression field, List<? extends Expression> parameters) {
|
||||||
|
super(source, CollectionUtils.combine(singletonList(field), parameters));
|
||||||
|
this.field = field;
|
||||||
|
this.parameters = parameters;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression field() {
|
||||||
|
return field;
|
||||||
|
}
|
||||||
|
|
||||||
|
public List<? extends Expression> parameters() {
|
||||||
|
return parameters;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected TypeResolution resolveType() {
|
||||||
|
return TypeResolutions.isExact(field, sourceText(), DEFAULT);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Pipe makePipe() {
|
||||||
|
// unresolved AggNameInput (should always get replaced by the folder)
|
||||||
|
return new AggNameInput(source(), this, sourceText());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
throw new QlIllegalArgumentException("Aggregate functions cannot be scripted");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
// NB: the hashcode is currently used for key generation so
|
||||||
|
// to avoid clashes between aggs with the same arguments, add the class name as variation
|
||||||
|
return Objects.hash(getClass(), children());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (super.equals(obj)) {
|
||||||
|
AggregateFunction other = (AggregateFunction) obj;
|
||||||
|
return Objects.equals(other.field(), field()) && Objects.equals(other.parameters(), parameters());
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,22 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.aggregate;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Marker type for compound aggregates, that is an aggregate that provides multiple values (like Stats or Matrix)
|
||||||
|
*/
|
||||||
|
public interface CompoundAggregate {
|
||||||
|
|
||||||
|
Expression field();
|
||||||
|
|
||||||
|
List<? extends Expression> parameters();
|
||||||
|
}
|
|
@ -0,0 +1,64 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.aggregate;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Count the number of documents matched ({@code COUNT})
|
||||||
|
* <strong>OR</strong> count the number of distinct values
|
||||||
|
* for a field that matched ({@code COUNT(DISTINCT}.
|
||||||
|
*/
|
||||||
|
public class Count extends AggregateFunction {
|
||||||
|
|
||||||
|
private final boolean distinct;
|
||||||
|
|
||||||
|
public Count(Source source, Expression field, boolean distinct) {
|
||||||
|
super(source, field);
|
||||||
|
this.distinct = distinct;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<Count> info() {
|
||||||
|
return NodeInfo.create(this, Count::new, field(), distinct);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Count replaceChildren(List<Expression> newChildren) {
|
||||||
|
return new Count(source(), newChildren.get(0), distinct);
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean distinct() {
|
||||||
|
return distinct;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return DataTypes.LONG;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), distinct());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (super.equals(obj)) {
|
||||||
|
Count other = (Count) obj;
|
||||||
|
return Objects.equals(other.distinct(), distinct());
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,13 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.aggregate;
|
||||||
|
|
||||||
|
// Agg 'enclosed' by another agg. Used for agg that return multiple embedded aggs (like MatrixStats)
|
||||||
|
public interface EnclosedAgg {
|
||||||
|
|
||||||
|
String innerName();
|
||||||
|
}
|
|
@ -0,0 +1,98 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.aggregate;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.Check;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
public class InnerAggregate extends AggregateFunction {
|
||||||
|
|
||||||
|
private final AggregateFunction inner;
|
||||||
|
private final CompoundAggregate outer;
|
||||||
|
private final String innerName;
|
||||||
|
// used when the result needs to be extracted from a map (like in MatrixAggs or Percentiles)
|
||||||
|
private final Expression innerKey;
|
||||||
|
|
||||||
|
public InnerAggregate(AggregateFunction inner, CompoundAggregate outer) {
|
||||||
|
this(inner.source(), inner, outer, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
public InnerAggregate(Source source, AggregateFunction inner, CompoundAggregate outer, Expression innerKey) {
|
||||||
|
super(source, outer.field(), outer.parameters());
|
||||||
|
this.inner = inner;
|
||||||
|
this.outer = outer;
|
||||||
|
Check.isTrue(inner instanceof EnclosedAgg, "Inner function is not marked as Enclosed");
|
||||||
|
Check.isTrue(outer instanceof Expression, "CompoundAggregate is not an Expression");
|
||||||
|
this.innerName = ((EnclosedAgg) inner).innerName();
|
||||||
|
this.innerKey = innerKey;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<InnerAggregate> info() {
|
||||||
|
return NodeInfo.create(this, InnerAggregate::new, inner, outer, innerKey);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Expression replaceChildren(List<Expression> newChildren) {
|
||||||
|
/* I can't figure out how rewriting this one's children ever worked because its
|
||||||
|
* are all twisted up in `outer`. Refusing to rewrite it doesn't break anything
|
||||||
|
* that I can see right now so lets just go with it and hope for the best.
|
||||||
|
* Maybe someone will make this make sense one day! */
|
||||||
|
throw new UnsupportedOperationException("can't be rewritten");
|
||||||
|
}
|
||||||
|
|
||||||
|
public AggregateFunction inner() {
|
||||||
|
return inner;
|
||||||
|
}
|
||||||
|
|
||||||
|
public CompoundAggregate outer() {
|
||||||
|
return outer;
|
||||||
|
}
|
||||||
|
|
||||||
|
public String innerName() {
|
||||||
|
return innerName;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression innerKey() {
|
||||||
|
return innerKey;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return inner.dataType();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String functionName() {
|
||||||
|
return inner.functionName();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(inner, outer, innerKey);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (super.equals(obj)) {
|
||||||
|
InnerAggregate other = (InnerAggregate) obj;
|
||||||
|
return Objects.equals(inner, other.inner) && Objects.equals(outer, other.outer) && Objects.equals(innerKey, other.innerKey);
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return nodeName() + "[" + outer + ">" + inner.nodeName() + "]";
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,51 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.aggregate;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* All spatial aggregate functions extend this class to enable the planning of reading from doc values for higher performance.
|
||||||
|
* The AggregateMapper class will generate multiple aggregation functions for each combination, allowing the planner to
|
||||||
|
* select the best one.
|
||||||
|
*/
|
||||||
|
public abstract class SpatialAggregateFunction extends AggregateFunction {
|
||||||
|
protected final boolean useDocValues;
|
||||||
|
|
||||||
|
protected SpatialAggregateFunction(Source source, Expression field, boolean useDocValues) {
|
||||||
|
super(source, field);
|
||||||
|
this.useDocValues = useDocValues;
|
||||||
|
}
|
||||||
|
|
||||||
|
public abstract SpatialAggregateFunction withDocValues();
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
// NB: the hashcode is currently used for key generation so
|
||||||
|
// to avoid clashes between aggs with the same arguments, add the class name as variation
|
||||||
|
return Objects.hash(getClass(), children(), useDocValues);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (super.equals(obj)) {
|
||||||
|
SpatialAggregateFunction other = (SpatialAggregateFunction) obj;
|
||||||
|
return Objects.equals(other.field(), field())
|
||||||
|
&& Objects.equals(other.parameters(), parameters())
|
||||||
|
&& Objects.equals(other.useDocValues, useDocValues);
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean useDocValues() {
|
||||||
|
return useDocValues;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,74 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.grouping;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.Function;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.AggNameInput;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.CollectionUtils;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A type of {@code Function} that creates groups or buckets.
|
||||||
|
*/
|
||||||
|
public abstract class GroupingFunction extends Function {
|
||||||
|
|
||||||
|
private final Expression field;
|
||||||
|
private final List<Expression> parameters;
|
||||||
|
|
||||||
|
protected GroupingFunction(Source source, Expression field) {
|
||||||
|
this(source, field, emptyList());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected GroupingFunction(Source source, Expression field, List<Expression> parameters) {
|
||||||
|
super(source, CollectionUtils.combine(singletonList(field), parameters));
|
||||||
|
this.field = field;
|
||||||
|
this.parameters = parameters;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression field() {
|
||||||
|
return field;
|
||||||
|
}
|
||||||
|
|
||||||
|
public List<Expression> parameters() {
|
||||||
|
return parameters;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Pipe makePipe() {
|
||||||
|
// unresolved AggNameInput (should always get replaced by the folder)
|
||||||
|
return new AggNameInput(source(), this, sourceText());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
throw new QlIllegalArgumentException("Grouping functions cannot be scripted");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (false == super.equals(obj)) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
GroupingFunction other = (GroupingFunction) obj;
|
||||||
|
return Objects.equals(other.field(), field()) && Objects.equals(other.parameters(), parameters());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(field(), parameters());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,58 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
public abstract class BaseSurrogateFunction extends ScalarFunction implements SurrogateFunction {
|
||||||
|
|
||||||
|
private ScalarFunction lazySubstitute;
|
||||||
|
|
||||||
|
public BaseSurrogateFunction(Source source) {
|
||||||
|
super(source);
|
||||||
|
}
|
||||||
|
|
||||||
|
public BaseSurrogateFunction(Source source, List<Expression> fields) {
|
||||||
|
super(source, fields);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScalarFunction substitute() {
|
||||||
|
if (lazySubstitute == null) {
|
||||||
|
lazySubstitute = makeSubstitute();
|
||||||
|
}
|
||||||
|
return lazySubstitute;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract ScalarFunction makeSubstitute();
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return substitute().foldable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object fold() {
|
||||||
|
return substitute().fold();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected Pipe makePipe() {
|
||||||
|
return substitute().asPipe();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
return substitute().asScript();
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,66 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.Scripts;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
|
public abstract class BinaryScalarFunction extends ScalarFunction {
|
||||||
|
|
||||||
|
private final Expression left, right;
|
||||||
|
|
||||||
|
protected BinaryScalarFunction(Source source, Expression left, Expression right) {
|
||||||
|
super(source, Arrays.asList(left, right));
|
||||||
|
this.left = left;
|
||||||
|
this.right = right;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final BinaryScalarFunction replaceChildren(List<Expression> newChildren) {
|
||||||
|
Expression newLeft = newChildren.get(0);
|
||||||
|
Expression newRight = newChildren.get(1);
|
||||||
|
|
||||||
|
return left.equals(newLeft) && right.equals(newRight) ? this : replaceChildren(newLeft, newRight);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract BinaryScalarFunction replaceChildren(Expression newLeft, Expression newRight);
|
||||||
|
|
||||||
|
public Expression left() {
|
||||||
|
return left;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression right() {
|
||||||
|
return right;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return left.foldable() && right.foldable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
ScriptTemplate leftScript = asScript(left());
|
||||||
|
ScriptTemplate rightScript = asScript(right());
|
||||||
|
|
||||||
|
return asScriptFrom(leftScript, rightScript);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate asScriptFrom(ScriptTemplate leftScript, ScriptTemplate rightScript) {
|
||||||
|
return Scripts.binaryMethod(Scripts.classPackageAsPrefix(getClass()), scriptMethodName(), leftScript, rightScript, dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected String scriptMethodName() {
|
||||||
|
return getClass().getSimpleName().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,28 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.session.Configuration;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
public abstract class ConfigurationFunction extends ScalarFunction {
|
||||||
|
|
||||||
|
private final Configuration configuration;
|
||||||
|
|
||||||
|
protected ConfigurationFunction(Source source, List<Expression> fields, Configuration configuration) {
|
||||||
|
super(source, fields);
|
||||||
|
this.configuration = configuration;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Configuration configuration() {
|
||||||
|
return configuration;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,19 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
// FIXME: accessor interface until making script generation pluggable
|
||||||
|
public interface IntervalScripting {
|
||||||
|
|
||||||
|
String script();
|
||||||
|
|
||||||
|
String value();
|
||||||
|
|
||||||
|
String typeName();
|
||||||
|
|
||||||
|
}
|
|
@ -0,0 +1,174 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.FieldAttribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.Function;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.aggregate.AggregateFunction;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.grouping.GroupingFunction;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.Params;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ParamsBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.Scripts;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.DateUtils;
|
||||||
|
|
||||||
|
import java.time.OffsetTime;
|
||||||
|
import java.time.ZonedDateTime;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
import static org.elasticsearch.common.logging.LoggerMessageFormat.format;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.gen.script.ParamsBuilder.paramsBuilder;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.gen.script.Scripts.PARAM;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.DATETIME;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.LONG;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.UNSIGNED_LONG;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@code ScalarFunction} is a {@code Function} that takes values from some
|
||||||
|
* operation and converts each to another value. An example would be
|
||||||
|
* {@code ABS()}, which takes one value at a time, applies a function to the
|
||||||
|
* value (abs) and returns a new value.
|
||||||
|
*/
|
||||||
|
public abstract class ScalarFunction extends Function {
|
||||||
|
|
||||||
|
protected ScalarFunction(Source source) {
|
||||||
|
super(source, emptyList());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScalarFunction(Source source, List<Expression> fields) {
|
||||||
|
super(source, fields);
|
||||||
|
}
|
||||||
|
|
||||||
|
//
|
||||||
|
// Script generation
|
||||||
|
//
|
||||||
|
public ScriptTemplate asScript(Expression exp) {
|
||||||
|
if (exp.foldable()) {
|
||||||
|
return scriptWithFoldable(exp);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (exp instanceof FieldAttribute) {
|
||||||
|
return scriptWithField((FieldAttribute) exp);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (exp instanceof ScalarFunction) {
|
||||||
|
return scriptWithScalar((ScalarFunction) exp);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (exp instanceof AggregateFunction) {
|
||||||
|
return scriptWithAggregate((AggregateFunction) exp);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (exp instanceof GroupingFunction) {
|
||||||
|
return scriptWithGrouping((GroupingFunction) exp);
|
||||||
|
}
|
||||||
|
throw new QlIllegalArgumentException("Cannot evaluate script for expression {}", exp);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate scriptWithFoldable(Expression foldable) {
|
||||||
|
Object fold = foldable.fold();
|
||||||
|
|
||||||
|
// FIXME: this needs to be refactored
|
||||||
|
//
|
||||||
|
// Custom type handling
|
||||||
|
//
|
||||||
|
|
||||||
|
// wrap intervals with dedicated methods for serialization
|
||||||
|
if (fold instanceof ZonedDateTime zdt) {
|
||||||
|
return new ScriptTemplate(
|
||||||
|
processScript("{sql}.asDateTime({})"),
|
||||||
|
paramsBuilder().variable(DateUtils.toString(zdt)).build(),
|
||||||
|
dataType()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (fold instanceof IntervalScripting is) {
|
||||||
|
return new ScriptTemplate(
|
||||||
|
processScript(is.script()),
|
||||||
|
paramsBuilder().variable(is.value()).variable(is.typeName()).build(),
|
||||||
|
dataType()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (fold instanceof OffsetTime ot) {
|
||||||
|
return new ScriptTemplate(processScript("{sql}.asTime({})"), paramsBuilder().variable(ot.toString()).build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
if (fold != null && fold.getClass().getSimpleName().equals("GeoShape")) {
|
||||||
|
return new ScriptTemplate(processScript("{sql}.stWktToSql({})"), paramsBuilder().variable(fold.toString()).build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
return new ScriptTemplate(processScript("{}"), paramsBuilder().variable(fold).build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate scriptWithScalar(ScalarFunction scalar) {
|
||||||
|
ScriptTemplate nested = scalar.asScript();
|
||||||
|
return new ScriptTemplate(processScript(nested.template()), paramsBuilder().script(nested.params()).build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate scriptWithAggregate(AggregateFunction aggregate) {
|
||||||
|
String template = PARAM;
|
||||||
|
ParamsBuilder paramsBuilder = paramsBuilder().agg(aggregate);
|
||||||
|
|
||||||
|
DataType nullSafeCastDataType = null;
|
||||||
|
DataType dataType = aggregate.dataType();
|
||||||
|
if (dataType.name().equals("DATE") || dataType == DATETIME ||
|
||||||
|
// Aggregations on date_nanos are returned as string
|
||||||
|
aggregate.field().dataType() == DATETIME) {
|
||||||
|
|
||||||
|
template = "{sql}.asDateTime({})";
|
||||||
|
} else if (dataType.isInteger()) {
|
||||||
|
// MAX, MIN need to retain field's data type, so that possible operations on integral types (like division) work
|
||||||
|
// correctly -> perform a cast in the aggs filtering script, the bucket selector for HAVING.
|
||||||
|
// SQL function classes not available in QL: filter by name
|
||||||
|
String fn = aggregate.functionName();
|
||||||
|
if ("MAX".equals(fn) || "MIN".equals(fn)) {
|
||||||
|
nullSafeCastDataType = dataType;
|
||||||
|
} else if ("SUM".equals(fn)) {
|
||||||
|
// SUM(integral_type) requires returning a LONG value
|
||||||
|
nullSafeCastDataType = LONG;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (nullSafeCastDataType != null) {
|
||||||
|
template = "{ql}.nullSafeCastNumeric({},{})";
|
||||||
|
paramsBuilder.variable(nullSafeCastDataType.name());
|
||||||
|
}
|
||||||
|
return new ScriptTemplate(processScript(template), paramsBuilder.build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
// This method isn't actually used at the moment, since there is no grouping function (ie HISTOGRAM)
|
||||||
|
// that currently results in a script being generated
|
||||||
|
protected ScriptTemplate scriptWithGrouping(GroupingFunction grouping) {
|
||||||
|
String template = PARAM;
|
||||||
|
return new ScriptTemplate(processScript(template), paramsBuilder().grouping(grouping).build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate scriptWithField(FieldAttribute field) {
|
||||||
|
Params params = paramsBuilder().variable(field.exactAttribute().name()).build();
|
||||||
|
// unsigned_long fields get returned in scripts as plain longs, so a conversion is required
|
||||||
|
return field.dataType() != UNSIGNED_LONG
|
||||||
|
? new ScriptTemplate(processScript(Scripts.DOC_VALUE), params, dataType())
|
||||||
|
: new ScriptTemplate(
|
||||||
|
processScript(format("{ql}.", "nullSafeCastToUnsignedLong({})", Scripts.DOC_VALUE)),
|
||||||
|
params,
|
||||||
|
UNSIGNED_LONG
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected String processScript(String script) {
|
||||||
|
return formatTemplate(script);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected String formatTemplate(String template) {
|
||||||
|
return Scripts.formatTemplate(template);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,13 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
public interface SurrogateFunction {
|
||||||
|
|
||||||
|
ScalarFunction substitute();
|
||||||
|
}
|
|
@ -0,0 +1,67 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expressions;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.UnaryPipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static java.util.Collections.singletonList;
|
||||||
|
|
||||||
|
public abstract class UnaryScalarFunction extends ScalarFunction {
|
||||||
|
|
||||||
|
private final Expression field;
|
||||||
|
|
||||||
|
protected UnaryScalarFunction(Source source) {
|
||||||
|
super(source);
|
||||||
|
this.field = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected UnaryScalarFunction(Source source, Expression field) {
|
||||||
|
super(source, singletonList(field));
|
||||||
|
this.field = field;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final UnaryScalarFunction replaceChildren(List<Expression> newChildren) {
|
||||||
|
return replaceChild(newChildren.get(0));
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract UnaryScalarFunction replaceChild(Expression newChild);
|
||||||
|
|
||||||
|
public Expression field() {
|
||||||
|
return field;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe makePipe() {
|
||||||
|
return new UnaryPipe(source(), this, Expressions.pipe(field()), makeProcessor());
|
||||||
|
}
|
||||||
|
|
||||||
|
protected abstract Processor makeProcessor();
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return field.foldable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object fold() {
|
||||||
|
return makeProcessor().process(field().fold());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
return asScript(field);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,118 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar.string;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.Scripts;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.lang.String.format;
|
||||||
|
import static java.util.Arrays.asList;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.ParamOrdinal.FIRST;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.ParamOrdinal.SECOND;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.isStringAndExact;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.gen.script.ParamsBuilder.paramsBuilder;
|
||||||
|
|
||||||
|
public abstract class BinaryComparisonCaseInsensitiveFunction extends CaseInsensitiveScalarFunction {
|
||||||
|
|
||||||
|
private final Expression left, right;
|
||||||
|
|
||||||
|
protected BinaryComparisonCaseInsensitiveFunction(Source source, Expression left, Expression right, boolean caseInsensitive) {
|
||||||
|
super(source, asList(left, right), caseInsensitive);
|
||||||
|
this.left = left;
|
||||||
|
this.right = right;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected TypeResolution resolveType() {
|
||||||
|
if (childrenResolved() == false) {
|
||||||
|
return new TypeResolution("Unresolved children");
|
||||||
|
}
|
||||||
|
|
||||||
|
TypeResolution sourceResolution = isStringAndExact(left, sourceText(), FIRST);
|
||||||
|
if (sourceResolution.unresolved()) {
|
||||||
|
return sourceResolution;
|
||||||
|
}
|
||||||
|
|
||||||
|
return isStringAndExact(right, sourceText(), SECOND);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression left() {
|
||||||
|
return left;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression right() {
|
||||||
|
return right;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return DataTypes.BOOLEAN;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return left.foldable() && right.foldable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
ScriptTemplate leftScript = asScript(left);
|
||||||
|
ScriptTemplate rightScript = asScript(right);
|
||||||
|
|
||||||
|
return asScriptFrom(leftScript, rightScript);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate asScriptFrom(ScriptTemplate leftScript, ScriptTemplate rightScript) {
|
||||||
|
return new ScriptTemplate(
|
||||||
|
format(
|
||||||
|
Locale.ROOT,
|
||||||
|
formatTemplate("%s.%s(%s,%s,%s)"),
|
||||||
|
Scripts.classPackageAsPrefix(getClass()),
|
||||||
|
scriptMethodName(),
|
||||||
|
leftScript.template(),
|
||||||
|
rightScript.template(),
|
||||||
|
"{}"
|
||||||
|
),
|
||||||
|
paramsBuilder().script(leftScript.params()).script(rightScript.params()).variable(isCaseInsensitive()).build(),
|
||||||
|
dataType()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected String scriptMethodName() {
|
||||||
|
String simpleName = getClass().getSimpleName();
|
||||||
|
return Character.toLowerCase(simpleName.charAt(0)) + simpleName.substring(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(left, right, isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
BinaryComparisonCaseInsensitiveFunction other = (BinaryComparisonCaseInsensitiveFunction) obj;
|
||||||
|
return Objects.equals(left, other.left)
|
||||||
|
&& Objects.equals(right, other.right)
|
||||||
|
&& Objects.equals(isCaseInsensitive(), other.isCaseInsensitive());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,53 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar.string;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.FieldAttribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.scalar.ScalarFunction;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.Scripts;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.gen.script.ParamsBuilder.paramsBuilder;
|
||||||
|
|
||||||
|
public abstract class CaseInsensitiveScalarFunction extends ScalarFunction {
|
||||||
|
|
||||||
|
private final boolean caseInsensitive;
|
||||||
|
|
||||||
|
protected CaseInsensitiveScalarFunction(Source source, List<Expression> fields, boolean caseInsensitive) {
|
||||||
|
super(source, fields);
|
||||||
|
this.caseInsensitive = caseInsensitive;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean isCaseInsensitive() {
|
||||||
|
return caseInsensitive;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate scriptWithField(FieldAttribute field) {
|
||||||
|
return new ScriptTemplate(
|
||||||
|
processScript(Scripts.DOC_VALUE),
|
||||||
|
paramsBuilder().variable(field.exactAttribute().name()).build(),
|
||||||
|
dataType()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(super.hashCode(), isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object other) {
|
||||||
|
return super.equals(other) && Objects.equals(((CaseInsensitiveScalarFunction) other).caseInsensitive, caseInsensitive);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,111 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar.string;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expressions;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.FieldAttribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ParamsBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.ScriptTemplate;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.script.Scripts;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataType;
|
||||||
|
import org.elasticsearch.xpack.esql.core.type.DataTypes;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.ParamOrdinal.FIRST;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.ParamOrdinal.SECOND;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.TypeResolutions.isStringAndExact;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.function.scalar.string.StartsWithFunctionProcessor.doProcess;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.expression.gen.script.ParamsBuilder.paramsBuilder;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Function that checks if first parameter starts with the second parameter. Both parameters should be strings
|
||||||
|
* and the function returns a boolean value.
|
||||||
|
*/
|
||||||
|
public abstract class StartsWith extends CaseInsensitiveScalarFunction {
|
||||||
|
|
||||||
|
private final Expression input;
|
||||||
|
private final Expression pattern;
|
||||||
|
|
||||||
|
public StartsWith(Source source, Expression input, Expression pattern, boolean caseInsensitive) {
|
||||||
|
super(source, Arrays.asList(input, pattern), caseInsensitive);
|
||||||
|
this.input = input;
|
||||||
|
this.pattern = pattern;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected TypeResolution resolveType() {
|
||||||
|
if (childrenResolved() == false) {
|
||||||
|
return new TypeResolution("Unresolved children");
|
||||||
|
}
|
||||||
|
|
||||||
|
TypeResolution fieldResolution = isStringAndExact(input, sourceText(), FIRST);
|
||||||
|
if (fieldResolution.unresolved()) {
|
||||||
|
return fieldResolution;
|
||||||
|
}
|
||||||
|
|
||||||
|
return isStringAndExact(pattern, sourceText(), SECOND);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression input() {
|
||||||
|
return input;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Expression pattern() {
|
||||||
|
return pattern;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Pipe makePipe() {
|
||||||
|
return new StartsWithFunctionPipe(source(), this, Expressions.pipe(input), Expressions.pipe(pattern), isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean foldable() {
|
||||||
|
return input.foldable() && pattern.foldable();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object fold() {
|
||||||
|
return doProcess(input.fold(), pattern.fold(), isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate asScript() {
|
||||||
|
ScriptTemplate fieldScript = asScript(input);
|
||||||
|
ScriptTemplate patternScript = asScript(pattern);
|
||||||
|
|
||||||
|
return asScriptFrom(fieldScript, patternScript);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected ScriptTemplate asScriptFrom(ScriptTemplate fieldScript, ScriptTemplate patternScript) {
|
||||||
|
ParamsBuilder params = paramsBuilder();
|
||||||
|
|
||||||
|
String template = formatTemplate("{ql}.startsWith(" + fieldScript.template() + ", " + patternScript.template() + ", {})");
|
||||||
|
params.script(fieldScript.params()).script(patternScript.params()).variable(isCaseInsensitive());
|
||||||
|
|
||||||
|
return new ScriptTemplate(template, params.build(), dataType());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public ScriptTemplate scriptWithField(FieldAttribute field) {
|
||||||
|
return new ScriptTemplate(
|
||||||
|
processScript(Scripts.DOC_VALUE),
|
||||||
|
paramsBuilder().variable(field.exactAttribute().name()).build(),
|
||||||
|
dataType()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public DataType dataType() {
|
||||||
|
return DataTypes.BOOLEAN;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,109 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar.string;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.pipeline.Pipe;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
public class StartsWithFunctionPipe extends Pipe {
|
||||||
|
|
||||||
|
private final Pipe input;
|
||||||
|
private final Pipe pattern;
|
||||||
|
private final boolean isCaseSensitive;
|
||||||
|
|
||||||
|
public StartsWithFunctionPipe(Source source, Expression expression, Pipe input, Pipe pattern, boolean isCaseSensitive) {
|
||||||
|
super(source, expression, Arrays.asList(input, pattern));
|
||||||
|
this.input = input;
|
||||||
|
this.pattern = pattern;
|
||||||
|
this.isCaseSensitive = isCaseSensitive;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe replaceChildren(List<Pipe> newChildren) {
|
||||||
|
return replaceChildren(newChildren.get(0), newChildren.get(1));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
Pipe newField = input.resolveAttributes(resolver);
|
||||||
|
Pipe newPattern = pattern.resolveAttributes(resolver);
|
||||||
|
if (newField == input && newPattern == pattern) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
return replaceChildren(newField, newPattern);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean supportedByAggsOnlyQuery() {
|
||||||
|
return input.supportedByAggsOnlyQuery() && pattern.supportedByAggsOnlyQuery();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return input.resolved() && pattern.resolved();
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Pipe replaceChildren(Pipe newField, Pipe newPattern) {
|
||||||
|
return new StartsWithFunctionPipe(source(), expression(), newField, newPattern, isCaseSensitive);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
input.collectFields(sourceBuilder);
|
||||||
|
pattern.collectFields(sourceBuilder);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<StartsWithFunctionPipe> info() {
|
||||||
|
return NodeInfo.create(this, StartsWithFunctionPipe::new, expression(), input, pattern, isCaseSensitive);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public StartsWithFunctionProcessor asProcessor() {
|
||||||
|
return new StartsWithFunctionProcessor(input.asProcessor(), pattern.asProcessor(), isCaseSensitive);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Pipe input() {
|
||||||
|
return input;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Pipe pattern() {
|
||||||
|
return pattern;
|
||||||
|
}
|
||||||
|
|
||||||
|
public boolean isCaseSensitive() {
|
||||||
|
return isCaseSensitive;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(input, pattern, isCaseSensitive);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
StartsWithFunctionPipe other = (StartsWithFunctionPipe) obj;
|
||||||
|
return Objects.equals(input, other.input)
|
||||||
|
&& Objects.equals(pattern, other.pattern)
|
||||||
|
&& Objects.equals(isCaseSensitive, other.isCaseSensitive);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,108 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar.string;
|
||||||
|
|
||||||
|
import org.elasticsearch.common.io.stream.StreamInput;
|
||||||
|
import org.elasticsearch.common.io.stream.StreamOutput;
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
public class StartsWithFunctionProcessor implements Processor {
|
||||||
|
|
||||||
|
public static final String NAME = "sstw";
|
||||||
|
|
||||||
|
private final Processor source;
|
||||||
|
private final Processor pattern;
|
||||||
|
private final boolean caseInsensitive;
|
||||||
|
|
||||||
|
public StartsWithFunctionProcessor(Processor source, Processor pattern, boolean caseInsensitive) {
|
||||||
|
this.source = source;
|
||||||
|
this.pattern = pattern;
|
||||||
|
this.caseInsensitive = caseInsensitive;
|
||||||
|
}
|
||||||
|
|
||||||
|
public StartsWithFunctionProcessor(StreamInput in) throws IOException {
|
||||||
|
source = in.readNamedWriteable(Processor.class);
|
||||||
|
pattern = in.readNamedWriteable(Processor.class);
|
||||||
|
caseInsensitive = in.readBoolean();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void writeTo(StreamOutput out) throws IOException {
|
||||||
|
out.writeNamedWriteable(source);
|
||||||
|
out.writeNamedWriteable(pattern);
|
||||||
|
out.writeBoolean(caseInsensitive);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Object process(Object input) {
|
||||||
|
return doProcess(source.process(input), pattern.process(input), isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Object doProcess(Object source, Object pattern, boolean caseInsensitive) {
|
||||||
|
if (source == null) {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
if (source instanceof String == false && source instanceof Character == false) {
|
||||||
|
throw new QlIllegalArgumentException("A string/char is required; received [{}]", source);
|
||||||
|
}
|
||||||
|
if (pattern == null) {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
if (pattern instanceof String == false && pattern instanceof Character == false) {
|
||||||
|
throw new QlIllegalArgumentException("A string/char is required; received [{}]", pattern);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (caseInsensitive == false) {
|
||||||
|
return source.toString().startsWith(pattern.toString());
|
||||||
|
} else {
|
||||||
|
return source.toString().toLowerCase(Locale.ROOT).startsWith(pattern.toString().toLowerCase(Locale.ROOT));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Processor source() {
|
||||||
|
return source;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Processor pattern() {
|
||||||
|
return pattern;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected boolean isCaseInsensitive() {
|
||||||
|
return caseInsensitive;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
StartsWithFunctionProcessor other = (StartsWithFunctionProcessor) obj;
|
||||||
|
return Objects.equals(source(), other.source())
|
||||||
|
&& Objects.equals(pattern(), other.pattern())
|
||||||
|
&& Objects.equals(isCaseInsensitive(), other.isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(source(), pattern(), isCaseInsensitive());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getWriteableName() {
|
||||||
|
return NAME;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,170 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.function.scalar.whitelist;
|
||||||
|
|
||||||
|
import org.elasticsearch.index.fielddata.ScriptDocValues;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.function.scalar.string.StartsWithFunctionProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.logical.BinaryLogicProcessor.BinaryLogicOperation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.logical.NotProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.nulls.CheckNullProcessor.CheckNullOperation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.operator.arithmetic.DefaultBinaryArithmeticOperation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.operator.arithmetic.UnaryArithmeticProcessor.UnaryArithmeticOperation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.operator.comparison.BinaryComparisonProcessor.BinaryComparisonOperation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.operator.comparison.InProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.predicate.regex.RegexProcessor.RegexOperation;
|
||||||
|
import org.elasticsearch.xpack.esql.core.util.StringUtils;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypeConverter.convert;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypeConverter.toUnsignedLong;
|
||||||
|
import static org.elasticsearch.xpack.esql.core.type.DataTypes.fromTypeName;
|
||||||
|
|
||||||
|
public class InternalQlScriptUtils {
|
||||||
|
|
||||||
|
//
|
||||||
|
// Utilities
|
||||||
|
//
|
||||||
|
|
||||||
|
// safe missing mapping/value extractor
|
||||||
|
public static <T> Object docValue(Map<String, ScriptDocValues<T>> doc, String fieldName) {
|
||||||
|
if (doc.containsKey(fieldName)) {
|
||||||
|
ScriptDocValues<T> docValues = doc.get(fieldName);
|
||||||
|
if (docValues.isEmpty() == false) {
|
||||||
|
return docValues.get(0);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static boolean nullSafeFilter(Boolean filter) {
|
||||||
|
return filter == null ? false : filter.booleanValue();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static double nullSafeSortNumeric(Number sort) {
|
||||||
|
return sort == null ? 0.0d : sort.doubleValue();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static String nullSafeSortString(Object sort) {
|
||||||
|
return sort == null ? StringUtils.EMPTY : sort.toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number nullSafeCastNumeric(Number number, String typeName) {
|
||||||
|
return number == null || Double.isNaN(number.doubleValue()) ? null : (Number) convert(number, fromTypeName(typeName));
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number nullSafeCastToUnsignedLong(Number number) {
|
||||||
|
return number == null || Double.isNaN(number.doubleValue()) ? null : toUnsignedLong(number);
|
||||||
|
}
|
||||||
|
|
||||||
|
//
|
||||||
|
// Operators
|
||||||
|
//
|
||||||
|
|
||||||
|
//
|
||||||
|
// Logical
|
||||||
|
//
|
||||||
|
public static Boolean eq(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.EQ.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean nulleq(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.NULLEQ.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean neq(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.NEQ.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean lt(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.LT.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean lte(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.LTE.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean gt(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.GT.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean gte(Object left, Object right) {
|
||||||
|
return BinaryComparisonOperation.GTE.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean in(Object value, List<Object> values) {
|
||||||
|
return InProcessor.apply(value, values);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean and(Boolean left, Boolean right) {
|
||||||
|
return BinaryLogicOperation.AND.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean or(Boolean left, Boolean right) {
|
||||||
|
return BinaryLogicOperation.OR.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean not(Boolean expression) {
|
||||||
|
return NotProcessor.apply(expression);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean isNull(Object expression) {
|
||||||
|
return CheckNullOperation.IS_NULL.test(expression);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean isNotNull(Object expression) {
|
||||||
|
return CheckNullOperation.IS_NOT_NULL.test(expression);
|
||||||
|
}
|
||||||
|
|
||||||
|
//
|
||||||
|
// Regex
|
||||||
|
//
|
||||||
|
public static Boolean regex(String value, String pattern) {
|
||||||
|
return regex(value, pattern, Boolean.FALSE);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Boolean regex(String value, String pattern, Boolean caseInsensitive) {
|
||||||
|
// TODO: this needs to be improved to avoid creating the pattern on every call
|
||||||
|
return RegexOperation.match(value, pattern, caseInsensitive);
|
||||||
|
}
|
||||||
|
|
||||||
|
//
|
||||||
|
// Math
|
||||||
|
//
|
||||||
|
public static Number add(Number left, Number right) {
|
||||||
|
return (Number) DefaultBinaryArithmeticOperation.ADD.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number div(Number left, Number right) {
|
||||||
|
return (Number) DefaultBinaryArithmeticOperation.DIV.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number mod(Number left, Number right) {
|
||||||
|
return (Number) DefaultBinaryArithmeticOperation.MOD.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number mul(Number left, Number right) {
|
||||||
|
return (Number) DefaultBinaryArithmeticOperation.MUL.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number neg(Number value) {
|
||||||
|
return UnaryArithmeticOperation.NEGATE.apply(value);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static Number sub(Number left, Number right) {
|
||||||
|
return (Number) DefaultBinaryArithmeticOperation.SUB.apply(left, right);
|
||||||
|
}
|
||||||
|
|
||||||
|
//
|
||||||
|
// String
|
||||||
|
//
|
||||||
|
public static Boolean startsWith(String s, String pattern, Boolean caseInsensitive) {
|
||||||
|
return (Boolean) StartsWithFunctionProcessor.doProcess(s, pattern, caseInsensitive);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,52 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.extractor.BucketExtractor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.BucketExtractorProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.ChainingProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
public class AggExtractorInput extends LeafInput<BucketExtractor> {
|
||||||
|
|
||||||
|
private final Processor chained;
|
||||||
|
|
||||||
|
public AggExtractorInput(Source source, Expression expression, Processor processor, BucketExtractor context) {
|
||||||
|
super(source, expression, context);
|
||||||
|
this.chained = processor;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<AggExtractorInput> info() {
|
||||||
|
return NodeInfo.create(this, AggExtractorInput::new, expression(), chained, context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Processor asProcessor() {
|
||||||
|
Processor proc = new BucketExtractorProcessor(context());
|
||||||
|
return chained != null ? new ChainingProcessor(proc, chained) : proc;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean supportedByAggsOnlyQuery() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
// Nothing to collect
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,32 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
public class AggNameInput extends CommonNonExecutableInput<String> {
|
||||||
|
public AggNameInput(Source source, Expression expression, String context) {
|
||||||
|
super(source, expression, context);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<AggNameInput> info() {
|
||||||
|
return NodeInfo.create(this, AggNameInput::new, expression(), context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean supportedByAggsOnlyQuery() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean resolved() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,74 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.AggRef;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
public class AggPathInput extends CommonNonExecutableInput<AggRef> {
|
||||||
|
|
||||||
|
// used in case the agg itself is not returned in a suitable format (like date aggs)
|
||||||
|
private final Processor action;
|
||||||
|
|
||||||
|
public AggPathInput(Expression expression, AggRef context) {
|
||||||
|
this(Source.EMPTY, expression, context, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* Constructs a new <code>AggPathInput</code> instance.
|
||||||
|
* The action is used for handling corner-case results such as date histogram which returns
|
||||||
|
* a full date object for year which requires additional extraction.
|
||||||
|
*/
|
||||||
|
public AggPathInput(Source source, Expression expression, AggRef context, Processor action) {
|
||||||
|
super(source, expression, context);
|
||||||
|
this.action = action;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<AggPathInput> info() {
|
||||||
|
return NodeInfo.create(this, AggPathInput::new, expression(), context(), action);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Processor action() {
|
||||||
|
return action;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean supportedByAggsOnlyQuery() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(context(), action);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
AggPathInput other = (AggPathInput) obj;
|
||||||
|
return Objects.equals(context(), other.context()) && Objects.equals(action, other.action);
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,43 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Attribute;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An input that must first be rewritten against the rest of the query
|
||||||
|
* before it can be further processed.
|
||||||
|
*/
|
||||||
|
public class AttributeInput extends NonExecutableInput<Attribute> {
|
||||||
|
public AttributeInput(Source source, Expression expression, Attribute context) {
|
||||||
|
super(source, expression, context);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<AttributeInput> info() {
|
||||||
|
return NodeInfo.create(this, AttributeInput::new, expression(), context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean supportedByAggsOnlyQuery() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
return new ReferenceInput(source(), expression(), resolver.resolve(context()));
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
// Nothing to extract
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,90 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
public abstract class BinaryPipe extends Pipe {
|
||||||
|
|
||||||
|
private final Pipe left, right;
|
||||||
|
|
||||||
|
public BinaryPipe(Source source, Expression expression, Pipe left, Pipe right) {
|
||||||
|
super(source, expression, Arrays.asList(left, right));
|
||||||
|
this.left = left;
|
||||||
|
this.right = right;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe replaceChildren(List<Pipe> newChildren) {
|
||||||
|
return replaceChildren(newChildren.get(0), newChildren.get(1));
|
||||||
|
}
|
||||||
|
|
||||||
|
public Pipe left() {
|
||||||
|
return left;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Pipe right() {
|
||||||
|
return right;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean supportedByAggsOnlyQuery() {
|
||||||
|
return left.supportedByAggsOnlyQuery() || right.supportedByAggsOnlyQuery();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
Pipe newLeft = left.resolveAttributes(resolver);
|
||||||
|
Pipe newRight = right.resolveAttributes(resolver);
|
||||||
|
if (newLeft == left && newRight == right) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
return replaceChildren(newLeft, newRight);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build a copy of this object with new left and right children. Used by
|
||||||
|
* {@link #resolveAttributes(AttributeResolver)}.
|
||||||
|
*/
|
||||||
|
protected abstract BinaryPipe replaceChildren(Pipe left, Pipe right);
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return left().resolved() && right().resolved();
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
left.collectFields(sourceBuilder);
|
||||||
|
right.collectFields(sourceBuilder);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(left(), right());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
BinaryPipe other = (BinaryPipe) obj;
|
||||||
|
return Objects.equals(left(), other.left()) && Objects.equals(right(), other.right());
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,38 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.QlIllegalArgumentException;
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Implementation common to most subclasses of
|
||||||
|
* {@link NonExecutableInput} but not shared by all.
|
||||||
|
*/
|
||||||
|
abstract class CommonNonExecutableInput<T> extends NonExecutableInput<T> {
|
||||||
|
CommonNonExecutableInput(Source source, Expression expression, T context) {
|
||||||
|
super(source, expression, context);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Processor asProcessor() {
|
||||||
|
throw new QlIllegalArgumentException("Unresolved input - needs resolving first");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
// Nothing to extract
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,46 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.ConstantProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
public class ConstantInput extends LeafInput<Object> {
|
||||||
|
|
||||||
|
public ConstantInput(Source source, Expression expression, Object context) {
|
||||||
|
super(source, expression, context);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<ConstantInput> info() {
|
||||||
|
return NodeInfo.create(this, ConstantInput::new, expression(), context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Processor asProcessor() {
|
||||||
|
return new ConstantProcessor(context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean supportedByAggsOnlyQuery() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
// Nothing to collect
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,47 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.QlSourceBuilder;
|
||||||
|
import org.elasticsearch.xpack.esql.core.execution.search.extractor.HitExtractor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.HitExtractorProcessor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.gen.processor.Processor;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.NodeInfo;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
public class HitExtractorInput extends LeafInput<HitExtractor> {
|
||||||
|
|
||||||
|
public HitExtractorInput(Source source, Expression expression, HitExtractor context) {
|
||||||
|
super(source, expression, context);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected NodeInfo<HitExtractorInput> info() {
|
||||||
|
return NodeInfo.create(this, HitExtractorInput::new, expression(), context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Processor asProcessor() {
|
||||||
|
return new HitExtractorProcessor(context());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final boolean supportedByAggsOnlyQuery() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public Pipe resolveAttributes(AttributeResolver resolver) {
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final void collectFields(QlSourceBuilder sourceBuilder) {
|
||||||
|
// No fields to collect
|
||||||
|
}
|
||||||
|
}
|
|
@ -0,0 +1,58 @@
|
||||||
|
/*
|
||||||
|
* Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one
|
||||||
|
* or more contributor license agreements. Licensed under the Elastic License
|
||||||
|
* 2.0; you may not use this file except in compliance with the Elastic License
|
||||||
|
* 2.0.
|
||||||
|
*/
|
||||||
|
package org.elasticsearch.xpack.esql.core.expression.gen.pipeline;
|
||||||
|
|
||||||
|
import org.elasticsearch.xpack.esql.core.expression.Expression;
|
||||||
|
import org.elasticsearch.xpack.esql.core.tree.Source;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Collections.emptyList;
|
||||||
|
|
||||||
|
public abstract class LeafInput<T> extends Pipe {
|
||||||
|
|
||||||
|
private T context;
|
||||||
|
|
||||||
|
public LeafInput(Source source, Expression expression, T context) {
|
||||||
|
super(source, expression, emptyList());
|
||||||
|
this.context = context;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public final Pipe replaceChildren(List<Pipe> newChildren) {
|
||||||
|
throw new UnsupportedOperationException("this type of node doesn't have any children to replace");
|
||||||
|
}
|
||||||
|
|
||||||
|
public T context() {
|
||||||
|
return context;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean resolved() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(expression(), context);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object obj) {
|
||||||
|
if (this == obj) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (obj == null || getClass() != obj.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
LeafInput<?> other = (LeafInput<?>) obj;
|
||||||
|
return Objects.equals(context(), other.context()) && Objects.equals(expression(), other.expression());
|
||||||
|
}
|
||||||
|
}
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue